From 7693f2ab54376428c6f1d3c2710edbd584898771 Mon Sep 17 00:00:00 2001 From: Winicius Silva Date: Thu, 19 Feb 2026 16:05:34 +0000 Subject: [PATCH 1/2] Scaffolding the AddressScope controller go run ./cmd/scaffold-controller \ -interactive=false \ -kind AddressScope \ -gophercloud-client NewNetworkV2 \ -gophercloud-module github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/layer3/addressscopes \ -optional-create-dependency Project \ -import-dependency Project --- api/v1alpha1/addressscope_types.go | 88 ++++++ api/v1alpha1/zz_generated.deepcopy.go | 75 +++++ cmd/models-schema/zz_generated.openapi.go | 105 +++++++ config/rbac/role.yaml | 2 + .../openstack_v1alpha1_addressscope.yaml | 14 + internal/controllers/addressscope/actuator.go | 273 ++++++++++++++++++ .../controllers/addressscope/actuator_test.go | 119 ++++++++ .../controllers/addressscope/controller.go | 114 ++++++++ internal/controllers/addressscope/status.go | 64 ++++ .../addressscope-create-full/00-assert.yaml | 33 +++ .../00-create-resource.yaml | 29 ++ .../addressscope-create-full/00-secret.yaml | 6 + .../tests/addressscope-create-full/README.md | 11 + .../00-assert.yaml | 27 ++ .../00-create-resource.yaml | 14 + .../00-secret.yaml | 6 + .../01-assert.yaml | 11 + .../01-delete-secret.yaml | 7 + .../addressscope-create-minimal/README.md | 15 + .../addressscope-dependency/00-assert.yaml | 30 ++ .../00-create-resources-missing-deps.yaml | 27 ++ .../addressscope-dependency/00-secret.yaml | 6 + .../addressscope-dependency/01-assert.yaml | 30 ++ .../01-create-dependencies.yaml | 19 ++ .../addressscope-dependency/02-assert.yaml | 17 ++ .../02-delete-dependencies.yaml | 9 + .../addressscope-dependency/03-assert.yaml | 9 + .../03-delete-resources.yaml | 10 + .../tests/addressscope-dependency/README.md | 21 ++ .../00-assert.yaml | 17 ++ .../00-import-resource.yaml | 26 ++ .../00-secret.yaml | 6 + .../01-assert.yaml | 32 ++ .../01-create-trap-resource.yaml | 28 ++ .../02-assert.yaml | 34 +++ .../02-create-resource.yaml | 27 ++ .../03-assert.yaml | 6 + .../03-delete-import-dependencies.yaml | 7 + .../04-assert.yaml | 6 + .../04-delete-resource.yaml | 7 + .../addressscope-import-dependency/README.md | 29 ++ .../addressscope-import-error/00-assert.yaml | 30 ++ .../00-create-resources.yaml | 28 ++ .../addressscope-import-error/00-secret.yaml | 6 + .../addressscope-import-error/01-assert.yaml | 15 + .../01-import-resource.yaml | 13 + .../tests/addressscope-import-error/README.md | 13 + .../tests/addressscope-import/00-assert.yaml | 15 + .../00-import-resource.yaml | 15 + .../tests/addressscope-import/00-secret.yaml | 6 + .../tests/addressscope-import/01-assert.yaml | 34 +++ .../01-create-trap-resource.yaml | 17 ++ .../tests/addressscope-import/02-assert.yaml | 33 +++ .../02-create-resource.yaml | 14 + .../tests/addressscope-import/README.md | 18 ++ .../tests/addressscope-update/00-assert.yaml | 26 ++ .../00-minimal-resource.yaml | 14 + .../tests/addressscope-update/00-secret.yaml | 6 + .../tests/addressscope-update/01-assert.yaml | 17 ++ .../01-updated-resource.yaml | 10 + .../tests/addressscope-update/02-assert.yaml | 26 ++ .../02-reverted-resource.yaml | 7 + .../tests/addressscope-update/README.md | 17 ++ internal/osclients/addressscope.go | 104 +++++++ website/docs/crd-reference.md | 10 + 65 files changed, 1910 insertions(+) create mode 100644 api/v1alpha1/addressscope_types.go create mode 100644 config/samples/openstack_v1alpha1_addressscope.yaml create mode 100644 internal/controllers/addressscope/actuator.go create mode 100644 internal/controllers/addressscope/actuator_test.go create mode 100644 internal/controllers/addressscope/controller.go create mode 100644 internal/controllers/addressscope/status.go create mode 100644 internal/controllers/addressscope/tests/addressscope-create-full/00-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-create-full/00-create-resource.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-create-full/00-secret.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-create-full/README.md create mode 100644 internal/controllers/addressscope/tests/addressscope-create-minimal/00-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-create-minimal/00-create-resource.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-create-minimal/00-secret.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-create-minimal/01-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-create-minimal/01-delete-secret.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-create-minimal/README.md create mode 100644 internal/controllers/addressscope/tests/addressscope-dependency/00-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-dependency/00-create-resources-missing-deps.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-dependency/00-secret.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-dependency/01-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-dependency/01-create-dependencies.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-dependency/02-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-dependency/02-delete-dependencies.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-dependency/03-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-dependency/03-delete-resources.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-dependency/README.md create mode 100644 internal/controllers/addressscope/tests/addressscope-import-dependency/00-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-dependency/00-import-resource.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-dependency/00-secret.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-dependency/01-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-dependency/01-create-trap-resource.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-dependency/02-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-dependency/02-create-resource.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-dependency/03-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-dependency/03-delete-import-dependencies.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-dependency/04-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-dependency/04-delete-resource.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-dependency/README.md create mode 100644 internal/controllers/addressscope/tests/addressscope-import-error/00-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-error/00-create-resources.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-error/00-secret.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-error/01-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-error/01-import-resource.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import-error/README.md create mode 100644 internal/controllers/addressscope/tests/addressscope-import/00-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import/00-import-resource.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import/00-secret.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import/01-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import/01-create-trap-resource.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import/02-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import/02-create-resource.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-import/README.md create mode 100644 internal/controllers/addressscope/tests/addressscope-update/00-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-update/00-minimal-resource.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-update/00-secret.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-update/01-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-update/01-updated-resource.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-update/02-assert.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-update/02-reverted-resource.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-update/README.md create mode 100644 internal/osclients/addressscope.go diff --git a/api/v1alpha1/addressscope_types.go b/api/v1alpha1/addressscope_types.go new file mode 100644 index 000000000..d7f47e804 --- /dev/null +++ b/api/v1alpha1/addressscope_types.go @@ -0,0 +1,88 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package v1alpha1 + +// AddressScopeResourceSpec contains the desired state of the resource. +type AddressScopeResourceSpec struct { + // name will be the name of the created resource. If not specified, the + // name of the ORC object will be used. + // +optional + Name *OpenStackName `json:"name,omitempty"` + + // description is a human-readable description for the resource. + // +kubebuilder:validation:MinLength:=1 + // +kubebuilder:validation:MaxLength:=255 + // +optional + Description *string `json:"description,omitempty"` + + // projectRef is a reference to the ORC Project which this resource is associated with. + // +optional + // +kubebuilder:validation:XValidation:rule="self == oldSelf",message="projectRef is immutable" + ProjectRef *KubernetesNameRef `json:"projectRef,omitempty"` + + // TODO(scaffolding): Add more types. + // To see what is supported, you can take inspiration from the CreateOpts structure from + // github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/layer3/addressscopes + // + // Until you have implemented mutability for the field, you must add a CEL validation + // preventing the field being modified: + // `// +kubebuilder:validation:XValidation:rule="self == oldSelf",message=" is immutable"` +} + +// AddressScopeFilter defines an existing resource by its properties +// +kubebuilder:validation:MinProperties:=1 +type AddressScopeFilter struct { + // name of the existing resource + // +optional + Name *OpenStackName `json:"name,omitempty"` + + // description of the existing resource + // +kubebuilder:validation:MinLength:=1 + // +kubebuilder:validation:MaxLength:=255 + // +optional + Description *string `json:"description,omitempty"` + + // projectRef is a reference to the ORC Project which this resource is associated with. + // +optional + ProjectRef *KubernetesNameRef `json:"projectRef,omitempty"` + + // TODO(scaffolding): Add more types. + // To see what is supported, you can take inspiration from the ListOpts structure from + // github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/layer3/addressscopes +} + +// AddressScopeResourceStatus represents the observed state of the resource. +type AddressScopeResourceStatus struct { + // name is a Human-readable name for the resource. Might not be unique. + // +kubebuilder:validation:MaxLength=1024 + // +optional + Name string `json:"name,omitempty"` + + // description is a human-readable description for the resource. + // +kubebuilder:validation:MaxLength=1024 + // +optional + Description string `json:"description,omitempty"` + + // projectID is the ID of the Project to which the resource is associated. + // +kubebuilder:validation:MaxLength=1024 + // +optional + ProjectID string `json:"projectID,omitempty"` + + // TODO(scaffolding): Add more types. + // To see what is supported, you can take inspiration from the AddressScope structure from + // github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/layer3/addressscopes +} diff --git a/api/v1alpha1/zz_generated.deepcopy.go b/api/v1alpha1/zz_generated.deepcopy.go index 3f9a9f21f..bc18dc6d0 100644 --- a/api/v1alpha1/zz_generated.deepcopy.go +++ b/api/v1alpha1/zz_generated.deepcopy.go @@ -45,6 +45,81 @@ func (in *Address) DeepCopy() *Address { return out } +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *AddressScopeFilter) DeepCopyInto(out *AddressScopeFilter) { + *out = *in + if in.Name != nil { + in, out := &in.Name, &out.Name + *out = new(OpenStackName) + **out = **in + } + if in.Description != nil { + in, out := &in.Description, &out.Description + *out = new(string) + **out = **in + } + if in.ProjectRef != nil { + in, out := &in.ProjectRef, &out.ProjectRef + *out = new(KubernetesNameRef) + **out = **in + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AddressScopeFilter. +func (in *AddressScopeFilter) DeepCopy() *AddressScopeFilter { + if in == nil { + return nil + } + out := new(AddressScopeFilter) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *AddressScopeResourceSpec) DeepCopyInto(out *AddressScopeResourceSpec) { + *out = *in + if in.Name != nil { + in, out := &in.Name, &out.Name + *out = new(OpenStackName) + **out = **in + } + if in.Description != nil { + in, out := &in.Description, &out.Description + *out = new(string) + **out = **in + } + if in.ProjectRef != nil { + in, out := &in.ProjectRef, &out.ProjectRef + *out = new(KubernetesNameRef) + **out = **in + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AddressScopeResourceSpec. +func (in *AddressScopeResourceSpec) DeepCopy() *AddressScopeResourceSpec { + if in == nil { + return nil + } + out := new(AddressScopeResourceSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *AddressScopeResourceStatus) DeepCopyInto(out *AddressScopeResourceStatus) { + *out = *in +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AddressScopeResourceStatus. +func (in *AddressScopeResourceStatus) DeepCopy() *AddressScopeResourceStatus { + if in == nil { + return nil + } + out := new(AddressScopeResourceStatus) + in.DeepCopyInto(out) + return out +} + // DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. func (in *AllocationPool) DeepCopyInto(out *AllocationPool) { *out = *in diff --git a/cmd/models-schema/zz_generated.openapi.go b/cmd/models-schema/zz_generated.openapi.go index d00ee16e4..81b3df785 100644 --- a/cmd/models-schema/zz_generated.openapi.go +++ b/cmd/models-schema/zz_generated.openapi.go @@ -31,6 +31,9 @@ import ( func GetOpenAPIDefinitions(ref common.ReferenceCallback) map[string]common.OpenAPIDefinition { return map[string]common.OpenAPIDefinition{ "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.Address": schema_openstack_resource_controller_v2_api_v1alpha1_Address(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeFilter": schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeFilter(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeResourceSpec": schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeResourceSpec(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeResourceStatus": schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeResourceStatus(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AllocationPool": schema_openstack_resource_controller_v2_api_v1alpha1_AllocationPool(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AllocationPoolStatus": schema_openstack_resource_controller_v2_api_v1alpha1_AllocationPoolStatus(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AllowedAddressPair": schema_openstack_resource_controller_v2_api_v1alpha1_AllowedAddressPair(ref), @@ -561,6 +564,108 @@ func schema_openstack_resource_controller_v2_api_v1alpha1_Address(ref common.Ref } } +func schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeFilter(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "AddressScopeFilter defines an existing resource by its properties", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "name": { + SchemaProps: spec.SchemaProps{ + Description: "name of the existing resource", + Type: []string{"string"}, + Format: "", + }, + }, + "description": { + SchemaProps: spec.SchemaProps{ + Description: "description of the existing resource", + Type: []string{"string"}, + Format: "", + }, + }, + "projectRef": { + SchemaProps: spec.SchemaProps{ + Description: "projectRef is a reference to the ORC Project which this resource is associated with.", + Type: []string{"string"}, + Format: "", + }, + }, + }, + }, + }, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeResourceSpec(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "AddressScopeResourceSpec contains the desired state of the resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "name": { + SchemaProps: spec.SchemaProps{ + Description: "name will be the name of the created resource. If not specified, the name of the ORC object will be used.", + Type: []string{"string"}, + Format: "", + }, + }, + "description": { + SchemaProps: spec.SchemaProps{ + Description: "description is a human-readable description for the resource.", + Type: []string{"string"}, + Format: "", + }, + }, + "projectRef": { + SchemaProps: spec.SchemaProps{ + Description: "projectRef is a reference to the ORC Project which this resource is associated with.", + Type: []string{"string"}, + Format: "", + }, + }, + }, + }, + }, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeResourceStatus(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "AddressScopeResourceStatus represents the observed state of the resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "name": { + SchemaProps: spec.SchemaProps{ + Description: "name is a Human-readable name for the resource. Might not be unique.", + Type: []string{"string"}, + Format: "", + }, + }, + "description": { + SchemaProps: spec.SchemaProps{ + Description: "description is a human-readable description for the resource.", + Type: []string{"string"}, + Format: "", + }, + }, + "projectID": { + SchemaProps: spec.SchemaProps{ + Description: "projectID is the ID of the Project to which the resource is associated.", + Type: []string{"string"}, + Format: "", + }, + }, + }, + }, + }, + } +} + func schema_openstack_resource_controller_v2_api_v1alpha1_AllocationPool(ref common.ReferenceCallback) common.OpenAPIDefinition { return common.OpenAPIDefinition{ Schema: spec.Schema{ diff --git a/config/rbac/role.yaml b/config/rbac/role.yaml index 1bb68f2b9..c7aac3f35 100644 --- a/config/rbac/role.yaml +++ b/config/rbac/role.yaml @@ -17,6 +17,7 @@ rules: - apiGroups: - openstack.k-orc.cloud resources: + - addressscopes - domains - endpoints - flavors @@ -49,6 +50,7 @@ rules: - apiGroups: - openstack.k-orc.cloud resources: + - addressscopes/status - domains/status - endpoints/status - flavors/status diff --git a/config/samples/openstack_v1alpha1_addressscope.yaml b/config/samples/openstack_v1alpha1_addressscope.yaml new file mode 100644 index 000000000..9647f7d75 --- /dev/null +++ b/config/samples/openstack_v1alpha1_addressscope.yaml @@ -0,0 +1,14 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-sample +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: Sample AddressScope + # TODO(scaffolding): Add all fields the resource supports diff --git a/internal/controllers/addressscope/actuator.go b/internal/controllers/addressscope/actuator.go new file mode 100644 index 000000000..8504f474d --- /dev/null +++ b/internal/controllers/addressscope/actuator.go @@ -0,0 +1,273 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package addressscope + +import ( + "context" + "iter" + + "github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/layer3/addressscopes" + corev1 "k8s.io/api/core/v1" + "k8s.io/utils/ptr" + ctrl "sigs.k8s.io/controller-runtime" + "sigs.k8s.io/controller-runtime/pkg/client" + + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/progress" + "github.com/k-orc/openstack-resource-controller/v2/internal/logging" + "github.com/k-orc/openstack-resource-controller/v2/internal/osclients" + "github.com/k-orc/openstack-resource-controller/v2/internal/util/dependency" + orcerrors "github.com/k-orc/openstack-resource-controller/v2/internal/util/errors" +) + +// OpenStack resource types +type ( + osResourceT = addressscopes.AddressScope + + createResourceActuator = interfaces.CreateResourceActuator[orcObjectPT, orcObjectT, filterT, osResourceT] + deleteResourceActuator = interfaces.DeleteResourceActuator[orcObjectPT, orcObjectT, osResourceT] + resourceReconciler = interfaces.ResourceReconciler[orcObjectPT, osResourceT] + helperFactory = interfaces.ResourceHelperFactory[orcObjectPT, orcObjectT, resourceSpecT, filterT, osResourceT] +) + +type addressscopeActuator struct { + osClient osclients.AddressScopeClient + k8sClient client.Client +} + +var _ createResourceActuator = addressscopeActuator{} +var _ deleteResourceActuator = addressscopeActuator{} + +func (addressscopeActuator) GetResourceID(osResource *osResourceT) string { + return osResource.ID +} + +func (actuator addressscopeActuator) GetOSResourceByID(ctx context.Context, id string) (*osResourceT, progress.ReconcileStatus) { + resource, err := actuator.osClient.GetAddressScope(ctx, id) + if err != nil { + return nil, progress.WrapError(err) + } + return resource, nil +} + +func (actuator addressscopeActuator) ListOSResourcesForAdoption(ctx context.Context, orcObject orcObjectPT) (iter.Seq2[*osResourceT, error], bool) { + resourceSpec := orcObject.Spec.Resource + if resourceSpec == nil { + return nil, false + } + + // TODO(scaffolding) If you need to filter resources on fields that the List() function + // of gophercloud does not support, it's possible to perform client-side filtering. + // Check osclients.ResourceFilter + + listOpts := addressscopes.ListOpts{ + Name: getResourceName(orcObject), + Description: ptr.Deref(resourceSpec.Description, ""), + } + + return actuator.osClient.ListAddressScopes(ctx, listOpts), true +} + +func (actuator addressscopeActuator) ListOSResourcesForImport(ctx context.Context, obj orcObjectPT, filter filterT) (iter.Seq2[*osResourceT, error], progress.ReconcileStatus) { + // TODO(scaffolding) If you need to filter resources on fields that the List() function + // of gophercloud does not support, it's possible to perform client-side filtering. + // Check osclients.ResourceFilter + var reconcileStatus progress.ReconcileStatus + + project, rs := dependency.FetchDependency( + ctx, actuator.k8sClient, obj.Namespace, + filter.ProjectRef, "Project", + func(dep *orcv1alpha1.Project) bool { return orcv1alpha1.IsAvailable(dep) && dep.Status.ID != nil }, + ) + reconcileStatus = reconcileStatus.WithReconcileStatus(rs) + + if needsReschedule, _ := reconcileStatus.NeedsReschedule(); needsReschedule { + return nil, reconcileStatus + } + + listOpts := addressscopes.ListOpts{ + Name: string(ptr.Deref(filter.Name, "")), + Description: string(ptr.Deref(filter.Description, "")), + ProjectID: ptr.Deref(project.Status.ID, ""), + // TODO(scaffolding): Add more import filters + } + + return actuator.osClient.ListAddressScopes(ctx, listOpts), reconcileStatus +} + +func (actuator addressscopeActuator) CreateResource(ctx context.Context, obj orcObjectPT) (*osResourceT, progress.ReconcileStatus) { + resource := obj.Spec.Resource + + if resource == nil { + // Should have been caught by API validation + return nil, progress.WrapError( + orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "Creation requested, but spec.resource is not set")) + } + var reconcileStatus progress.ReconcileStatus + + var projectID string + if resource.ProjectRef != nil { + project, projectDepRS := projectDependency.GetDependency( + ctx, actuator.k8sClient, obj, func(dep *orcv1alpha1.Project) bool { + return orcv1alpha1.IsAvailable(dep) && dep.Status.ID != nil + }, + ) + reconcileStatus = reconcileStatus.WithReconcileStatus(projectDepRS) + if project != nil { + projectID = ptr.Deref(project.Status.ID, "") + } + } + if needsReschedule, _ := reconcileStatus.NeedsReschedule(); needsReschedule { + return nil, reconcileStatus + } + createOpts := addressscopes.CreateOpts{ + Name: getResourceName(obj), + Description: ptr.Deref(resource.Description, ""), + ProjectID: projectID, + // TODO(scaffolding): Add more fields + } + + osResource, err := actuator.osClient.CreateAddressScope(ctx, createOpts) + if err != nil { + // We should require the spec to be updated before retrying a create which returned a conflict + if !orcerrors.IsRetryable(err) { + err = orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "invalid configuration creating resource: "+err.Error(), err) + } + return nil, progress.WrapError(err) + } + + return osResource, nil +} + +func (actuator addressscopeActuator) DeleteResource(ctx context.Context, _ orcObjectPT, resource *osResourceT) progress.ReconcileStatus { + return progress.WrapError(actuator.osClient.DeleteAddressScope(ctx, resource.ID)) +} + +func (actuator addressscopeActuator) updateResource(ctx context.Context, obj orcObjectPT, osResource *osResourceT) progress.ReconcileStatus { + log := ctrl.LoggerFrom(ctx) + resource := obj.Spec.Resource + if resource == nil { + // Should have been caught by API validation + return progress.WrapError( + orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "Update requested, but spec.resource is not set")) + } + + updateOpts := addressscopes.UpdateOpts{} + + handleNameUpdate(&updateOpts, obj, osResource) + handleDescriptionUpdate(&updateOpts, resource, osResource) + + // TODO(scaffolding): add handler for all fields supporting mutability + + needsUpdate, err := needsUpdate(updateOpts) + if err != nil { + return progress.WrapError( + orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "invalid configuration updating resource: "+err.Error(), err)) + } + if !needsUpdate { + log.V(logging.Debug).Info("No changes") + return nil + } + + _, err = actuator.osClient.UpdateAddressScope(ctx, osResource.ID, updateOpts) + + // We should require the spec to be updated before retrying an update which returned a conflict + if orcerrors.IsConflict(err) { + err = orcerrors.Terminal(orcv1alpha1.ConditionReasonInvalidConfiguration, "invalid configuration updating resource: "+err.Error(), err) + } + + if err != nil { + return progress.WrapError(err) + } + + return progress.NeedsRefresh() +} + +func needsUpdate(updateOpts addressscopes.UpdateOpts) (bool, error) { + updateOptsMap, err := updateOpts.ToAddressScopeUpdateMap() + if err != nil { + return false, err + } + + updateMap, ok := updateOptsMap["address_scope"].(map[string]any) + if !ok { + updateMap = make(map[string]any) + } + + return len(updateMap) > 0, nil +} + +func handleNameUpdate(updateOpts *addressscopes.UpdateOpts, obj orcObjectPT, osResource *osResourceT) { + name := getResourceName(obj) + if osResource.Name != name { + updateOpts.Name = &name + } +} + +func handleDescriptionUpdate(updateOpts *addressscopes.UpdateOpts, resource *resourceSpecT, osResource *osResourceT) { + description := ptr.Deref(resource.Description, "") + if osResource.Description != description { + updateOpts.Description = &description + } +} + +func (actuator addressscopeActuator) GetResourceReconcilers(ctx context.Context, orcObject orcObjectPT, osResource *osResourceT, controller interfaces.ResourceController) ([]resourceReconciler, progress.ReconcileStatus) { + return []resourceReconciler{ + actuator.updateResource, + }, nil +} + +type addressscopeHelperFactory struct{} + +var _ helperFactory = addressscopeHelperFactory{} + +func newActuator(ctx context.Context, orcObject *orcv1alpha1.AddressScope, controller interfaces.ResourceController) (addressscopeActuator, progress.ReconcileStatus) { + log := ctrl.LoggerFrom(ctx) + + // Ensure credential secrets exist and have our finalizer + _, reconcileStatus := credentialsDependency.GetDependencies(ctx, controller.GetK8sClient(), orcObject, func(*corev1.Secret) bool { return true }) + if needsReschedule, _ := reconcileStatus.NeedsReschedule(); needsReschedule { + return addressscopeActuator{}, reconcileStatus + } + + clientScope, err := controller.GetScopeFactory().NewClientScopeFromObject(ctx, controller.GetK8sClient(), log, orcObject) + if err != nil { + return addressscopeActuator{}, progress.WrapError(err) + } + osClient, err := clientScope.NewAddressScopeClient() + if err != nil { + return addressscopeActuator{}, progress.WrapError(err) + } + + return addressscopeActuator{ + osClient: osClient, + k8sClient: controller.GetK8sClient(), + }, nil +} + +func (addressscopeHelperFactory) NewAPIObjectAdapter(obj orcObjectPT) adapterI { + return addressscopeAdapter{obj} +} + +func (addressscopeHelperFactory) NewCreateActuator(ctx context.Context, orcObject orcObjectPT, controller interfaces.ResourceController) (createResourceActuator, progress.ReconcileStatus) { + return newActuator(ctx, orcObject, controller) +} + +func (addressscopeHelperFactory) NewDeleteActuator(ctx context.Context, orcObject orcObjectPT, controller interfaces.ResourceController) (deleteResourceActuator, progress.ReconcileStatus) { + return newActuator(ctx, orcObject, controller) +} diff --git a/internal/controllers/addressscope/actuator_test.go b/internal/controllers/addressscope/actuator_test.go new file mode 100644 index 000000000..dd3cabaab --- /dev/null +++ b/internal/controllers/addressscope/actuator_test.go @@ -0,0 +1,119 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package addressscope + +import ( + "testing" + + "github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/layer3/addressscopes" + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "k8s.io/utils/ptr" +) + +func TestNeedsUpdate(t *testing.T) { + testCases := []struct { + name string + updateOpts addressscopes.UpdateOpts + expectChange bool + }{ + { + name: "Empty base opts", + updateOpts: addressscopes.UpdateOpts{}, + expectChange: false, + }, + { + name: "Updated opts", + updateOpts: addressscopes.UpdateOpts{Name: ptr.To("updated")}, + expectChange: true, + }, + } + + for _, tt := range testCases { + t.Run(tt.name, func(t *testing.T) { + got, _ := needsUpdate(tt.updateOpts) + if got != tt.expectChange { + t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) + } + }) + } +} + +func TestHandleNameUpdate(t *testing.T) { + ptrToName := ptr.To[orcv1alpha1.OpenStackName] + testCases := []struct { + name string + newValue *orcv1alpha1.OpenStackName + existingValue string + expectChange bool + }{ + {name: "Identical", newValue: ptrToName("name"), existingValue: "name", expectChange: false}, + {name: "Different", newValue: ptrToName("new-name"), existingValue: "name", expectChange: true}, + {name: "No value provided, existing is identical to object name", newValue: nil, existingValue: "object-name", expectChange: false}, + {name: "No value provided, existing is different from object name", newValue: nil, existingValue: "different-from-object-name", expectChange: true}, + } + + for _, tt := range testCases { + t.Run(tt.name, func(t *testing.T) { + resource := &orcv1alpha1.AddressScope{} + resource.Name = "object-name" + resource.Spec = orcv1alpha1.AddressScopeSpec{ + Resource: &orcv1alpha1.AddressScopeResourceSpec{Name: tt.newValue}, + } + osResource := &osResourceT{Name: tt.existingValue} + + updateOpts := addressscopes.UpdateOpts{} + handleNameUpdate(&updateOpts, resource, osResource) + + got, _ := needsUpdate(updateOpts) + if got != tt.expectChange { + t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) + } + }) + + } +} + +func TestHandleDescriptionUpdate(t *testing.T) { + ptrToDescription := ptr.To[string] + testCases := []struct { + name string + newValue *string + existingValue string + expectChange bool + }{ + {name: "Identical", newValue: ptrToDescription("desc"), existingValue: "desc", expectChange: false}, + {name: "Different", newValue: ptrToDescription("new-desc"), existingValue: "desc", expectChange: true}, + {name: "No value provided, existing is set", newValue: nil, existingValue: "desc", expectChange: true}, + {name: "No value provided, existing is empty", newValue: nil, existingValue: "", expectChange: false}, + } + + for _, tt := range testCases { + t.Run(tt.name, func(t *testing.T) { + resource := &orcv1alpha1.AddressScopeResourceSpec{Description: tt.newValue} + osResource := &osResourceT{Description: tt.existingValue} + + updateOpts := addressscopes.UpdateOpts{} + handleDescriptionUpdate(&updateOpts, resource, osResource) + + got, _ := needsUpdate(updateOpts) + if got != tt.expectChange { + t.Errorf("Expected change: %v, got: %v", tt.expectChange, got) + } + }) + + } +} diff --git a/internal/controllers/addressscope/controller.go b/internal/controllers/addressscope/controller.go new file mode 100644 index 000000000..daa8694e6 --- /dev/null +++ b/internal/controllers/addressscope/controller.go @@ -0,0 +1,114 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package addressscope + +import ( + "context" + "errors" + + ctrl "sigs.k8s.io/controller-runtime" + "sigs.k8s.io/controller-runtime/pkg/builder" + "sigs.k8s.io/controller-runtime/pkg/controller" + + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/reconciler" + "github.com/k-orc/openstack-resource-controller/v2/internal/scope" + "github.com/k-orc/openstack-resource-controller/v2/internal/util/credentials" + "github.com/k-orc/openstack-resource-controller/v2/internal/util/dependency" + "github.com/k-orc/openstack-resource-controller/v2/pkg/predicates" +) + +const controllerName = "addressscope" + +// +kubebuilder:rbac:groups=openstack.k-orc.cloud,resources=addressscopes,verbs=get;list;watch;create;update;patch;delete +// +kubebuilder:rbac:groups=openstack.k-orc.cloud,resources=addressscopes/status,verbs=get;update;patch + +type addressscopeReconcilerConstructor struct { + scopeFactory scope.Factory +} + +func New(scopeFactory scope.Factory) interfaces.Controller { + return addressscopeReconcilerConstructor{scopeFactory: scopeFactory} +} + +func (addressscopeReconcilerConstructor) GetName() string { + return controllerName +} + +var projectDependency = dependency.NewDeletionGuardDependency[*orcv1alpha1.AddressScopeList, *orcv1alpha1.Project]( + "spec.resource.projectRef", + func(addressscope *orcv1alpha1.AddressScope) []string { + resource := addressscope.Spec.Resource + if resource == nil || resource.ProjectRef == nil { + return nil + } + return []string{string(*resource.ProjectRef)} + }, + finalizer, externalObjectFieldOwner, +) + +var projectImportDependency = dependency.NewDependency[*orcv1alpha1.AddressScopeList, *orcv1alpha1.Project]( + "spec.import.filter.projectRef", + func(addressscope *orcv1alpha1.AddressScope) []string { + resource := addressscope.Spec.Import + if resource == nil || resource.Filter == nil || resource.Filter.ProjectRef == nil { + return nil + } + return []string{string(*resource.Filter.ProjectRef)} + }, +) + +// SetupWithManager sets up the controller with the Manager. +func (c addressscopeReconcilerConstructor) SetupWithManager(ctx context.Context, mgr ctrl.Manager, options controller.Options) error { + log := ctrl.LoggerFrom(ctx) + k8sClient := mgr.GetClient() + + projectWatchEventHandler, err := projectDependency.WatchEventHandler(log, k8sClient) + if err != nil { + return err + } + + projectImportWatchEventHandler, err := projectImportDependency.WatchEventHandler(log, k8sClient) + if err != nil { + return err + } + + builder := ctrl.NewControllerManagedBy(mgr). + WithOptions(options). + Watches(&orcv1alpha1.Project{}, projectWatchEventHandler, + builder.WithPredicates(predicates.NewBecameAvailable(log, &orcv1alpha1.Project{})), + ). + // A second watch is necessary because we need a different handler that omits deletion guards + Watches(&orcv1alpha1.Project{}, projectImportWatchEventHandler, + builder.WithPredicates(predicates.NewBecameAvailable(log, &orcv1alpha1.Project{})), + ). + For(&orcv1alpha1.AddressScope{}) + + if err := errors.Join( + projectDependency.AddToManager(ctx, mgr), + projectImportDependency.AddToManager(ctx, mgr), + credentialsDependency.AddToManager(ctx, mgr), + credentials.AddCredentialsWatch(log, mgr.GetClient(), builder, credentialsDependency), + ); err != nil { + return err + } + + r := reconciler.NewController(controllerName, mgr.GetClient(), c.scopeFactory, addressscopeHelperFactory{}, addressscopeStatusWriter{}) + return builder.Complete(&r) +} diff --git a/internal/controllers/addressscope/status.go b/internal/controllers/addressscope/status.go new file mode 100644 index 000000000..d64cc6520 --- /dev/null +++ b/internal/controllers/addressscope/status.go @@ -0,0 +1,64 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package addressscope + +import ( + "github.com/go-logr/logr" + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" + + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/progress" + orcapplyconfigv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" +) + +type addressscopeStatusWriter struct{} + +type objectApplyT = orcapplyconfigv1alpha1.AddressScopeApplyConfiguration +type statusApplyT = orcapplyconfigv1alpha1.AddressScopeStatusApplyConfiguration + +var _ interfaces.ResourceStatusWriter[*orcv1alpha1.AddressScope, *osResourceT, *objectApplyT, *statusApplyT] = addressscopeStatusWriter{} + +func (addressscopeStatusWriter) GetApplyConfig(name, namespace string) *objectApplyT { + return orcapplyconfigv1alpha1.AddressScope(name, namespace) +} + +func (addressscopeStatusWriter) ResourceAvailableStatus(orcObject *orcv1alpha1.AddressScope, osResource *osResourceT) (metav1.ConditionStatus, progress.ReconcileStatus) { + if osResource == nil { + if orcObject.Status.ID == nil { + return metav1.ConditionFalse, nil + } else { + return metav1.ConditionUnknown, nil + } + } + return metav1.ConditionTrue, nil +} + +func (addressscopeStatusWriter) ApplyResourceStatus(log logr.Logger, osResource *osResourceT, statusApply *statusApplyT) { + resourceStatus := orcapplyconfigv1alpha1.AddressScopeResourceStatus(). + WithProjectID(osResource.ProjectID). + WithName(osResource.Name) + + // TODO(scaffolding): add all of the fields supported in the AddressScopeResourceStatus struct + // If a zero-value isn't expected in the response, place it behind a conditional + + if osResource.Description != "" { + resourceStatus.WithDescription(osResource.Description) + } + + statusApply.WithResource(resourceStatus) +} diff --git a/internal/controllers/addressscope/tests/addressscope-create-full/00-assert.yaml b/internal/controllers/addressscope/tests/addressscope-create-full/00-assert.yaml new file mode 100644 index 000000000..752cf81ca --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-create-full/00-assert.yaml @@ -0,0 +1,33 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-create-full +status: + resource: + name: addressscope-create-full-override + description: AddressScope from "create full" test + # TODO(scaffolding): Add all fields the resource supports + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: AddressScope + name: addressscope-create-full + ref: addressscope + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Project + name: addressscope-create-full + ref: project +assertAll: + - celExpr: "addressscope.status.id != ''" + - celExpr: "addressscope.status.resource.projectID == project.status.id" + # TODO(scaffolding): Add more checks diff --git a/internal/controllers/addressscope/tests/addressscope-create-full/00-create-resource.yaml b/internal/controllers/addressscope/tests/addressscope-create-full/00-create-resource.yaml new file mode 100644 index 000000000..93adb07a2 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-create-full/00-create-resource.yaml @@ -0,0 +1,29 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Project +metadata: + name: addressscope-create-full +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-create-full +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + name: addressscope-create-full-override + description: AddressScope from "create full" test + projectRef: addressscope-create-full + # TODO(scaffolding): Add all fields the resource supports diff --git a/internal/controllers/addressscope/tests/addressscope-create-full/00-secret.yaml b/internal/controllers/addressscope/tests/addressscope-create-full/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-create-full/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/addressscope/tests/addressscope-create-full/README.md b/internal/controllers/addressscope/tests/addressscope-create-full/README.md new file mode 100644 index 000000000..2dcbd470d --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-create-full/README.md @@ -0,0 +1,11 @@ +# Create a AddressScope with all the options + +## Step 00 + +Create a AddressScope using all available fields, and verify that the observed state corresponds to the spec. + +Also validate that the OpenStack resource uses the name from the spec when it is specified. + +## Reference + +https://k-orc.cloud/development/writing-tests/#create-full diff --git a/internal/controllers/addressscope/tests/addressscope-create-minimal/00-assert.yaml b/internal/controllers/addressscope/tests/addressscope-create-minimal/00-assert.yaml new file mode 100644 index 000000000..bfc03fc62 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-create-minimal/00-assert.yaml @@ -0,0 +1,27 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-create-minimal +status: + resource: + name: addressscope-create-minimal + # TODO(scaffolding): Add all fields the resource supports + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: AddressScope + name: addressscope-create-minimal + ref: addressscope +assertAll: + - celExpr: "addressscope.status.id != ''" + # TODO(scaffolding): Add more checks diff --git a/internal/controllers/addressscope/tests/addressscope-create-minimal/00-create-resource.yaml b/internal/controllers/addressscope/tests/addressscope-create-minimal/00-create-resource.yaml new file mode 100644 index 000000000..c3909c87f --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-create-minimal/00-create-resource.yaml @@ -0,0 +1,14 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-create-minimal +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Only add the mandatory fields. It's possible the resource + # doesn't have mandatory fields, in that case, leave it empty. + resource: {} diff --git a/internal/controllers/addressscope/tests/addressscope-create-minimal/00-secret.yaml b/internal/controllers/addressscope/tests/addressscope-create-minimal/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-create-minimal/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/addressscope/tests/addressscope-create-minimal/01-assert.yaml b/internal/controllers/addressscope/tests/addressscope-create-minimal/01-assert.yaml new file mode 100644 index 000000000..99cd6caab --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-create-minimal/01-assert.yaml @@ -0,0 +1,11 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: v1 + kind: Secret + name: openstack-clouds + ref: secret +assertAll: + - celExpr: "secret.metadata.deletionTimestamp != 0" + - celExpr: "'openstack.k-orc.cloud/addressscope' in secret.metadata.finalizers" diff --git a/internal/controllers/addressscope/tests/addressscope-create-minimal/01-delete-secret.yaml b/internal/controllers/addressscope/tests/addressscope-create-minimal/01-delete-secret.yaml new file mode 100644 index 000000000..1620791b9 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-create-minimal/01-delete-secret.yaml @@ -0,0 +1,7 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + # We expect the deletion to hang due to the finalizer, so use --wait=false + - command: kubectl delete secret openstack-clouds --wait=false + namespaced: true diff --git a/internal/controllers/addressscope/tests/addressscope-create-minimal/README.md b/internal/controllers/addressscope/tests/addressscope-create-minimal/README.md new file mode 100644 index 000000000..ab132b070 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-create-minimal/README.md @@ -0,0 +1,15 @@ +# Create a AddressScope with the minimum options + +## Step 00 + +Create a minimal AddressScope, that sets only the required fields, and verify that the observed state corresponds to the spec. + +Also validate that the OpenStack resource uses the name of the ORC object when no name is explicitly specified. + +## Step 01 + +Try deleting the secret and ensure that it is not deleted thanks to the finalizer. + +## Reference + +https://k-orc.cloud/development/writing-tests/#create-minimal diff --git a/internal/controllers/addressscope/tests/addressscope-dependency/00-assert.yaml b/internal/controllers/addressscope/tests/addressscope-dependency/00-assert.yaml new file mode 100644 index 000000000..f990e7ff8 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-dependency/00-assert.yaml @@ -0,0 +1,30 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-dependency-no-secret +status: + conditions: + - type: Available + message: Waiting for Secret/addressscope-dependency to be created + status: "False" + reason: Progressing + - type: Progressing + message: Waiting for Secret/addressscope-dependency to be created + status: "True" + reason: Progressing +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-dependency-no-project +status: + conditions: + - type: Available + message: Waiting for Project/addressscope-dependency to be created + status: "False" + reason: Progressing + - type: Progressing + message: Waiting for Project/addressscope-dependency to be created + status: "True" + reason: Progressing diff --git a/internal/controllers/addressscope/tests/addressscope-dependency/00-create-resources-missing-deps.yaml b/internal/controllers/addressscope/tests/addressscope-dependency/00-create-resources-missing-deps.yaml new file mode 100644 index 000000000..d73eb617c --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-dependency/00-create-resources-missing-deps.yaml @@ -0,0 +1,27 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-dependency-no-project +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + projectRef: addressscope-dependency + # TODO(scaffolding): Add the necessary fields to create the resource +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-dependency-no-secret +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: addressscope-dependency + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} diff --git a/internal/controllers/addressscope/tests/addressscope-dependency/00-secret.yaml b/internal/controllers/addressscope/tests/addressscope-dependency/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-dependency/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/addressscope/tests/addressscope-dependency/01-assert.yaml b/internal/controllers/addressscope/tests/addressscope-dependency/01-assert.yaml new file mode 100644 index 000000000..624cebf5e --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-dependency/01-assert.yaml @@ -0,0 +1,30 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-dependency-no-secret +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-dependency-no-project +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success diff --git a/internal/controllers/addressscope/tests/addressscope-dependency/01-create-dependencies.yaml b/internal/controllers/addressscope/tests/addressscope-dependency/01-create-dependencies.yaml new file mode 100644 index 000000000..9fb1fa9d5 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-dependency/01-create-dependencies.yaml @@ -0,0 +1,19 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic addressscope-dependency --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Project +metadata: + name: addressscope-dependency +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} diff --git a/internal/controllers/addressscope/tests/addressscope-dependency/02-assert.yaml b/internal/controllers/addressscope/tests/addressscope-dependency/02-assert.yaml new file mode 100644 index 000000000..4d3256dd3 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-dependency/02-assert.yaml @@ -0,0 +1,17 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Project + name: addressscope-dependency + ref: project + - apiVersion: v1 + kind: Secret + name: addressscope-dependency + ref: secret +assertAll: + - celExpr: "project.metadata.deletionTimestamp != 0" + - celExpr: "'openstack.k-orc.cloud/addressscope' in project.metadata.finalizers" + - celExpr: "secret.metadata.deletionTimestamp != 0" + - celExpr: "'openstack.k-orc.cloud/addressscope' in secret.metadata.finalizers" diff --git a/internal/controllers/addressscope/tests/addressscope-dependency/02-delete-dependencies.yaml b/internal/controllers/addressscope/tests/addressscope-dependency/02-delete-dependencies.yaml new file mode 100644 index 000000000..178214e19 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-dependency/02-delete-dependencies.yaml @@ -0,0 +1,9 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + # We expect the deletion to hang due to the finalizer, so use --wait=false + - command: kubectl delete project.openstack.k-orc.cloud addressscope-dependency --wait=false + namespaced: true + - command: kubectl delete secret addressscope-dependency --wait=false + namespaced: true diff --git a/internal/controllers/addressscope/tests/addressscope-dependency/03-assert.yaml b/internal/controllers/addressscope/tests/addressscope-dependency/03-assert.yaml new file mode 100644 index 000000000..7572987c2 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-dependency/03-assert.yaml @@ -0,0 +1,9 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +commands: +# Dependencies that were prevented deletion before should now be gone +- script: "! kubectl get project.openstack.k-orc.cloud addressscope-dependency --namespace $NAMESPACE" + skipLogOutput: true +- script: "! kubectl get secret addressscope-dependency --namespace $NAMESPACE" + skipLogOutput: true diff --git a/internal/controllers/addressscope/tests/addressscope-dependency/03-delete-resources.yaml b/internal/controllers/addressscope/tests/addressscope-dependency/03-delete-resources.yaml new file mode 100644 index 000000000..e07d5259f --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-dependency/03-delete-resources.yaml @@ -0,0 +1,10 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +delete: +- apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: AddressScope + name: addressscope-dependency-no-secret +- apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: AddressScope + name: addressscope-dependency-no-project diff --git a/internal/controllers/addressscope/tests/addressscope-dependency/README.md b/internal/controllers/addressscope/tests/addressscope-dependency/README.md new file mode 100644 index 000000000..1637a8625 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-dependency/README.md @@ -0,0 +1,21 @@ +# Creation and deletion dependencies + +## Step 00 + +Create AddressScopes referencing non-existing resources. Each AddressScope is dependent on other non-existing resource. Verify that the AddressScopes are waiting for the needed resources to be created externally. + +## Step 01 + +Create the missing dependencies and verify all the AddressScopes are available. + +## Step 02 + +Delete all the dependencies and check that ORC prevents deletion since there is still a resource that depends on them. + +## Step 03 + +Delete the AddressScopes and validate that all resources are gone. + +## Reference + +https://k-orc.cloud/development/writing-tests/#dependency diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/00-assert.yaml b/internal/controllers/addressscope/tests/addressscope-import-dependency/00-assert.yaml new file mode 100644 index 000000000..dd3974f4f --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/00-assert.yaml @@ -0,0 +1,17 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-dependency +status: + conditions: + - type: Available + message: |- + Waiting for Project/addressscope-import-dependency to be ready + status: "False" + reason: Progressing + - type: Progressing + message: |- + Waiting for Project/addressscope-import-dependency to be ready + status: "True" + reason: Progressing diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/00-import-resource.yaml b/internal/controllers/addressscope/tests/addressscope-import-dependency/00-import-resource.yaml new file mode 100644 index 000000000..61d1c1ba3 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/00-import-resource.yaml @@ -0,0 +1,26 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Project +metadata: + name: addressscope-import-dependency +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: unmanaged + import: + filter: + name: addressscope-import-dependency-external +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-dependency +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: unmanaged + import: + filter: + projectRef: addressscope-import-dependency diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/00-secret.yaml b/internal/controllers/addressscope/tests/addressscope-import-dependency/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/01-assert.yaml b/internal/controllers/addressscope/tests/addressscope-import-dependency/01-assert.yaml new file mode 100644 index 000000000..f961ee99d --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/01-assert.yaml @@ -0,0 +1,32 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-dependency-not-this-one +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-dependency +status: + conditions: + - type: Available + message: |- + Waiting for Project/addressscope-import-dependency to be ready + status: "False" + reason: Progressing + - type: Progressing + message: |- + Waiting for Project/addressscope-import-dependency to be ready + status: "True" + reason: Progressing diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/01-create-trap-resource.yaml b/internal/controllers/addressscope/tests/addressscope-import-dependency/01-create-trap-resource.yaml new file mode 100644 index 000000000..0e7f68c0a --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/01-create-trap-resource.yaml @@ -0,0 +1,28 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Project +metadata: + name: addressscope-import-dependency-not-this-one +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +# This `addressscope-import-dependency-not-this-one` should not be picked by the import filter +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-dependency-not-this-one +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + projectRef: addressscope-import-dependency-not-this-one + # TODO(scaffolding): Add the necessary fields to create the resource diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/02-assert.yaml b/internal/controllers/addressscope/tests/addressscope-import-dependency/02-assert.yaml new file mode 100644 index 000000000..5a71d805b --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/02-assert.yaml @@ -0,0 +1,34 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: AddressScope + name: addressscope-import-dependency + ref: addressscope1 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: AddressScope + name: addressscope-import-dependency-not-this-one + ref: addressscope2 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: Project + name: addressscope-import-dependency + ref: project +assertAll: + - celExpr: "addressscope1.status.id != addressscope2.status.id" + - celExpr: "addressscope1.status.resource.projectID == project.status.id" +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-dependency +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/02-create-resource.yaml b/internal/controllers/addressscope/tests/addressscope-import-dependency/02-create-resource.yaml new file mode 100644 index 000000000..467ab6261 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/02-create-resource.yaml @@ -0,0 +1,27 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: Project +metadata: + name: addressscope-import-dependency-external +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Add the necessary fields to create the resource + resource: {} +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-dependency-external +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack-admin + secretName: openstack-clouds + managementPolicy: managed + resource: + projectRef: addressscope-import-dependency-external + # TODO(scaffolding): Add the necessary fields to create the resource diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/03-assert.yaml b/internal/controllers/addressscope/tests/addressscope-import-dependency/03-assert.yaml new file mode 100644 index 000000000..183c12f03 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/03-assert.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +commands: +- script: "! kubectl get project.openstack.k-orc.cloud addressscope-import-dependency --namespace $NAMESPACE" + skipLogOutput: true diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/03-delete-import-dependencies.yaml b/internal/controllers/addressscope/tests/addressscope-import-dependency/03-delete-import-dependencies.yaml new file mode 100644 index 000000000..cc2c952aa --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/03-delete-import-dependencies.yaml @@ -0,0 +1,7 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + # We should be able to delete the import dependencies + - command: kubectl delete project.openstack.k-orc.cloud addressscope-import-dependency + namespaced: true diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/04-assert.yaml b/internal/controllers/addressscope/tests/addressscope-import-dependency/04-assert.yaml new file mode 100644 index 000000000..d8004f4db --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/04-assert.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +commands: +- script: "! kubectl get addressscope.openstack.k-orc.cloud addressscope-import-dependency --namespace $NAMESPACE" + skipLogOutput: true diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/04-delete-resource.yaml b/internal/controllers/addressscope/tests/addressscope-import-dependency/04-delete-resource.yaml new file mode 100644 index 000000000..9dc761c63 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/04-delete-resource.yaml @@ -0,0 +1,7 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +delete: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: AddressScope + name: addressscope-import-dependency diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/README.md b/internal/controllers/addressscope/tests/addressscope-import-dependency/README.md new file mode 100644 index 000000000..a4257bfc1 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/README.md @@ -0,0 +1,29 @@ +# Check dependency handling for imported AddressScope + +## Step 00 + +Import a AddressScope that references other imported resources. The referenced imported resources have no matching resources yet. +Verify the AddressScope is waiting for the dependency to be ready. + +## Step 01 + +Create a AddressScope matching the import filter, except for referenced resources, and verify that it's not being imported. + +## Step 02 + +Create the referenced resources and a AddressScope matching the import filters. + +Verify that the observed status on the imported AddressScope corresponds to the spec of the created AddressScope. + +## Step 03 + +Delete the referenced resources and check that ORC does not prevent deletion. The OpenStack resources still exist because they +were imported resources and we only deleted the ORC representation of it. + +## Step 04 + +Delete the AddressScope and validate that all resources are gone. + +## Reference + +https://k-orc.cloud/development/writing-tests/#import-dependency diff --git a/internal/controllers/addressscope/tests/addressscope-import-error/00-assert.yaml b/internal/controllers/addressscope/tests/addressscope-import-error/00-assert.yaml new file mode 100644 index 000000000..a99503379 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-error/00-assert.yaml @@ -0,0 +1,30 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-error-external-1 +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-error-external-2 +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success diff --git a/internal/controllers/addressscope/tests/addressscope-import-error/00-create-resources.yaml b/internal/controllers/addressscope/tests/addressscope-import-error/00-create-resources.yaml new file mode 100644 index 000000000..f8973e7e7 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-error/00-create-resources.yaml @@ -0,0 +1,28 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-error-external-1 +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: AddressScope from "import error" test + # TODO(scaffolding): add any required field +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-error-external-2 +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: AddressScope from "import error" test + # TODO(scaffolding): add any required field diff --git a/internal/controllers/addressscope/tests/addressscope-import-error/00-secret.yaml b/internal/controllers/addressscope/tests/addressscope-import-error/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-error/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/addressscope/tests/addressscope-import-error/01-assert.yaml b/internal/controllers/addressscope/tests/addressscope-import-error/01-assert.yaml new file mode 100644 index 000000000..c57c82729 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-error/01-assert.yaml @@ -0,0 +1,15 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-error +status: + conditions: + - type: Available + message: found more than one matching OpenStack resource during import + status: "False" + reason: InvalidConfiguration + - type: Progressing + message: found more than one matching OpenStack resource during import + status: "False" + reason: InvalidConfiguration diff --git a/internal/controllers/addressscope/tests/addressscope-import-error/01-import-resource.yaml b/internal/controllers/addressscope/tests/addressscope-import-error/01-import-resource.yaml new file mode 100644 index 000000000..3968af498 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-error/01-import-resource.yaml @@ -0,0 +1,13 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-error +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: unmanaged + import: + filter: + description: AddressScope from "import error" test diff --git a/internal/controllers/addressscope/tests/addressscope-import-error/README.md b/internal/controllers/addressscope/tests/addressscope-import-error/README.md new file mode 100644 index 000000000..338cf269f --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import-error/README.md @@ -0,0 +1,13 @@ +# Import AddressScope with more than one matching resources + +## Step 00 + +Create two AddressScopes with identical specs. + +## Step 01 + +Ensure that an imported AddressScope with a filter matching the resources returns an error. + +## Reference + +https://k-orc.cloud/development/writing-tests/#import-error diff --git a/internal/controllers/addressscope/tests/addressscope-import/00-assert.yaml b/internal/controllers/addressscope/tests/addressscope-import/00-assert.yaml new file mode 100644 index 000000000..d05edcda5 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import/00-assert.yaml @@ -0,0 +1,15 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import +status: + conditions: + - type: Available + message: Waiting for OpenStack resource to be created externally + status: "False" + reason: Progressing + - type: Progressing + message: Waiting for OpenStack resource to be created externally + status: "True" + reason: Progressing diff --git a/internal/controllers/addressscope/tests/addressscope-import/00-import-resource.yaml b/internal/controllers/addressscope/tests/addressscope-import/00-import-resource.yaml new file mode 100644 index 000000000..385c33cb1 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import/00-import-resource.yaml @@ -0,0 +1,15 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import +spec: + cloudCredentialsRef: + cloudName: openstack + secretName: openstack-clouds + managementPolicy: unmanaged + import: + filter: + name: addressscope-import-external + description: AddressScope addressscope-import-external from "addressscope-import" test + # TODO(scaffolding): Add all fields supported by the filter diff --git a/internal/controllers/addressscope/tests/addressscope-import/00-secret.yaml b/internal/controllers/addressscope/tests/addressscope-import/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/addressscope/tests/addressscope-import/01-assert.yaml b/internal/controllers/addressscope/tests/addressscope-import/01-assert.yaml new file mode 100644 index 000000000..6f4897ab2 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import/01-assert.yaml @@ -0,0 +1,34 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-external-not-this-one +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success + resource: + name: addressscope-import-external-not-this-one + description: AddressScope addressscope-import-external from "addressscope-import" test + # TODO(scaffolding): Add fields necessary to match filter +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import +status: + conditions: + - type: Available + message: Waiting for OpenStack resource to be created externally + status: "False" + reason: Progressing + - type: Progressing + message: Waiting for OpenStack resource to be created externally + status: "True" + reason: Progressing diff --git a/internal/controllers/addressscope/tests/addressscope-import/01-create-trap-resource.yaml b/internal/controllers/addressscope/tests/addressscope-import/01-create-trap-resource.yaml new file mode 100644 index 000000000..7661c9e14 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import/01-create-trap-resource.yaml @@ -0,0 +1,17 @@ +--- +# This `addressscope-import-external-not-this-one` resource serves two purposes: +# - ensure that we can successfully create another resource which name is a substring of it (i.e. it's not being adopted) +# - ensure that importing a resource which name is a substring of it will not pick this one. +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-external-not-this-one +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: AddressScope addressscope-import-external from "addressscope-import" test + # TODO(scaffolding): Add fields necessary to match filter diff --git a/internal/controllers/addressscope/tests/addressscope-import/02-assert.yaml b/internal/controllers/addressscope/tests/addressscope-import/02-assert.yaml new file mode 100644 index 000000000..9b2f882d9 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import/02-assert.yaml @@ -0,0 +1,33 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: AddressScope + name: addressscope-import-external + ref: addressscope1 + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: AddressScope + name: addressscope-import-external-not-this-one + ref: addressscope2 +assertAll: + - celExpr: "addressscope1.status.id != addressscope2.status.id" +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import +status: + conditions: + - type: Available + message: OpenStack resource is available + status: "True" + reason: Success + - type: Progressing + message: OpenStack resource is up to date + status: "False" + reason: Success + resource: + name: addressscope-import-external + description: AddressScope addressscope-import-external from "addressscope-import" test + # TODO(scaffolding): Add all fields the resource supports diff --git a/internal/controllers/addressscope/tests/addressscope-import/02-create-resource.yaml b/internal/controllers/addressscope/tests/addressscope-import/02-create-resource.yaml new file mode 100644 index 000000000..b9ea33592 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import/02-create-resource.yaml @@ -0,0 +1,14 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-import-external +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + resource: + description: AddressScope addressscope-import-external from "addressscope-import" test + # TODO(scaffolding): Add fields necessary to match filter diff --git a/internal/controllers/addressscope/tests/addressscope-import/README.md b/internal/controllers/addressscope/tests/addressscope-import/README.md new file mode 100644 index 000000000..59f54261e --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-import/README.md @@ -0,0 +1,18 @@ +# Import AddressScope + +## Step 00 + +Import a addressscope that matches all fields in the filter, and verify it is waiting for the external resource to be created. + +## Step 01 + +Create a addressscope whose name is a superstring of the one specified in the import filter, otherwise matching the filter, and verify that it's not being imported. + +## Step 02 + +Create a addressscope matching the filter and verify that the observed status on the imported addressscope corresponds to the spec of the created addressscope. +Also, confirm that it does not adopt any addressscope whose name is a superstring of its own. + +## Reference + +https://k-orc.cloud/development/writing-tests/#import diff --git a/internal/controllers/addressscope/tests/addressscope-update/00-assert.yaml b/internal/controllers/addressscope/tests/addressscope-update/00-assert.yaml new file mode 100644 index 000000000..b9ba9d3a8 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-update/00-assert.yaml @@ -0,0 +1,26 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: AddressScope + name: addressscope-update + ref: addressscope +assertAll: + - celExpr: "!has(addressscope.status.resource.description)" +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-update +status: + resource: + name: addressscope-update + # TODO(scaffolding): Add matches for more fields + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success diff --git a/internal/controllers/addressscope/tests/addressscope-update/00-minimal-resource.yaml b/internal/controllers/addressscope/tests/addressscope-update/00-minimal-resource.yaml new file mode 100644 index 000000000..994c24cb5 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-update/00-minimal-resource.yaml @@ -0,0 +1,14 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-update +spec: + cloudCredentialsRef: + # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created or updated + cloudName: openstack + secretName: openstack-clouds + managementPolicy: managed + # TODO(scaffolding): Only add the mandatory fields. It's possible the resource + # doesn't have mandatory fields, in that case, leave it empty. + resource: {} diff --git a/internal/controllers/addressscope/tests/addressscope-update/00-secret.yaml b/internal/controllers/addressscope/tests/addressscope-update/00-secret.yaml new file mode 100644 index 000000000..045711ee7 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-update/00-secret.yaml @@ -0,0 +1,6 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl create secret generic openstack-clouds --from-file=clouds.yaml=${E2E_KUTTL_OSCLOUDS} ${E2E_KUTTL_CACERT_OPT} + namespaced: true diff --git a/internal/controllers/addressscope/tests/addressscope-update/01-assert.yaml b/internal/controllers/addressscope/tests/addressscope-update/01-assert.yaml new file mode 100644 index 000000000..3caafcc31 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-update/01-assert.yaml @@ -0,0 +1,17 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-update +status: + resource: + name: addressscope-update-updated + description: addressscope-update-updated + # TODO(scaffolding): match all fields that were modified + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success diff --git a/internal/controllers/addressscope/tests/addressscope-update/01-updated-resource.yaml b/internal/controllers/addressscope/tests/addressscope-update/01-updated-resource.yaml new file mode 100644 index 000000000..07624e3e2 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-update/01-updated-resource.yaml @@ -0,0 +1,10 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-update +spec: + resource: + name: addressscope-update-updated + description: addressscope-update-updated + # TODO(scaffolding): update all mutable fields diff --git a/internal/controllers/addressscope/tests/addressscope-update/02-assert.yaml b/internal/controllers/addressscope/tests/addressscope-update/02-assert.yaml new file mode 100644 index 000000000..c74b5ff06 --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-update/02-assert.yaml @@ -0,0 +1,26 @@ +--- +apiVersion: kuttl.dev/v1beta1 +kind: TestAssert +resourceRefs: + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: AddressScope + name: addressscope-update + ref: addressscope +assertAll: + - celExpr: "!has(addressscope.status.resource.description)" +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-update +status: + resource: + name: addressscope-update + # TODO(scaffolding): validate that updated fields were all reverted to their original value + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success diff --git a/internal/controllers/addressscope/tests/addressscope-update/02-reverted-resource.yaml b/internal/controllers/addressscope/tests/addressscope-update/02-reverted-resource.yaml new file mode 100644 index 000000000..2c6c253ff --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-update/02-reverted-resource.yaml @@ -0,0 +1,7 @@ +# NOTE: kuttl only does patch updates, which means we can't delete a field. +# We have to use a kubectl apply command instead. +apiVersion: kuttl.dev/v1beta1 +kind: TestStep +commands: + - command: kubectl replace -f 00-minimal-resource.yaml + namespaced: true diff --git a/internal/controllers/addressscope/tests/addressscope-update/README.md b/internal/controllers/addressscope/tests/addressscope-update/README.md new file mode 100644 index 000000000..f2f56c33f --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-update/README.md @@ -0,0 +1,17 @@ +# Update AddressScope + +## Step 00 + +Create a AddressScope using only mandatory fields. + +## Step 01 + +Update all mutable fields. + +## Step 02 + +Revert the resource to its original value and verify that the resulting object matches its state when first created. + +## Reference + +https://k-orc.cloud/development/writing-tests/#update diff --git a/internal/osclients/addressscope.go b/internal/osclients/addressscope.go new file mode 100644 index 000000000..464628e0b --- /dev/null +++ b/internal/osclients/addressscope.go @@ -0,0 +1,104 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package osclients + +import ( + "context" + "fmt" + "iter" + + "github.com/gophercloud/gophercloud/v2" + "github.com/gophercloud/gophercloud/v2/openstack" + "github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/layer3/addressscopes" + "github.com/gophercloud/utils/v2/openstack/clientconfig" +) + +type AddressScopeClient interface { + ListAddressScopes(ctx context.Context, listOpts addressscopes.ListOptsBuilder) iter.Seq2[*addressscopes.AddressScope, error] + CreateAddressScope(ctx context.Context, opts addressscopes.CreateOptsBuilder) (*addressscopes.AddressScope, error) + DeleteAddressScope(ctx context.Context, resourceID string) error + GetAddressScope(ctx context.Context, resourceID string) (*addressscopes.AddressScope, error) + UpdateAddressScope(ctx context.Context, id string, opts addressscopes.UpdateOptsBuilder) (*addressscopes.AddressScope, error) +} + +type addressscopeClient struct{ client *gophercloud.ServiceClient } + +// NewAddressScopeClient returns a new OpenStack client. +func NewAddressScopeClient(providerClient *gophercloud.ProviderClient, providerClientOpts *clientconfig.ClientOpts) (AddressScopeClient, error) { + client, err := openstack.NewNetworkV2(providerClient, gophercloud.EndpointOpts{ + Region: providerClientOpts.RegionName, + Availability: clientconfig.GetEndpointType(providerClientOpts.EndpointType), + }) + + if err != nil { + return nil, fmt.Errorf("failed to create addressscope service client: %v", err) + } + + return &addressscopeClient{client}, nil +} + +func (c addressscopeClient) ListAddressScopes(ctx context.Context, listOpts addressscopes.ListOptsBuilder) iter.Seq2[*addressscopes.AddressScope, error] { + pager := addressscopes.List(c.client, listOpts) + return func(yield func(*addressscopes.AddressScope, error) bool) { + _ = pager.EachPage(ctx, yieldPage(addressscopes.ExtractAddressScopes, yield)) + } +} + +func (c addressscopeClient) CreateAddressScope(ctx context.Context, opts addressscopes.CreateOptsBuilder) (*addressscopes.AddressScope, error) { + return addressscopes.Create(ctx, c.client, opts).Extract() +} + +func (c addressscopeClient) DeleteAddressScope(ctx context.Context, resourceID string) error { + return addressscopes.Delete(ctx, c.client, resourceID).ExtractErr() +} + +func (c addressscopeClient) GetAddressScope(ctx context.Context, resourceID string) (*addressscopes.AddressScope, error) { + return addressscopes.Get(ctx, c.client, resourceID).Extract() +} + +func (c addressscopeClient) UpdateAddressScope(ctx context.Context, id string, opts addressscopes.UpdateOptsBuilder) (*addressscopes.AddressScope, error) { + return addressscopes.Update(ctx, c.client, id, opts).Extract() +} + +type addressscopeErrorClient struct{ error } + +// NewAddressScopeErrorClient returns a AddressScopeClient in which every method returns the given error. +func NewAddressScopeErrorClient(e error) AddressScopeClient { + return addressscopeErrorClient{e} +} + +func (e addressscopeErrorClient) ListAddressScopes(_ context.Context, _ addressscopes.ListOptsBuilder) iter.Seq2[*addressscopes.AddressScope, error] { + return func(yield func(*addressscopes.AddressScope, error) bool) { + yield(nil, e.error) + } +} + +func (e addressscopeErrorClient) CreateAddressScope(_ context.Context, _ addressscopes.CreateOptsBuilder) (*addressscopes.AddressScope, error) { + return nil, e.error +} + +func (e addressscopeErrorClient) DeleteAddressScope(_ context.Context, _ string) error { + return e.error +} + +func (e addressscopeErrorClient) GetAddressScope(_ context.Context, _ string) (*addressscopes.AddressScope, error) { + return nil, e.error +} + +func (e addressscopeErrorClient) UpdateAddressScope(_ context.Context, _ string, _ addressscopes.UpdateOptsBuilder) (*addressscopes.AddressScope, error) { + return nil, e.error +} diff --git a/website/docs/crd-reference.md b/website/docs/crd-reference.md index 18bf9bf9e..ebec04a84 100644 --- a/website/docs/crd-reference.md +++ b/website/docs/crd-reference.md @@ -51,6 +51,12 @@ _Appears in:_ | `subnetRef` _[KubernetesNameRef](#kubernetesnameref)_ | subnetRef references the subnet from which to allocate the IP
address. | | MaxLength: 253
MinLength: 1
| + + + + + + #### AllocationPool @@ -1772,6 +1778,8 @@ _Validation:_ _Appears in:_ - [Address](#address) +- [AddressScopeFilter](#addressscopefilter) +- [AddressScopeResourceSpec](#addressscoperesourcespec) - [EndpointFilter](#endpointfilter) - [EndpointResourceSpec](#endpointresourcespec) - [ExternalGateway](#externalgateway) @@ -2179,6 +2187,8 @@ _Validation:_ - Pattern: `^[^,]+$` _Appears in:_ +- [AddressScopeFilter](#addressscopefilter) +- [AddressScopeResourceSpec](#addressscoperesourcespec) - [FlavorFilter](#flavorfilter) - [FlavorResourceSpec](#flavorresourcespec) - [ImageFilter](#imagefilter) From e791581d986c0644de515d3679e954bead2e5d46 Mon Sep 17 00:00:00 2001 From: Winicius Silva Date: Thu, 19 Feb 2026 16:13:44 +0000 Subject: [PATCH 2/2] network: implement addressscope controller --- PROJECT | 8 + README.md | 1 + api/v1alpha1/addressscope_types.go | 60 ++-- .../zz_generated.addressscope-resource.go | 179 ++++++++++ api/v1alpha1/zz_generated.deepcopy.go | 172 ++++++++- cmd/manager/main.go | 2 + cmd/models-schema/zz_generated.openapi.go | 284 ++++++++++++++- cmd/resource-generator/main.go | 3 + .../openstack.k-orc.cloud_addressscopes.yaml | 338 ++++++++++++++++++ config/crd/kustomization.yaml | 1 + config/samples/kustomization.yaml | 1 + .../openstack_v1alpha1_addressscope.yaml | 4 +- internal/controllers/addressscope/actuator.go | 42 +-- .../controllers/addressscope/actuator_test.go | 20 +- internal/controllers/addressscope/status.go | 11 +- .../addressscope-create-full/00-assert.yaml | 5 +- .../00-create-resource.yaml | 15 +- .../tests/addressscope-create-full/README.md | 4 +- .../00-assert.yaml | 5 +- .../00-create-resource.yaml | 6 +- .../addressscope-create-minimal/README.md | 2 +- .../00-create-resources-missing-deps.yaml | 10 +- .../01-create-dependencies.yaml | 4 +- .../00-import-resource.yaml | 4 +- .../01-create-trap-resource.yaml | 9 +- .../02-create-resource.yaml | 7 +- .../addressscope-import-dependency/README.md | 6 +- .../00-create-resources.yaml | 8 +- .../01-import-resource.yaml | 2 +- .../00-import-resource.yaml | 5 +- .../tests/addressscope-import/01-assert.yaml | 4 +- .../01-create-trap-resource.yaml | 7 +- .../tests/addressscope-import/02-assert.yaml | 4 +- .../02-create-resource.yaml | 7 +- .../tests/addressscope-import/README.md | 6 +- .../tests/addressscope-update/00-assert.yaml | 35 +- .../00-minimal-resource.yaml | 6 +- .../00-minimal-shared.yaml | 13 + .../tests/addressscope-update/01-assert.yaml | 21 +- .../01-updated-resource.yaml | 10 +- .../tests/addressscope-update/02-assert.yaml | 13 +- .../tests/addressscope-update/README.md | 5 +- .../addressscope/zz_generated.adapter.go | 88 +++++ .../addressscope/zz_generated.controller.go | 45 +++ internal/osclients/mock/addressscope.go | 131 +++++++ internal/osclients/mock/doc.go | 3 + internal/scope/mock.go | 7 + internal/scope/provider.go | 4 + internal/scope/scope.go | 1 + kuttl-test.yaml | 1 + .../api/v1alpha1/addressscope.go | 281 +++++++++++++++ .../api/v1alpha1/addressscopefilter.go | 70 ++++ .../api/v1alpha1/addressscopeimport.go | 48 +++ .../api/v1alpha1/addressscoperesourcespec.go | 70 ++++ .../v1alpha1/addressscoperesourcestatus.go | 66 ++++ .../api/v1alpha1/addressscopespec.go | 79 ++++ .../api/v1alpha1/addressscopestatus.go | 66 ++++ .../applyconfiguration/internal/internal.go | 112 ++++++ pkg/clients/applyconfiguration/utils.go | 14 + .../typed/api/v1alpha1/addressscope.go | 74 ++++ .../typed/api/v1alpha1/api_client.go | 5 + .../api/v1alpha1/fake/fake_addressscope.go | 53 +++ .../api/v1alpha1/fake/fake_api_client.go | 4 + .../typed/api/v1alpha1/generated_expansion.go | 2 + .../api/v1alpha1/addressscope.go | 102 ++++++ .../api/v1alpha1/interface.go | 7 + .../informers/externalversions/generic.go | 2 + .../listers/api/v1alpha1/addressscope.go | 70 ++++ .../api/v1alpha1/expansion_generated.go | 8 + test/apivalidations/addressscope_test.go | 77 ++++ website/docs/crd-reference.md | 135 +++++++ 71 files changed, 2785 insertions(+), 189 deletions(-) create mode 100644 api/v1alpha1/zz_generated.addressscope-resource.go create mode 100644 config/crd/bases/openstack.k-orc.cloud_addressscopes.yaml create mode 100644 internal/controllers/addressscope/tests/addressscope-update/00-minimal-shared.yaml create mode 100644 internal/controllers/addressscope/zz_generated.adapter.go create mode 100644 internal/controllers/addressscope/zz_generated.controller.go create mode 100644 internal/osclients/mock/addressscope.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/addressscope.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/addressscopefilter.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/addressscopeimport.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/addressscoperesourcespec.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/addressscoperesourcestatus.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/addressscopespec.go create mode 100644 pkg/clients/applyconfiguration/api/v1alpha1/addressscopestatus.go create mode 100644 pkg/clients/clientset/clientset/typed/api/v1alpha1/addressscope.go create mode 100644 pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_addressscope.go create mode 100644 pkg/clients/informers/externalversions/api/v1alpha1/addressscope.go create mode 100644 pkg/clients/listers/api/v1alpha1/addressscope.go create mode 100644 test/apivalidations/addressscope_test.go diff --git a/PROJECT b/PROJECT index 54fc55950..b3f1540fc 100644 --- a/PROJECT +++ b/PROJECT @@ -8,6 +8,14 @@ layout: projectName: orc repo: github.com/k-orc/openstack-resource-controller resources: +- api: + crdVersion: v1 + namespaced: true + domain: k-orc.cloud + group: openstack + kind: AddressScope + path: github.com/k-orc/openstack-resource-controller/api/v1alpha1 + version: v1alpha1 - api: crdVersion: v1 namespaced: true diff --git a/README.md b/README.md index c05143838..5bddd51c3 100644 --- a/README.md +++ b/README.md @@ -70,6 +70,7 @@ kubectl delete -f $ORC_RELEASE | **controller** | **1.x** | **2.x** | **main** | |:---------------------------:|:-------:|:-------:|:--------:| +| addressscope | | ✔ | ✔ | | domain | | ✔ | ✔ | | endpoint | | ◐ | ◐ | | flavor | | ✔ | ✔ | diff --git a/api/v1alpha1/addressscope_types.go b/api/v1alpha1/addressscope_types.go index d7f47e804..8a28e4585 100644 --- a/api/v1alpha1/addressscope_types.go +++ b/api/v1alpha1/addressscope_types.go @@ -23,24 +23,23 @@ type AddressScopeResourceSpec struct { // +optional Name *OpenStackName `json:"name,omitempty"` - // description is a human-readable description for the resource. - // +kubebuilder:validation:MinLength:=1 - // +kubebuilder:validation:MaxLength:=255 - // +optional - Description *string `json:"description,omitempty"` - // projectRef is a reference to the ORC Project which this resource is associated with. // +optional // +kubebuilder:validation:XValidation:rule="self == oldSelf",message="projectRef is immutable" ProjectRef *KubernetesNameRef `json:"projectRef,omitempty"` - // TODO(scaffolding): Add more types. - // To see what is supported, you can take inspiration from the CreateOpts structure from - // github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/layer3/addressscopes - // - // Until you have implemented mutability for the field, you must add a CEL validation - // preventing the field being modified: - // `// +kubebuilder:validation:XValidation:rule="self == oldSelf",message=" is immutable"` + // ipVersion is the IP protocol version. + // +required + // +kubebuilder:validation:XValidation:rule="self == oldSelf",message="ipVersion is immutable" + IPVersion IPVersion `json:"ipVersion"` + + // shared indicates whether this resource is shared across all + // projects or not. By default, only admin users can change set + // this value. We can't unshared a shared address scope; Neutron + // enforces this. + // +optional + // +kubebuilder:validation:XValidation:rule="!(oldSelf && !self)",message="shared address scope can't be unshared" + Shared *bool `json:"shared,omitempty"` } // AddressScopeFilter defines an existing resource by its properties @@ -50,19 +49,19 @@ type AddressScopeFilter struct { // +optional Name *OpenStackName `json:"name,omitempty"` - // description of the existing resource - // +kubebuilder:validation:MinLength:=1 - // +kubebuilder:validation:MaxLength:=255 - // +optional - Description *string `json:"description,omitempty"` - // projectRef is a reference to the ORC Project which this resource is associated with. // +optional ProjectRef *KubernetesNameRef `json:"projectRef,omitempty"` - // TODO(scaffolding): Add more types. - // To see what is supported, you can take inspiration from the ListOpts structure from - // github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/layer3/addressscopes + // ipVersion is the IP protocol version. + // +optional + IPVersion IPVersion `json:"ipVersion,omitempty"` + + // shared indicates whether this resource is shared across all + // projects or not. By default, only admin users can change set + // this value. + // +optional + Shared *bool `json:"shared,omitempty"` } // AddressScopeResourceStatus represents the observed state of the resource. @@ -72,17 +71,18 @@ type AddressScopeResourceStatus struct { // +optional Name string `json:"name,omitempty"` - // description is a human-readable description for the resource. - // +kubebuilder:validation:MaxLength=1024 - // +optional - Description string `json:"description,omitempty"` - // projectID is the ID of the Project to which the resource is associated. // +kubebuilder:validation:MaxLength=1024 // +optional ProjectID string `json:"projectID,omitempty"` - // TODO(scaffolding): Add more types. - // To see what is supported, you can take inspiration from the AddressScope structure from - // github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/layer3/addressscopes + // ipVersion is the IP protocol version. + // +optional + IPVersion int32 `json:"ipVersion,omitempty"` + + // shared indicates whether this resource is shared across all + // projects or not. By default, only admin users can change set + // this value. + // +optional + Shared *bool `json:"shared,omitempty"` } diff --git a/api/v1alpha1/zz_generated.addressscope-resource.go b/api/v1alpha1/zz_generated.addressscope-resource.go new file mode 100644 index 000000000..a61636c7d --- /dev/null +++ b/api/v1alpha1/zz_generated.addressscope-resource.go @@ -0,0 +1,179 @@ +// Code generated by resource-generator. DO NOT EDIT. +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package v1alpha1 + +import ( + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" +) + +// AddressScopeImport specifies an existing resource which will be imported instead of +// creating a new one +// +kubebuilder:validation:MinProperties:=1 +// +kubebuilder:validation:MaxProperties:=1 +type AddressScopeImport struct { + // id contains the unique identifier of an existing OpenStack resource. Note + // that when specifying an import by ID, the resource MUST already exist. + // The ORC object will enter an error state if the resource does not exist. + // +kubebuilder:validation:Format:=uuid + // +kubebuilder:validation:MaxLength:=36 + // +optional + ID *string `json:"id,omitempty"` //nolint:kubeapilinter + + // filter contains a resource query which is expected to return a single + // result. The controller will continue to retry if filter returns no + // results. If filter returns multiple results the controller will set an + // error state and will not continue to retry. + // +optional + Filter *AddressScopeFilter `json:"filter,omitempty"` +} + +// AddressScopeSpec defines the desired state of an ORC object. +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'managed' ? has(self.resource) : true",message="resource must be specified when policy is managed" +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'managed' ? !has(self.__import__) : true",message="import may not be specified when policy is managed" +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'unmanaged' ? !has(self.resource) : true",message="resource may not be specified when policy is unmanaged" +// +kubebuilder:validation:XValidation:rule="self.managementPolicy == 'unmanaged' ? has(self.__import__) : true",message="import must be specified when policy is unmanaged" +// +kubebuilder:validation:XValidation:rule="has(self.managedOptions) ? self.managementPolicy == 'managed' : true",message="managedOptions may only be provided when policy is managed" +type AddressScopeSpec struct { + // import refers to an existing OpenStack resource which will be imported instead of + // creating a new one. + // +optional + Import *AddressScopeImport `json:"import,omitempty"` + + // resource specifies the desired state of the resource. + // + // resource may not be specified if the management policy is `unmanaged`. + // + // resource must be specified if the management policy is `managed`. + // +optional + Resource *AddressScopeResourceSpec `json:"resource,omitempty"` + + // managementPolicy defines how ORC will treat the object. Valid values are + // `managed`: ORC will create, update, and delete the resource; `unmanaged`: + // ORC will import an existing resource, and will not apply updates to it or + // delete it. + // +kubebuilder:validation:XValidation:rule="self == oldSelf",message="managementPolicy is immutable" + // +kubebuilder:default:=managed + // +optional + ManagementPolicy ManagementPolicy `json:"managementPolicy,omitempty"` + + // managedOptions specifies options which may be applied to managed objects. + // +optional + ManagedOptions *ManagedOptions `json:"managedOptions,omitempty"` + + // cloudCredentialsRef points to a secret containing OpenStack credentials + // +required + CloudCredentialsRef CloudCredentialsReference `json:"cloudCredentialsRef,omitzero"` +} + +// AddressScopeStatus defines the observed state of an ORC resource. +type AddressScopeStatus struct { + // conditions represents the observed status of the object. + // Known .status.conditions.type are: "Available", "Progressing" + // + // Available represents the availability of the OpenStack resource. If it is + // true then the resource is ready for use. + // + // Progressing indicates whether the controller is still attempting to + // reconcile the current state of the OpenStack resource to the desired + // state. Progressing will be False either because the desired state has + // been achieved, or because some terminal error prevents it from ever being + // achieved and the controller is no longer attempting to reconcile. If + // Progressing is True, an observer waiting on the resource should continue + // to wait. + // + // +kubebuilder:validation:MaxItems:=32 + // +patchMergeKey=type + // +patchStrategy=merge + // +listType=map + // +listMapKey=type + // +optional + Conditions []metav1.Condition `json:"conditions,omitempty" patchStrategy:"merge" patchMergeKey:"type"` + + // id is the unique identifier of the OpenStack resource. + // +kubebuilder:validation:MaxLength:=1024 + // +optional + ID *string `json:"id,omitempty"` + + // resource contains the observed state of the OpenStack resource. + // +optional + Resource *AddressScopeResourceStatus `json:"resource,omitempty"` +} + +var _ ObjectWithConditions = &AddressScope{} + +func (i *AddressScope) GetConditions() []metav1.Condition { + return i.Status.Conditions +} + +// +genclient +// +kubebuilder:object:root=true +// +kubebuilder:resource:categories=openstack +// +kubebuilder:subresource:status +// +kubebuilder:printcolumn:name="ID",type="string",JSONPath=".status.id",description="Resource ID" +// +kubebuilder:printcolumn:name="Available",type="string",JSONPath=".status.conditions[?(@.type=='Available')].status",description="Availability status of resource" +// +kubebuilder:printcolumn:name="Message",type="string",JSONPath=".status.conditions[?(@.type=='Progressing')].message",description="Message describing current progress status" + +// AddressScope is the Schema for an ORC resource. +type AddressScope struct { + metav1.TypeMeta `json:",inline"` + + // metadata contains the object metadata + // +optional + metav1.ObjectMeta `json:"metadata,omitempty"` + + // spec specifies the desired state of the resource. + // +required + Spec AddressScopeSpec `json:"spec,omitzero"` + + // status defines the observed state of the resource. + // +optional + Status AddressScopeStatus `json:"status,omitempty"` +} + +// +kubebuilder:object:root=true + +// AddressScopeList contains a list of AddressScope. +type AddressScopeList struct { + metav1.TypeMeta `json:",inline"` + + // metadata contains the list metadata + // +optional + metav1.ListMeta `json:"metadata,omitempty"` + + // items contains a list of AddressScope. + // +required + Items []AddressScope `json:"items"` +} + +func (l *AddressScopeList) GetItems() []AddressScope { + return l.Items +} + +func init() { + SchemeBuilder.Register(&AddressScope{}, &AddressScopeList{}) +} + +func (i *AddressScope) GetCloudCredentialsRef() (*string, *CloudCredentialsReference) { + if i == nil { + return nil, nil + } + + return &i.Namespace, &i.Spec.CloudCredentialsRef +} + +var _ CloudCredentialsRefProvider = &AddressScope{} diff --git a/api/v1alpha1/zz_generated.deepcopy.go b/api/v1alpha1/zz_generated.deepcopy.go index bc18dc6d0..c2ef6bb40 100644 --- a/api/v1alpha1/zz_generated.deepcopy.go +++ b/api/v1alpha1/zz_generated.deepcopy.go @@ -45,6 +45,33 @@ func (in *Address) DeepCopy() *Address { return out } +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *AddressScope) DeepCopyInto(out *AddressScope) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ObjectMeta.DeepCopyInto(&out.ObjectMeta) + in.Spec.DeepCopyInto(&out.Spec) + in.Status.DeepCopyInto(&out.Status) +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AddressScope. +func (in *AddressScope) DeepCopy() *AddressScope { + if in == nil { + return nil + } + out := new(AddressScope) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *AddressScope) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + // DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. func (in *AddressScopeFilter) DeepCopyInto(out *AddressScopeFilter) { *out = *in @@ -53,16 +80,16 @@ func (in *AddressScopeFilter) DeepCopyInto(out *AddressScopeFilter) { *out = new(OpenStackName) **out = **in } - if in.Description != nil { - in, out := &in.Description, &out.Description - *out = new(string) - **out = **in - } if in.ProjectRef != nil { in, out := &in.ProjectRef, &out.ProjectRef *out = new(KubernetesNameRef) **out = **in } + if in.Shared != nil { + in, out := &in.Shared, &out.Shared + *out = new(bool) + **out = **in + } } // DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AddressScopeFilter. @@ -75,6 +102,63 @@ func (in *AddressScopeFilter) DeepCopy() *AddressScopeFilter { return out } +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *AddressScopeImport) DeepCopyInto(out *AddressScopeImport) { + *out = *in + if in.ID != nil { + in, out := &in.ID, &out.ID + *out = new(string) + **out = **in + } + if in.Filter != nil { + in, out := &in.Filter, &out.Filter + *out = new(AddressScopeFilter) + (*in).DeepCopyInto(*out) + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AddressScopeImport. +func (in *AddressScopeImport) DeepCopy() *AddressScopeImport { + if in == nil { + return nil + } + out := new(AddressScopeImport) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *AddressScopeList) DeepCopyInto(out *AddressScopeList) { + *out = *in + out.TypeMeta = in.TypeMeta + in.ListMeta.DeepCopyInto(&out.ListMeta) + if in.Items != nil { + in, out := &in.Items, &out.Items + *out = make([]AddressScope, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AddressScopeList. +func (in *AddressScopeList) DeepCopy() *AddressScopeList { + if in == nil { + return nil + } + out := new(AddressScopeList) + in.DeepCopyInto(out) + return out +} + +// DeepCopyObject is an autogenerated deepcopy function, copying the receiver, creating a new runtime.Object. +func (in *AddressScopeList) DeepCopyObject() runtime.Object { + if c := in.DeepCopy(); c != nil { + return c + } + return nil +} + // DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. func (in *AddressScopeResourceSpec) DeepCopyInto(out *AddressScopeResourceSpec) { *out = *in @@ -83,16 +167,16 @@ func (in *AddressScopeResourceSpec) DeepCopyInto(out *AddressScopeResourceSpec) *out = new(OpenStackName) **out = **in } - if in.Description != nil { - in, out := &in.Description, &out.Description - *out = new(string) - **out = **in - } if in.ProjectRef != nil { in, out := &in.ProjectRef, &out.ProjectRef *out = new(KubernetesNameRef) **out = **in } + if in.Shared != nil { + in, out := &in.Shared, &out.Shared + *out = new(bool) + **out = **in + } } // DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AddressScopeResourceSpec. @@ -108,6 +192,11 @@ func (in *AddressScopeResourceSpec) DeepCopy() *AddressScopeResourceSpec { // DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. func (in *AddressScopeResourceStatus) DeepCopyInto(out *AddressScopeResourceStatus) { *out = *in + if in.Shared != nil { + in, out := &in.Shared, &out.Shared + *out = new(bool) + **out = **in + } } // DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AddressScopeResourceStatus. @@ -120,6 +209,69 @@ func (in *AddressScopeResourceStatus) DeepCopy() *AddressScopeResourceStatus { return out } +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *AddressScopeSpec) DeepCopyInto(out *AddressScopeSpec) { + *out = *in + if in.Import != nil { + in, out := &in.Import, &out.Import + *out = new(AddressScopeImport) + (*in).DeepCopyInto(*out) + } + if in.Resource != nil { + in, out := &in.Resource, &out.Resource + *out = new(AddressScopeResourceSpec) + (*in).DeepCopyInto(*out) + } + if in.ManagedOptions != nil { + in, out := &in.ManagedOptions, &out.ManagedOptions + *out = new(ManagedOptions) + **out = **in + } + out.CloudCredentialsRef = in.CloudCredentialsRef +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AddressScopeSpec. +func (in *AddressScopeSpec) DeepCopy() *AddressScopeSpec { + if in == nil { + return nil + } + out := new(AddressScopeSpec) + in.DeepCopyInto(out) + return out +} + +// DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. +func (in *AddressScopeStatus) DeepCopyInto(out *AddressScopeStatus) { + *out = *in + if in.Conditions != nil { + in, out := &in.Conditions, &out.Conditions + *out = make([]v1.Condition, len(*in)) + for i := range *in { + (*in)[i].DeepCopyInto(&(*out)[i]) + } + } + if in.ID != nil { + in, out := &in.ID, &out.ID + *out = new(string) + **out = **in + } + if in.Resource != nil { + in, out := &in.Resource, &out.Resource + *out = new(AddressScopeResourceStatus) + (*in).DeepCopyInto(*out) + } +} + +// DeepCopy is an autogenerated deepcopy function, copying the receiver, creating a new AddressScopeStatus. +func (in *AddressScopeStatus) DeepCopy() *AddressScopeStatus { + if in == nil { + return nil + } + out := new(AddressScopeStatus) + in.DeepCopyInto(out) + return out +} + // DeepCopyInto is an autogenerated deepcopy function, copying the receiver, writing into out. in must be non-nil. func (in *AllocationPool) DeepCopyInto(out *AllocationPool) { *out = *in diff --git a/cmd/manager/main.go b/cmd/manager/main.go index bb5b27c69..0da3b3bb6 100644 --- a/cmd/manager/main.go +++ b/cmd/manager/main.go @@ -27,6 +27,7 @@ import ( ctrl "sigs.k8s.io/controller-runtime" "sigs.k8s.io/controller-runtime/pkg/log/zap" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/addressscope" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/domain" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/endpoint" "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/flavor" @@ -109,6 +110,7 @@ func main() { scopeFactory := scope.NewFactory(orcOpts.ScopeCacheMaxSize, caCerts) controllers := []interfaces.Controller{ + addressscope.New(scopeFactory), endpoint.New(scopeFactory), image.New(scopeFactory), network.New(scopeFactory), diff --git a/cmd/models-schema/zz_generated.openapi.go b/cmd/models-schema/zz_generated.openapi.go index 81b3df785..372fc02ea 100644 --- a/cmd/models-schema/zz_generated.openapi.go +++ b/cmd/models-schema/zz_generated.openapi.go @@ -31,9 +31,14 @@ import ( func GetOpenAPIDefinitions(ref common.ReferenceCallback) map[string]common.OpenAPIDefinition { return map[string]common.OpenAPIDefinition{ "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.Address": schema_openstack_resource_controller_v2_api_v1alpha1_Address(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScope": schema_openstack_resource_controller_v2_api_v1alpha1_AddressScope(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeFilter": schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeFilter(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeImport": schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeImport(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeList": schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeList(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeResourceSpec": schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeResourceSpec(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeResourceStatus": schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeResourceStatus(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeSpec": schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeSpec(ref), + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeStatus": schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeStatus(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AllocationPool": schema_openstack_resource_controller_v2_api_v1alpha1_AllocationPool(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AllocationPoolStatus": schema_openstack_resource_controller_v2_api_v1alpha1_AllocationPoolStatus(ref), "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AllowedAddressPair": schema_openstack_resource_controller_v2_api_v1alpha1_AllowedAddressPair(ref), @@ -564,6 +569,57 @@ func schema_openstack_resource_controller_v2_api_v1alpha1_Address(ref common.Ref } } +func schema_openstack_resource_controller_v2_api_v1alpha1_AddressScope(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "AddressScope is the Schema for an ORC resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "kind": { + SchemaProps: spec.SchemaProps{ + Description: "Kind is a string value representing the REST resource this object represents. Servers may infer this from the endpoint the client submits requests to. Cannot be updated. In CamelCase. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds", + Type: []string{"string"}, + Format: "", + }, + }, + "apiVersion": { + SchemaProps: spec.SchemaProps{ + Description: "APIVersion defines the versioned schema of this representation of an object. Servers should convert recognized schemas to the latest internal value, and may reject unrecognized values. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources", + Type: []string{"string"}, + Format: "", + }, + }, + "metadata": { + SchemaProps: spec.SchemaProps{ + Description: "metadata contains the object metadata", + Default: map[string]interface{}{}, + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.ObjectMeta"), + }, + }, + "spec": { + SchemaProps: spec.SchemaProps{ + Description: "spec specifies the desired state of the resource.", + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeSpec"), + }, + }, + "status": { + SchemaProps: spec.SchemaProps{ + Description: "status defines the observed state of the resource.", + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeStatus"), + }, + }, + }, + Required: []string{"spec"}, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeSpec", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeStatus", "k8s.io/apimachinery/pkg/apis/meta/v1.ObjectMeta"}, + } +} + func schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeFilter(ref common.ReferenceCallback) common.OpenAPIDefinition { return common.OpenAPIDefinition{ Schema: spec.Schema{ @@ -578,23 +634,109 @@ func schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeFilter(ref Format: "", }, }, - "description": { + "projectRef": { SchemaProps: spec.SchemaProps{ - Description: "description of the existing resource", + Description: "projectRef is a reference to the ORC Project which this resource is associated with.", Type: []string{"string"}, Format: "", }, }, - "projectRef": { + "ipVersion": { SchemaProps: spec.SchemaProps{ - Description: "projectRef is a reference to the ORC Project which this resource is associated with.", + Description: "ipVersion is the IP protocol version.", + Type: []string{"integer"}, + Format: "int32", + }, + }, + "shared": { + SchemaProps: spec.SchemaProps{ + Description: "shared indicates whether this resource is shared across all projects or not. By default, only admin users can change set this value.", + Type: []string{"boolean"}, + Format: "", + }, + }, + }, + }, + }, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeImport(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "AddressScopeImport specifies an existing resource which will be imported instead of creating a new one", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "id": { + SchemaProps: spec.SchemaProps{ + Description: "id contains the unique identifier of an existing OpenStack resource. Note that when specifying an import by ID, the resource MUST already exist. The ORC object will enter an error state if the resource does not exist.", Type: []string{"string"}, Format: "", }, }, + "filter": { + SchemaProps: spec.SchemaProps{ + Description: "filter contains a resource query which is expected to return a single result. The controller will continue to retry if filter returns no results. If filter returns multiple results the controller will set an error state and will not continue to retry.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeFilter"), + }, + }, }, }, }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeFilter"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeList(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "AddressScopeList contains a list of AddressScope.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "kind": { + SchemaProps: spec.SchemaProps{ + Description: "Kind is a string value representing the REST resource this object represents. Servers may infer this from the endpoint the client submits requests to. Cannot be updated. In CamelCase. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds", + Type: []string{"string"}, + Format: "", + }, + }, + "apiVersion": { + SchemaProps: spec.SchemaProps{ + Description: "APIVersion defines the versioned schema of this representation of an object. Servers should convert recognized schemas to the latest internal value, and may reject unrecognized values. More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources", + Type: []string{"string"}, + Format: "", + }, + }, + "metadata": { + SchemaProps: spec.SchemaProps{ + Description: "metadata contains the list metadata", + Default: map[string]interface{}{}, + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.ListMeta"), + }, + }, + "items": { + SchemaProps: spec.SchemaProps{ + Description: "items contains a list of AddressScope.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScope"), + }, + }, + }, + }, + }, + }, + Required: []string{"items"}, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScope", "k8s.io/apimachinery/pkg/apis/meta/v1.ListMeta"}, } } @@ -612,21 +754,30 @@ func schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeResourceSp Format: "", }, }, - "description": { + "projectRef": { SchemaProps: spec.SchemaProps{ - Description: "description is a human-readable description for the resource.", + Description: "projectRef is a reference to the ORC Project which this resource is associated with.", Type: []string{"string"}, Format: "", }, }, - "projectRef": { + "ipVersion": { SchemaProps: spec.SchemaProps{ - Description: "projectRef is a reference to the ORC Project which this resource is associated with.", - Type: []string{"string"}, + Description: "ipVersion is the IP protocol version.", + Default: 0, + Type: []string{"integer"}, + Format: "int32", + }, + }, + "shared": { + SchemaProps: spec.SchemaProps{ + Description: "shared indicates whether this resource is shared across all projects or not. By default, only admin users can change set this value. We can't unshared a shared address scope; Neutron enforces this.", + Type: []string{"boolean"}, Format: "", }, }, }, + Required: []string{"ipVersion"}, }, }, } @@ -646,23 +797,130 @@ func schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeResourceSt Format: "", }, }, - "description": { + "projectID": { SchemaProps: spec.SchemaProps{ - Description: "description is a human-readable description for the resource.", + Description: "projectID is the ID of the Project to which the resource is associated.", Type: []string{"string"}, Format: "", }, }, - "projectID": { + "ipVersion": { SchemaProps: spec.SchemaProps{ - Description: "projectID is the ID of the Project to which the resource is associated.", + Description: "ipVersion is the IP protocol version.", + Type: []string{"integer"}, + Format: "int32", + }, + }, + "shared": { + SchemaProps: spec.SchemaProps{ + Description: "shared indicates whether this resource is shared across all projects or not. By default, only admin users can change set this value.", + Type: []string{"boolean"}, + Format: "", + }, + }, + }, + }, + }, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeSpec(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "AddressScopeSpec defines the desired state of an ORC object.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "import": { + SchemaProps: spec.SchemaProps{ + Description: "import refers to an existing OpenStack resource which will be imported instead of creating a new one.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeImport"), + }, + }, + "resource": { + SchemaProps: spec.SchemaProps{ + Description: "resource specifies the desired state of the resource.\n\nresource may not be specified if the management policy is `unmanaged`.\n\nresource must be specified if the management policy is `managed`.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeResourceSpec"), + }, + }, + "managementPolicy": { + SchemaProps: spec.SchemaProps{ + Description: "managementPolicy defines how ORC will treat the object. Valid values are `managed`: ORC will create, update, and delete the resource; `unmanaged`: ORC will import an existing resource, and will not apply updates to it or delete it.", + Type: []string{"string"}, + Format: "", + }, + }, + "managedOptions": { + SchemaProps: spec.SchemaProps{ + Description: "managedOptions specifies options which may be applied to managed objects.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.ManagedOptions"), + }, + }, + "cloudCredentialsRef": { + SchemaProps: spec.SchemaProps{ + Description: "cloudCredentialsRef points to a secret containing OpenStack credentials", + Default: map[string]interface{}{}, + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.CloudCredentialsReference"), + }, + }, + }, + Required: []string{"cloudCredentialsRef"}, + }, + }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeImport", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeResourceSpec", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.CloudCredentialsReference", "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.ManagedOptions"}, + } +} + +func schema_openstack_resource_controller_v2_api_v1alpha1_AddressScopeStatus(ref common.ReferenceCallback) common.OpenAPIDefinition { + return common.OpenAPIDefinition{ + Schema: spec.Schema{ + SchemaProps: spec.SchemaProps{ + Description: "AddressScopeStatus defines the observed state of an ORC resource.", + Type: []string{"object"}, + Properties: map[string]spec.Schema{ + "conditions": { + VendorExtensible: spec.VendorExtensible{ + Extensions: spec.Extensions{ + "x-kubernetes-list-map-keys": []interface{}{ + "type", + }, + "x-kubernetes-list-type": "map", + "x-kubernetes-patch-merge-key": "type", + "x-kubernetes-patch-strategy": "merge", + }, + }, + SchemaProps: spec.SchemaProps{ + Description: "conditions represents the observed status of the object. Known .status.conditions.type are: \"Available\", \"Progressing\"\n\nAvailable represents the availability of the OpenStack resource. If it is true then the resource is ready for use.\n\nProgressing indicates whether the controller is still attempting to reconcile the current state of the OpenStack resource to the desired state. Progressing will be False either because the desired state has been achieved, or because some terminal error prevents it from ever being achieved and the controller is no longer attempting to reconcile. If Progressing is True, an observer waiting on the resource should continue to wait.", + Type: []string{"array"}, + Items: &spec.SchemaOrArray{ + Schema: &spec.Schema{ + SchemaProps: spec.SchemaProps{ + Default: map[string]interface{}{}, + Ref: ref("k8s.io/apimachinery/pkg/apis/meta/v1.Condition"), + }, + }, + }, + }, + }, + "id": { + SchemaProps: spec.SchemaProps{ + Description: "id is the unique identifier of the OpenStack resource.", Type: []string{"string"}, Format: "", }, }, + "resource": { + SchemaProps: spec.SchemaProps{ + Description: "resource contains the observed state of the OpenStack resource.", + Ref: ref("github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeResourceStatus"), + }, + }, }, }, }, + Dependencies: []string{ + "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1.AddressScopeResourceStatus", "k8s.io/apimachinery/pkg/apis/meta/v1.Condition"}, } } diff --git a/cmd/resource-generator/main.go b/cmd/resource-generator/main.go index 0e7444cc1..147ec0edc 100644 --- a/cmd/resource-generator/main.go +++ b/cmd/resource-generator/main.go @@ -168,6 +168,9 @@ var resources []templateFields = []templateFields{ Name: "Endpoint", IsNotNamed: true, }, + { + Name: "AddressScope", + }, } // These resources won't be generated diff --git a/config/crd/bases/openstack.k-orc.cloud_addressscopes.yaml b/config/crd/bases/openstack.k-orc.cloud_addressscopes.yaml new file mode 100644 index 000000000..11fd4e11f --- /dev/null +++ b/config/crd/bases/openstack.k-orc.cloud_addressscopes.yaml @@ -0,0 +1,338 @@ +--- +apiVersion: apiextensions.k8s.io/v1 +kind: CustomResourceDefinition +metadata: + annotations: + controller-gen.kubebuilder.io/version: v0.17.1 + name: addressscopes.openstack.k-orc.cloud +spec: + group: openstack.k-orc.cloud + names: + categories: + - openstack + kind: AddressScope + listKind: AddressScopeList + plural: addressscopes + singular: addressscope + scope: Namespaced + versions: + - additionalPrinterColumns: + - description: Resource ID + jsonPath: .status.id + name: ID + type: string + - description: Availability status of resource + jsonPath: .status.conditions[?(@.type=='Available')].status + name: Available + type: string + - description: Message describing current progress status + jsonPath: .status.conditions[?(@.type=='Progressing')].message + name: Message + type: string + name: v1alpha1 + schema: + openAPIV3Schema: + description: AddressScope is the Schema for an ORC resource. + properties: + apiVersion: + description: |- + APIVersion defines the versioned schema of this representation of an object. + Servers should convert recognized schemas to the latest internal value, and + may reject unrecognized values. + More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#resources + type: string + kind: + description: |- + Kind is a string value representing the REST resource this object represents. + Servers may infer this from the endpoint the client submits requests to. + Cannot be updated. + In CamelCase. + More info: https://git.k8s.io/community/contributors/devel/sig-architecture/api-conventions.md#types-kinds + type: string + metadata: + type: object + spec: + description: spec specifies the desired state of the resource. + properties: + cloudCredentialsRef: + description: cloudCredentialsRef points to a secret containing OpenStack + credentials + properties: + cloudName: + description: cloudName specifies the name of the entry in the + clouds.yaml file to use. + maxLength: 256 + minLength: 1 + type: string + secretName: + description: |- + secretName is the name of a secret in the same namespace as the resource being provisioned. + The secret must contain a key named `clouds.yaml` which contains an OpenStack clouds.yaml file. + The secret may optionally contain a key named `cacert` containing a PEM-encoded CA certificate. + maxLength: 253 + minLength: 1 + type: string + required: + - cloudName + - secretName + type: object + import: + description: |- + import refers to an existing OpenStack resource which will be imported instead of + creating a new one. + maxProperties: 1 + minProperties: 1 + properties: + filter: + description: |- + filter contains a resource query which is expected to return a single + result. The controller will continue to retry if filter returns no + results. If filter returns multiple results the controller will set an + error state and will not continue to retry. + minProperties: 1 + properties: + ipVersion: + description: ipVersion is the IP protocol version. + enum: + - 4 + - 6 + format: int32 + type: integer + name: + description: name of the existing resource + maxLength: 255 + minLength: 1 + pattern: ^[^,]+$ + type: string + projectRef: + description: projectRef is a reference to the ORC Project + which this resource is associated with. + maxLength: 253 + minLength: 1 + type: string + shared: + description: |- + shared indicates whether this resource is shared across all + projects or not. By default, only admin users can change set + this value. + type: boolean + type: object + id: + description: |- + id contains the unique identifier of an existing OpenStack resource. Note + that when specifying an import by ID, the resource MUST already exist. + The ORC object will enter an error state if the resource does not exist. + format: uuid + maxLength: 36 + type: string + type: object + managedOptions: + description: managedOptions specifies options which may be applied + to managed objects. + properties: + onDelete: + default: delete + description: |- + onDelete specifies the behaviour of the controller when the ORC + object is deleted. Options are `delete` - delete the OpenStack resource; + `detach` - do not delete the OpenStack resource. If not specified, the + default is `delete`. + enum: + - delete + - detach + type: string + type: object + managementPolicy: + default: managed + description: |- + managementPolicy defines how ORC will treat the object. Valid values are + `managed`: ORC will create, update, and delete the resource; `unmanaged`: + ORC will import an existing resource, and will not apply updates to it or + delete it. + enum: + - managed + - unmanaged + type: string + x-kubernetes-validations: + - message: managementPolicy is immutable + rule: self == oldSelf + resource: + description: |- + resource specifies the desired state of the resource. + + resource may not be specified if the management policy is `unmanaged`. + + resource must be specified if the management policy is `managed`. + properties: + ipVersion: + description: ipVersion is the IP protocol version. + enum: + - 4 + - 6 + format: int32 + type: integer + x-kubernetes-validations: + - message: ipVersion is immutable + rule: self == oldSelf + name: + description: |- + name will be the name of the created resource. If not specified, the + name of the ORC object will be used. + maxLength: 255 + minLength: 1 + pattern: ^[^,]+$ + type: string + projectRef: + description: projectRef is a reference to the ORC Project which + this resource is associated with. + maxLength: 253 + minLength: 1 + type: string + x-kubernetes-validations: + - message: projectRef is immutable + rule: self == oldSelf + shared: + description: |- + shared indicates whether this resource is shared across all + projects or not. By default, only admin users can change set + this value. We can't unshared a shared address scope; Neutron + enforces this. + type: boolean + x-kubernetes-validations: + - message: shared address scope can't be unshared + rule: '!(oldSelf && !self)' + required: + - ipVersion + type: object + required: + - cloudCredentialsRef + type: object + x-kubernetes-validations: + - message: resource must be specified when policy is managed + rule: 'self.managementPolicy == ''managed'' ? has(self.resource) : true' + - message: import may not be specified when policy is managed + rule: 'self.managementPolicy == ''managed'' ? !has(self.__import__) + : true' + - message: resource may not be specified when policy is unmanaged + rule: 'self.managementPolicy == ''unmanaged'' ? !has(self.resource) + : true' + - message: import must be specified when policy is unmanaged + rule: 'self.managementPolicy == ''unmanaged'' ? has(self.__import__) + : true' + - message: managedOptions may only be provided when policy is managed + rule: 'has(self.managedOptions) ? self.managementPolicy == ''managed'' + : true' + status: + description: status defines the observed state of the resource. + properties: + conditions: + description: |- + conditions represents the observed status of the object. + Known .status.conditions.type are: "Available", "Progressing" + + Available represents the availability of the OpenStack resource. If it is + true then the resource is ready for use. + + Progressing indicates whether the controller is still attempting to + reconcile the current state of the OpenStack resource to the desired + state. Progressing will be False either because the desired state has + been achieved, or because some terminal error prevents it from ever being + achieved and the controller is no longer attempting to reconcile. If + Progressing is True, an observer waiting on the resource should continue + to wait. + items: + description: Condition contains details for one aspect of the current + state of this API Resource. + properties: + lastTransitionTime: + description: |- + lastTransitionTime is the last time the condition transitioned from one status to another. + This should be when the underlying condition changed. If that is not known, then using the time when the API field changed is acceptable. + format: date-time + type: string + message: + description: |- + message is a human readable message indicating details about the transition. + This may be an empty string. + maxLength: 32768 + type: string + observedGeneration: + description: |- + observedGeneration represents the .metadata.generation that the condition was set based upon. + For instance, if .metadata.generation is currently 12, but the .status.conditions[x].observedGeneration is 9, the condition is out of date + with respect to the current state of the instance. + format: int64 + minimum: 0 + type: integer + reason: + description: |- + reason contains a programmatic identifier indicating the reason for the condition's last transition. + Producers of specific condition types may define expected values and meanings for this field, + and whether the values are considered a guaranteed API. + The value should be a CamelCase string. + This field may not be empty. + maxLength: 1024 + minLength: 1 + pattern: ^[A-Za-z]([A-Za-z0-9_,:]*[A-Za-z0-9_])?$ + type: string + status: + description: status of the condition, one of True, False, Unknown. + enum: + - "True" + - "False" + - Unknown + type: string + type: + description: type of condition in CamelCase or in foo.example.com/CamelCase. + maxLength: 316 + pattern: ^([a-z0-9]([-a-z0-9]*[a-z0-9])?(\.[a-z0-9]([-a-z0-9]*[a-z0-9])?)*/)?(([A-Za-z0-9][-A-Za-z0-9_.]*)?[A-Za-z0-9])$ + type: string + required: + - lastTransitionTime + - message + - reason + - status + - type + type: object + maxItems: 32 + type: array + x-kubernetes-list-map-keys: + - type + x-kubernetes-list-type: map + id: + description: id is the unique identifier of the OpenStack resource. + maxLength: 1024 + type: string + resource: + description: resource contains the observed state of the OpenStack + resource. + properties: + ipVersion: + description: ipVersion is the IP protocol version. + format: int32 + type: integer + name: + description: name is a Human-readable name for the resource. Might + not be unique. + maxLength: 1024 + type: string + projectID: + description: projectID is the ID of the Project to which the resource + is associated. + maxLength: 1024 + type: string + shared: + description: |- + shared indicates whether this resource is shared across all + projects or not. By default, only admin users can change set + this value. + type: boolean + type: object + type: object + required: + - spec + type: object + served: true + storage: true + subresources: + status: {} diff --git a/config/crd/kustomization.yaml b/config/crd/kustomization.yaml index 319e67e8a..196a5c030 100644 --- a/config/crd/kustomization.yaml +++ b/config/crd/kustomization.yaml @@ -3,6 +3,7 @@ # since it depends on service name and namespace that are out of this kustomize package. # It should be run by config/default resources: +- bases/openstack.k-orc.cloud_addressscopes.yaml - bases/openstack.k-orc.cloud_domains.yaml - bases/openstack.k-orc.cloud_endpoints.yaml - bases/openstack.k-orc.cloud_flavors.yaml diff --git a/config/samples/kustomization.yaml b/config/samples/kustomization.yaml index 488fa1eb7..3f68a903d 100644 --- a/config/samples/kustomization.yaml +++ b/config/samples/kustomization.yaml @@ -1,6 +1,7 @@ # Code generated by resource-generator. DO NOT EDIT. ## Append samples of your project ## resources: +- openstack_v1alpha1_addressscope.yaml - openstack_v1alpha1_domain.yaml - openstack_v1alpha1_endpoint.yaml - openstack_v1alpha1_flavor.yaml diff --git a/config/samples/openstack_v1alpha1_addressscope.yaml b/config/samples/openstack_v1alpha1_addressscope.yaml index 9647f7d75..16435fac3 100644 --- a/config/samples/openstack_v1alpha1_addressscope.yaml +++ b/config/samples/openstack_v1alpha1_addressscope.yaml @@ -5,10 +5,8 @@ metadata: name: addressscope-sample spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed resource: - description: Sample AddressScope - # TODO(scaffolding): Add all fields the resource supports + ipVersion: 4 diff --git a/internal/controllers/addressscope/actuator.go b/internal/controllers/addressscope/actuator.go index 8504f474d..dd062fe9f 100644 --- a/internal/controllers/addressscope/actuator.go +++ b/internal/controllers/addressscope/actuator.go @@ -71,22 +71,14 @@ func (actuator addressscopeActuator) ListOSResourcesForAdoption(ctx context.Cont return nil, false } - // TODO(scaffolding) If you need to filter resources on fields that the List() function - // of gophercloud does not support, it's possible to perform client-side filtering. - // Check osclients.ResourceFilter - listOpts := addressscopes.ListOpts{ - Name: getResourceName(orcObject), - Description: ptr.Deref(resourceSpec.Description, ""), + Name: getResourceName(orcObject), } return actuator.osClient.ListAddressScopes(ctx, listOpts), true } func (actuator addressscopeActuator) ListOSResourcesForImport(ctx context.Context, obj orcObjectPT, filter filterT) (iter.Seq2[*osResourceT, error], progress.ReconcileStatus) { - // TODO(scaffolding) If you need to filter resources on fields that the List() function - // of gophercloud does not support, it's possible to perform client-side filtering. - // Check osclients.ResourceFilter var reconcileStatus progress.ReconcileStatus project, rs := dependency.FetchDependency( @@ -101,10 +93,10 @@ func (actuator addressscopeActuator) ListOSResourcesForImport(ctx context.Contex } listOpts := addressscopes.ListOpts{ - Name: string(ptr.Deref(filter.Name, "")), - Description: string(ptr.Deref(filter.Description, "")), - ProjectID: ptr.Deref(project.Status.ID, ""), - // TODO(scaffolding): Add more import filters + Name: string(ptr.Deref(filter.Name, "")), + ProjectID: ptr.Deref(project.Status.ID, ""), + IPVersion: int(filter.IPVersion), + Shared: filter.Shared, } return actuator.osClient.ListAddressScopes(ctx, listOpts), reconcileStatus @@ -135,11 +127,15 @@ func (actuator addressscopeActuator) CreateResource(ctx context.Context, obj orc if needsReschedule, _ := reconcileStatus.NeedsReschedule(); needsReschedule { return nil, reconcileStatus } + createOpts := addressscopes.CreateOpts{ - Name: getResourceName(obj), - Description: ptr.Deref(resource.Description, ""), - ProjectID: projectID, - // TODO(scaffolding): Add more fields + Name: getResourceName(obj), + ProjectID: projectID, + IPVersion: int(resource.IPVersion), + } + + if resource.Shared != nil { + createOpts.Shared = *resource.Shared } osResource, err := actuator.osClient.CreateAddressScope(ctx, createOpts) @@ -170,9 +166,7 @@ func (actuator addressscopeActuator) updateResource(ctx context.Context, obj orc updateOpts := addressscopes.UpdateOpts{} handleNameUpdate(&updateOpts, obj, osResource) - handleDescriptionUpdate(&updateOpts, resource, osResource) - - // TODO(scaffolding): add handler for all fields supporting mutability + handleSharedUpdate(&updateOpts, resource, osResource) needsUpdate, err := needsUpdate(updateOpts) if err != nil { @@ -219,10 +213,10 @@ func handleNameUpdate(updateOpts *addressscopes.UpdateOpts, obj orcObjectPT, osR } } -func handleDescriptionUpdate(updateOpts *addressscopes.UpdateOpts, resource *resourceSpecT, osResource *osResourceT) { - description := ptr.Deref(resource.Description, "") - if osResource.Description != description { - updateOpts.Description = &description +func handleSharedUpdate(updateOpts *addressscopes.UpdateOpts, resource *resourceSpecT, osResource *osResourceT) { + shared := ptr.Deref(resource.Shared, false) + if shared != osResource.Shared { + updateOpts.Shared = &shared } } diff --git a/internal/controllers/addressscope/actuator_test.go b/internal/controllers/addressscope/actuator_test.go index dd3cabaab..151595fb4 100644 --- a/internal/controllers/addressscope/actuator_test.go +++ b/internal/controllers/addressscope/actuator_test.go @@ -87,27 +87,25 @@ func TestHandleNameUpdate(t *testing.T) { } } -func TestHandleDescriptionUpdate(t *testing.T) { - ptrToDescription := ptr.To[string] +func TestHandleSharedUpdate(t *testing.T) { testCases := []struct { name string - newValue *string - existingValue string + newValue *bool + existingValue bool expectChange bool }{ - {name: "Identical", newValue: ptrToDescription("desc"), existingValue: "desc", expectChange: false}, - {name: "Different", newValue: ptrToDescription("new-desc"), existingValue: "desc", expectChange: true}, - {name: "No value provided, existing is set", newValue: nil, existingValue: "desc", expectChange: true}, - {name: "No value provided, existing is empty", newValue: nil, existingValue: "", expectChange: false}, + {name: "Identical true", newValue: ptr.To(true), existingValue: true, expectChange: false}, + {name: "Identical false", newValue: ptr.To(false), existingValue: false, expectChange: false}, + {name: "Change from false to true", newValue: ptr.To(true), existingValue: false, expectChange: true}, } for _, tt := range testCases { t.Run(tt.name, func(t *testing.T) { - resource := &orcv1alpha1.AddressScopeResourceSpec{Description: tt.newValue} - osResource := &osResourceT{Description: tt.existingValue} + resource := &orcv1alpha1.AddressScopeResourceSpec{Shared: tt.newValue} + osResource := &osResourceT{Shared: tt.existingValue} updateOpts := addressscopes.UpdateOpts{} - handleDescriptionUpdate(&updateOpts, resource, osResource) + handleSharedUpdate(&updateOpts, resource, osResource) got, _ := needsUpdate(updateOpts) if got != tt.expectChange { diff --git a/internal/controllers/addressscope/status.go b/internal/controllers/addressscope/status.go index d64cc6520..5065adfad 100644 --- a/internal/controllers/addressscope/status.go +++ b/internal/controllers/addressscope/status.go @@ -51,14 +51,9 @@ func (addressscopeStatusWriter) ResourceAvailableStatus(orcObject *orcv1alpha1.A func (addressscopeStatusWriter) ApplyResourceStatus(log logr.Logger, osResource *osResourceT, statusApply *statusApplyT) { resourceStatus := orcapplyconfigv1alpha1.AddressScopeResourceStatus(). WithProjectID(osResource.ProjectID). - WithName(osResource.Name) - - // TODO(scaffolding): add all of the fields supported in the AddressScopeResourceStatus struct - // If a zero-value isn't expected in the response, place it behind a conditional - - if osResource.Description != "" { - resourceStatus.WithDescription(osResource.Description) - } + WithName(osResource.Name). + WithShared(osResource.Shared). + WithIPVersion(int32(osResource.IPVersion)) statusApply.WithResource(resourceStatus) } diff --git a/internal/controllers/addressscope/tests/addressscope-create-full/00-assert.yaml b/internal/controllers/addressscope/tests/addressscope-create-full/00-assert.yaml index 752cf81ca..00cce7ced 100644 --- a/internal/controllers/addressscope/tests/addressscope-create-full/00-assert.yaml +++ b/internal/controllers/addressscope/tests/addressscope-create-full/00-assert.yaml @@ -6,8 +6,8 @@ metadata: status: resource: name: addressscope-create-full-override - description: AddressScope from "create full" test - # TODO(scaffolding): Add all fields the resource supports + ipVersion: 4 + shared: true conditions: - type: Available status: "True" @@ -30,4 +30,3 @@ resourceRefs: assertAll: - celExpr: "addressscope.status.id != ''" - celExpr: "addressscope.status.resource.projectID == project.status.id" - # TODO(scaffolding): Add more checks diff --git a/internal/controllers/addressscope/tests/addressscope-create-full/00-create-resource.yaml b/internal/controllers/addressscope/tests/addressscope-create-full/00-create-resource.yaml index 93adb07a2..cd6928ae9 100644 --- a/internal/controllers/addressscope/tests/addressscope-create-full/00-create-resource.yaml +++ b/internal/controllers/addressscope/tests/addressscope-create-full/00-create-resource.yaml @@ -5,11 +5,9 @@ metadata: name: addressscope-create-full spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource resource: {} --- apiVersion: openstack.k-orc.cloud/v1alpha1 @@ -18,12 +16,15 @@ metadata: name: addressscope-create-full spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created - cloudName: openstack + # We need to use admin credentials to be able to create this + # AddressScope because we're specifying a different project + # that we are authenticated. + # https://docs.openstack.org/api-ref/network/v2/index.html#create-address-scope + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed resource: name: addressscope-create-full-override - description: AddressScope from "create full" test projectRef: addressscope-create-full - # TODO(scaffolding): Add all fields the resource supports + ipVersion: 4 + shared: true diff --git a/internal/controllers/addressscope/tests/addressscope-create-full/README.md b/internal/controllers/addressscope/tests/addressscope-create-full/README.md index 2dcbd470d..b1559172a 100644 --- a/internal/controllers/addressscope/tests/addressscope-create-full/README.md +++ b/internal/controllers/addressscope/tests/addressscope-create-full/README.md @@ -1,8 +1,8 @@ -# Create a AddressScope with all the options +# Create an AddressScope with all the options ## Step 00 -Create a AddressScope using all available fields, and verify that the observed state corresponds to the spec. +Create an AddressScope using all available fields, and verify that the observed state corresponds to the spec. Also validate that the OpenStack resource uses the name from the spec when it is specified. diff --git a/internal/controllers/addressscope/tests/addressscope-create-minimal/00-assert.yaml b/internal/controllers/addressscope/tests/addressscope-create-minimal/00-assert.yaml index bfc03fc62..667713d5a 100644 --- a/internal/controllers/addressscope/tests/addressscope-create-minimal/00-assert.yaml +++ b/internal/controllers/addressscope/tests/addressscope-create-minimal/00-assert.yaml @@ -6,7 +6,8 @@ metadata: status: resource: name: addressscope-create-minimal - # TODO(scaffolding): Add all fields the resource supports + ipVersion: 4 + shared: false conditions: - type: Available status: "True" @@ -24,4 +25,4 @@ resourceRefs: ref: addressscope assertAll: - celExpr: "addressscope.status.id != ''" - # TODO(scaffolding): Add more checks + - celExpr: "addressscope.status.resource.projectID != ''" diff --git a/internal/controllers/addressscope/tests/addressscope-create-minimal/00-create-resource.yaml b/internal/controllers/addressscope/tests/addressscope-create-minimal/00-create-resource.yaml index c3909c87f..8e3f088e5 100644 --- a/internal/controllers/addressscope/tests/addressscope-create-minimal/00-create-resource.yaml +++ b/internal/controllers/addressscope/tests/addressscope-create-minimal/00-create-resource.yaml @@ -5,10 +5,8 @@ metadata: name: addressscope-create-minimal spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Only add the mandatory fields. It's possible the resource - # doesn't have mandatory fields, in that case, leave it empty. - resource: {} + resource: + ipVersion: 4 diff --git a/internal/controllers/addressscope/tests/addressscope-create-minimal/README.md b/internal/controllers/addressscope/tests/addressscope-create-minimal/README.md index ab132b070..c60142ac7 100644 --- a/internal/controllers/addressscope/tests/addressscope-create-minimal/README.md +++ b/internal/controllers/addressscope/tests/addressscope-create-minimal/README.md @@ -1,4 +1,4 @@ -# Create a AddressScope with the minimum options +# Create an AddressScope with the minimum options ## Step 00 diff --git a/internal/controllers/addressscope/tests/addressscope-dependency/00-create-resources-missing-deps.yaml b/internal/controllers/addressscope/tests/addressscope-dependency/00-create-resources-missing-deps.yaml index d73eb617c..e731f2549 100644 --- a/internal/controllers/addressscope/tests/addressscope-dependency/00-create-resources-missing-deps.yaml +++ b/internal/controllers/addressscope/tests/addressscope-dependency/00-create-resources-missing-deps.yaml @@ -5,13 +5,12 @@ metadata: name: addressscope-dependency-no-project spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed resource: projectRef: addressscope-dependency - # TODO(scaffolding): Add the necessary fields to create the resource + ipVersion: 4 --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: AddressScope @@ -19,9 +18,8 @@ metadata: name: addressscope-dependency-no-secret spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: addressscope-dependency managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource - resource: {} + resource: + ipVersion: 4 diff --git a/internal/controllers/addressscope/tests/addressscope-dependency/01-create-dependencies.yaml b/internal/controllers/addressscope/tests/addressscope-dependency/01-create-dependencies.yaml index 9fb1fa9d5..6cd0d5040 100644 --- a/internal/controllers/addressscope/tests/addressscope-dependency/01-create-dependencies.yaml +++ b/internal/controllers/addressscope/tests/addressscope-dependency/01-create-dependencies.yaml @@ -11,9 +11,7 @@ metadata: name: addressscope-dependency spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource resource: {} diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/00-import-resource.yaml b/internal/controllers/addressscope/tests/addressscope-import-dependency/00-import-resource.yaml index 61d1c1ba3..f5e9a0b58 100644 --- a/internal/controllers/addressscope/tests/addressscope-import-dependency/00-import-resource.yaml +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/00-import-resource.yaml @@ -5,7 +5,7 @@ metadata: name: addressscope-import-dependency spec: cloudCredentialsRef: - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: unmanaged import: @@ -18,7 +18,7 @@ metadata: name: addressscope-import-dependency spec: cloudCredentialsRef: - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: unmanaged import: diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/01-create-trap-resource.yaml b/internal/controllers/addressscope/tests/addressscope-import-dependency/01-create-trap-resource.yaml index 0e7f68c0a..0c8fcf0aa 100644 --- a/internal/controllers/addressscope/tests/addressscope-import-dependency/01-create-trap-resource.yaml +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/01-create-trap-resource.yaml @@ -5,11 +5,9 @@ metadata: name: addressscope-import-dependency-not-this-one spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource resource: {} --- # This `addressscope-import-dependency-not-this-one` should not be picked by the import filter @@ -19,10 +17,9 @@ metadata: name: addressscope-import-dependency-not-this-one spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed resource: + ipVersion: 4 projectRef: addressscope-import-dependency-not-this-one - # TODO(scaffolding): Add the necessary fields to create the resource diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/02-create-resource.yaml b/internal/controllers/addressscope/tests/addressscope-import-dependency/02-create-resource.yaml index 467ab6261..3ca9845d6 100644 --- a/internal/controllers/addressscope/tests/addressscope-import-dependency/02-create-resource.yaml +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/02-create-resource.yaml @@ -5,11 +5,9 @@ metadata: name: addressscope-import-dependency-external spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Add the necessary fields to create the resource resource: {} --- apiVersion: openstack.k-orc.cloud/v1alpha1 @@ -18,10 +16,9 @@ metadata: name: addressscope-import-dependency-external spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed resource: + ipVersion: 4 projectRef: addressscope-import-dependency-external - # TODO(scaffolding): Add the necessary fields to create the resource diff --git a/internal/controllers/addressscope/tests/addressscope-import-dependency/README.md b/internal/controllers/addressscope/tests/addressscope-import-dependency/README.md index a4257bfc1..ce4b071ca 100644 --- a/internal/controllers/addressscope/tests/addressscope-import-dependency/README.md +++ b/internal/controllers/addressscope/tests/addressscope-import-dependency/README.md @@ -2,16 +2,16 @@ ## Step 00 -Import a AddressScope that references other imported resources. The referenced imported resources have no matching resources yet. +Import an AddressScope that references other imported resources. The referenced imported resources have no matching resources yet. Verify the AddressScope is waiting for the dependency to be ready. ## Step 01 -Create a AddressScope matching the import filter, except for referenced resources, and verify that it's not being imported. +Create an AddressScope matching the import filter, except for referenced resources, and verify that it's not being imported. ## Step 02 -Create the referenced resources and a AddressScope matching the import filters. +Create the referenced resources and an AddressScope matching the import filters. Verify that the observed status on the imported AddressScope corresponds to the spec of the created AddressScope. diff --git a/internal/controllers/addressscope/tests/addressscope-import-error/00-create-resources.yaml b/internal/controllers/addressscope/tests/addressscope-import-error/00-create-resources.yaml index f8973e7e7..775ce0239 100644 --- a/internal/controllers/addressscope/tests/addressscope-import-error/00-create-resources.yaml +++ b/internal/controllers/addressscope/tests/addressscope-import-error/00-create-resources.yaml @@ -5,13 +5,11 @@ metadata: name: addressscope-import-error-external-1 spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed resource: - description: AddressScope from "import error" test - # TODO(scaffolding): add any required field + ipVersion: 4 --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: AddressScope @@ -19,10 +17,8 @@ metadata: name: addressscope-import-error-external-2 spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created cloudName: openstack secretName: openstack-clouds managementPolicy: managed resource: - description: AddressScope from "import error" test - # TODO(scaffolding): add any required field + ipVersion: 4 diff --git a/internal/controllers/addressscope/tests/addressscope-import-error/01-import-resource.yaml b/internal/controllers/addressscope/tests/addressscope-import-error/01-import-resource.yaml index 3968af498..c9073e8a6 100644 --- a/internal/controllers/addressscope/tests/addressscope-import-error/01-import-resource.yaml +++ b/internal/controllers/addressscope/tests/addressscope-import-error/01-import-resource.yaml @@ -10,4 +10,4 @@ spec: managementPolicy: unmanaged import: filter: - description: AddressScope from "import error" test + ipVersion: 4 diff --git a/internal/controllers/addressscope/tests/addressscope-import/00-import-resource.yaml b/internal/controllers/addressscope/tests/addressscope-import/00-import-resource.yaml index 385c33cb1..d25ab6f94 100644 --- a/internal/controllers/addressscope/tests/addressscope-import/00-import-resource.yaml +++ b/internal/controllers/addressscope/tests/addressscope-import/00-import-resource.yaml @@ -11,5 +11,6 @@ spec: import: filter: name: addressscope-import-external - description: AddressScope addressscope-import-external from "addressscope-import" test - # TODO(scaffolding): Add all fields supported by the filter + ipVersion: 4 + shared: true + diff --git a/internal/controllers/addressscope/tests/addressscope-import/01-assert.yaml b/internal/controllers/addressscope/tests/addressscope-import/01-assert.yaml index 6f4897ab2..1f6fed6d5 100644 --- a/internal/controllers/addressscope/tests/addressscope-import/01-assert.yaml +++ b/internal/controllers/addressscope/tests/addressscope-import/01-assert.yaml @@ -15,8 +15,8 @@ status: reason: Success resource: name: addressscope-import-external-not-this-one - description: AddressScope addressscope-import-external from "addressscope-import" test - # TODO(scaffolding): Add fields necessary to match filter + ipVersion: 4 + shared: true --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: AddressScope diff --git a/internal/controllers/addressscope/tests/addressscope-import/01-create-trap-resource.yaml b/internal/controllers/addressscope/tests/addressscope-import/01-create-trap-resource.yaml index 7661c9e14..cffc38ecd 100644 --- a/internal/controllers/addressscope/tests/addressscope-import/01-create-trap-resource.yaml +++ b/internal/controllers/addressscope/tests/addressscope-import/01-create-trap-resource.yaml @@ -8,10 +8,9 @@ metadata: name: addressscope-import-external-not-this-one spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed resource: - description: AddressScope addressscope-import-external from "addressscope-import" test - # TODO(scaffolding): Add fields necessary to match filter + ipVersion: 4 + shared: true diff --git a/internal/controllers/addressscope/tests/addressscope-import/02-assert.yaml b/internal/controllers/addressscope/tests/addressscope-import/02-assert.yaml index 9b2f882d9..0e7ecfc38 100644 --- a/internal/controllers/addressscope/tests/addressscope-import/02-assert.yaml +++ b/internal/controllers/addressscope/tests/addressscope-import/02-assert.yaml @@ -29,5 +29,5 @@ status: reason: Success resource: name: addressscope-import-external - description: AddressScope addressscope-import-external from "addressscope-import" test - # TODO(scaffolding): Add all fields the resource supports + ipVersion: 4 + shared: true diff --git a/internal/controllers/addressscope/tests/addressscope-import/02-create-resource.yaml b/internal/controllers/addressscope/tests/addressscope-import/02-create-resource.yaml index b9ea33592..3e81b0d9b 100644 --- a/internal/controllers/addressscope/tests/addressscope-import/02-create-resource.yaml +++ b/internal/controllers/addressscope/tests/addressscope-import/02-create-resource.yaml @@ -5,10 +5,9 @@ metadata: name: addressscope-import-external spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created - cloudName: openstack + cloudName: openstack-admin secretName: openstack-clouds managementPolicy: managed resource: - description: AddressScope addressscope-import-external from "addressscope-import" test - # TODO(scaffolding): Add fields necessary to match filter + ipVersion: 4 + shared: true diff --git a/internal/controllers/addressscope/tests/addressscope-import/README.md b/internal/controllers/addressscope/tests/addressscope-import/README.md index 59f54261e..54359a58b 100644 --- a/internal/controllers/addressscope/tests/addressscope-import/README.md +++ b/internal/controllers/addressscope/tests/addressscope-import/README.md @@ -2,15 +2,15 @@ ## Step 00 -Import a addressscope that matches all fields in the filter, and verify it is waiting for the external resource to be created. +Import an addressscope that matches all fields in the filter, and verify it is waiting for the external resource to be created. ## Step 01 -Create a addressscope whose name is a superstring of the one specified in the import filter, otherwise matching the filter, and verify that it's not being imported. +Create an addressscope whose name is a superstring of the one specified in the import filter, otherwise matching the filter, and verify that it's not being imported. ## Step 02 -Create a addressscope matching the filter and verify that the observed status on the imported addressscope corresponds to the spec of the created addressscope. +Create an addressscope matching the filter and verify that the observed status on the imported addressscope corresponds to the spec of the created addressscope. Also, confirm that it does not adopt any addressscope whose name is a superstring of its own. ## Reference diff --git a/internal/controllers/addressscope/tests/addressscope-update/00-assert.yaml b/internal/controllers/addressscope/tests/addressscope-update/00-assert.yaml index b9ba9d3a8..5bf475fa1 100644 --- a/internal/controllers/addressscope/tests/addressscope-update/00-assert.yaml +++ b/internal/controllers/addressscope/tests/addressscope-update/00-assert.yaml @@ -2,12 +2,17 @@ apiVersion: kuttl.dev/v1beta1 kind: TestAssert resourceRefs: - - apiVersion: openstack.k-orc.cloud/v1alpha1 - kind: AddressScope - name: addressscope-update - ref: addressscope + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: AddressScope + name: addressscope-update + ref: addressscope + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: AddressScope + name: addressscope-update-shared + ref: addressscopeShared assertAll: - - celExpr: "!has(addressscope.status.resource.description)" + - celExpr: "addressscope.status.resource.projectID != ''" + - celExpr: "addressscopeShared.status.resource.projectID != ''" --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: AddressScope @@ -16,7 +21,25 @@ metadata: status: resource: name: addressscope-update - # TODO(scaffolding): Add matches for more fields + ipVersion: 4 + shared: false + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-update-shared +status: + resource: + name: addressscope-update-shared + ipVersion: 4 + shared: false conditions: - type: Available status: "True" diff --git a/internal/controllers/addressscope/tests/addressscope-update/00-minimal-resource.yaml b/internal/controllers/addressscope/tests/addressscope-update/00-minimal-resource.yaml index 994c24cb5..bf3092497 100644 --- a/internal/controllers/addressscope/tests/addressscope-update/00-minimal-resource.yaml +++ b/internal/controllers/addressscope/tests/addressscope-update/00-minimal-resource.yaml @@ -5,10 +5,8 @@ metadata: name: addressscope-update spec: cloudCredentialsRef: - # TODO(scaffolding): Use openstack-admin if the resource needs admin credentials to be created or updated cloudName: openstack secretName: openstack-clouds managementPolicy: managed - # TODO(scaffolding): Only add the mandatory fields. It's possible the resource - # doesn't have mandatory fields, in that case, leave it empty. - resource: {} + resource: + ipVersion: 4 diff --git a/internal/controllers/addressscope/tests/addressscope-update/00-minimal-shared.yaml b/internal/controllers/addressscope/tests/addressscope-update/00-minimal-shared.yaml new file mode 100644 index 000000000..bf345b0bb --- /dev/null +++ b/internal/controllers/addressscope/tests/addressscope-update/00-minimal-shared.yaml @@ -0,0 +1,13 @@ +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-update-shared +spec: + cloudCredentialsRef: + cloudName: openstack-admin + secretName: openstack-clouds + managementPolicy: managed + resource: + ipVersion: 4 + shared: false diff --git a/internal/controllers/addressscope/tests/addressscope-update/01-assert.yaml b/internal/controllers/addressscope/tests/addressscope-update/01-assert.yaml index 3caafcc31..ca3ae4d37 100644 --- a/internal/controllers/addressscope/tests/addressscope-update/01-assert.yaml +++ b/internal/controllers/addressscope/tests/addressscope-update/01-assert.yaml @@ -6,8 +6,25 @@ metadata: status: resource: name: addressscope-update-updated - description: addressscope-update-updated - # TODO(scaffolding): match all fields that were modified + ipVersion: 4 + shared: false + conditions: + - type: Available + status: "True" + reason: Success + - type: Progressing + status: "False" + reason: Success +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-update-shared +status: + resource: + name: addressscope-update-shared + ipVersion: 4 + shared: true conditions: - type: Available status: "True" diff --git a/internal/controllers/addressscope/tests/addressscope-update/01-updated-resource.yaml b/internal/controllers/addressscope/tests/addressscope-update/01-updated-resource.yaml index 07624e3e2..aefd7d703 100644 --- a/internal/controllers/addressscope/tests/addressscope-update/01-updated-resource.yaml +++ b/internal/controllers/addressscope/tests/addressscope-update/01-updated-resource.yaml @@ -6,5 +6,11 @@ metadata: spec: resource: name: addressscope-update-updated - description: addressscope-update-updated - # TODO(scaffolding): update all mutable fields +--- +apiVersion: openstack.k-orc.cloud/v1alpha1 +kind: AddressScope +metadata: + name: addressscope-update-shared +spec: + resource: + shared: true diff --git a/internal/controllers/addressscope/tests/addressscope-update/02-assert.yaml b/internal/controllers/addressscope/tests/addressscope-update/02-assert.yaml index c74b5ff06..d095fd69f 100644 --- a/internal/controllers/addressscope/tests/addressscope-update/02-assert.yaml +++ b/internal/controllers/addressscope/tests/addressscope-update/02-assert.yaml @@ -2,12 +2,12 @@ apiVersion: kuttl.dev/v1beta1 kind: TestAssert resourceRefs: - - apiVersion: openstack.k-orc.cloud/v1alpha1 - kind: AddressScope - name: addressscope-update - ref: addressscope + - apiVersion: openstack.k-orc.cloud/v1alpha1 + kind: AddressScope + name: addressscope-update + ref: addressscope assertAll: - - celExpr: "!has(addressscope.status.resource.description)" + - celExpr: "addressscope.status.resource.projectID != ''" --- apiVersion: openstack.k-orc.cloud/v1alpha1 kind: AddressScope @@ -16,7 +16,8 @@ metadata: status: resource: name: addressscope-update - # TODO(scaffolding): validate that updated fields were all reverted to their original value + ipVersion: 4 + shared: false conditions: - type: Available status: "True" diff --git a/internal/controllers/addressscope/tests/addressscope-update/README.md b/internal/controllers/addressscope/tests/addressscope-update/README.md index f2f56c33f..8a88a9a3e 100644 --- a/internal/controllers/addressscope/tests/addressscope-update/README.md +++ b/internal/controllers/addressscope/tests/addressscope-update/README.md @@ -2,7 +2,8 @@ ## Step 00 -Create a AddressScope using only mandatory fields. +Create two AddressScopes using only mandatory fields, but one of them +will be used to update the `shared` field. ## Step 01 @@ -10,7 +11,7 @@ Update all mutable fields. ## Step 02 -Revert the resource to its original value and verify that the resulting object matches its state when first created. +Revert the resource to its original value and verify that the resulting object matches its state when first created, except the resource with the shared field. ## Reference diff --git a/internal/controllers/addressscope/zz_generated.adapter.go b/internal/controllers/addressscope/zz_generated.adapter.go new file mode 100644 index 000000000..768861dbd --- /dev/null +++ b/internal/controllers/addressscope/zz_generated.adapter.go @@ -0,0 +1,88 @@ +// Code generated by resource-generator. DO NOT EDIT. +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package addressscope + +import ( + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + "github.com/k-orc/openstack-resource-controller/v2/internal/controllers/generic/interfaces" +) + +// Fundamental types +type ( + orcObjectT = orcv1alpha1.AddressScope + orcObjectListT = orcv1alpha1.AddressScopeList + resourceSpecT = orcv1alpha1.AddressScopeResourceSpec + filterT = orcv1alpha1.AddressScopeFilter +) + +// Derived types +type ( + orcObjectPT = *orcObjectT + adapterI = interfaces.APIObjectAdapter[orcObjectPT, resourceSpecT, filterT] + adapterT = addressscopeAdapter +) + +type addressscopeAdapter struct { + *orcv1alpha1.AddressScope +} + +var _ adapterI = &adapterT{} + +func (f adapterT) GetObject() orcObjectPT { + return f.AddressScope +} + +func (f adapterT) GetManagementPolicy() orcv1alpha1.ManagementPolicy { + return f.Spec.ManagementPolicy +} + +func (f adapterT) GetManagedOptions() *orcv1alpha1.ManagedOptions { + return f.Spec.ManagedOptions +} + +func (f adapterT) GetStatusID() *string { + return f.Status.ID +} + +func (f adapterT) GetResourceSpec() *resourceSpecT { + return f.Spec.Resource +} + +func (f adapterT) GetImportID() *string { + if f.Spec.Import == nil { + return nil + } + return f.Spec.Import.ID +} + +func (f adapterT) GetImportFilter() *filterT { + if f.Spec.Import == nil { + return nil + } + return f.Spec.Import.Filter +} + +// getResourceName returns the name of the OpenStack resource we should use. +// This method is not implemented as part of APIObjectAdapter as it is intended +// to be used by resource actuators, which don't use the adapter. +func getResourceName(orcObject orcObjectPT) string { + if orcObject.Spec.Resource.Name != nil { + return string(*orcObject.Spec.Resource.Name) + } + return orcObject.Name +} diff --git a/internal/controllers/addressscope/zz_generated.controller.go b/internal/controllers/addressscope/zz_generated.controller.go new file mode 100644 index 000000000..c17697f8c --- /dev/null +++ b/internal/controllers/addressscope/zz_generated.controller.go @@ -0,0 +1,45 @@ +// Code generated by resource-generator. DO NOT EDIT. +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package addressscope + +import ( + corev1 "k8s.io/api/core/v1" + + "github.com/k-orc/openstack-resource-controller/v2/internal/util/dependency" + orcstrings "github.com/k-orc/openstack-resource-controller/v2/internal/util/strings" +) + +var ( + // NOTE: controllerName must be defined in any controller using this template + + // finalizer is the string this controller adds to an object's Finalizers + finalizer = orcstrings.GetFinalizerName(controllerName) + + // externalObjectFieldOwner is the field owner we use when using + // server-side-apply on objects we don't control + externalObjectFieldOwner = orcstrings.GetSSAFieldOwner(controllerName) + + credentialsDependency = dependency.NewDeletionGuardDependency[*orcObjectListT, *corev1.Secret]( + "spec.cloudCredentialsRef.secretName", + func(obj orcObjectPT) []string { + return []string{obj.Spec.CloudCredentialsRef.SecretName} + }, + finalizer, externalObjectFieldOwner, + dependency.OverrideDependencyName("credentials"), + ) +) diff --git a/internal/osclients/mock/addressscope.go b/internal/osclients/mock/addressscope.go new file mode 100644 index 000000000..fbaf844bb --- /dev/null +++ b/internal/osclients/mock/addressscope.go @@ -0,0 +1,131 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ +// Code generated by MockGen. DO NOT EDIT. +// Source: ../addressscope.go +// +// Generated by this command: +// +// mockgen -package mock -destination=addressscope.go -source=../addressscope.go github.com/k-orc/openstack-resource-controller/internal/osclients/mock AddressScopeClient +// + +// Package mock is a generated GoMock package. +package mock + +import ( + context "context" + iter "iter" + reflect "reflect" + + addressscopes "github.com/gophercloud/gophercloud/v2/openstack/networking/v2/extensions/layer3/addressscopes" + gomock "go.uber.org/mock/gomock" +) + +// MockAddressScopeClient is a mock of AddressScopeClient interface. +type MockAddressScopeClient struct { + ctrl *gomock.Controller + recorder *MockAddressScopeClientMockRecorder + isgomock struct{} +} + +// MockAddressScopeClientMockRecorder is the mock recorder for MockAddressScopeClient. +type MockAddressScopeClientMockRecorder struct { + mock *MockAddressScopeClient +} + +// NewMockAddressScopeClient creates a new mock instance. +func NewMockAddressScopeClient(ctrl *gomock.Controller) *MockAddressScopeClient { + mock := &MockAddressScopeClient{ctrl: ctrl} + mock.recorder = &MockAddressScopeClientMockRecorder{mock} + return mock +} + +// EXPECT returns an object that allows the caller to indicate expected use. +func (m *MockAddressScopeClient) EXPECT() *MockAddressScopeClientMockRecorder { + return m.recorder +} + +// CreateAddressScope mocks base method. +func (m *MockAddressScopeClient) CreateAddressScope(ctx context.Context, opts addressscopes.CreateOptsBuilder) (*addressscopes.AddressScope, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "CreateAddressScope", ctx, opts) + ret0, _ := ret[0].(*addressscopes.AddressScope) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// CreateAddressScope indicates an expected call of CreateAddressScope. +func (mr *MockAddressScopeClientMockRecorder) CreateAddressScope(ctx, opts any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "CreateAddressScope", reflect.TypeOf((*MockAddressScopeClient)(nil).CreateAddressScope), ctx, opts) +} + +// DeleteAddressScope mocks base method. +func (m *MockAddressScopeClient) DeleteAddressScope(ctx context.Context, resourceID string) error { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "DeleteAddressScope", ctx, resourceID) + ret0, _ := ret[0].(error) + return ret0 +} + +// DeleteAddressScope indicates an expected call of DeleteAddressScope. +func (mr *MockAddressScopeClientMockRecorder) DeleteAddressScope(ctx, resourceID any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "DeleteAddressScope", reflect.TypeOf((*MockAddressScopeClient)(nil).DeleteAddressScope), ctx, resourceID) +} + +// GetAddressScope mocks base method. +func (m *MockAddressScopeClient) GetAddressScope(ctx context.Context, resourceID string) (*addressscopes.AddressScope, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "GetAddressScope", ctx, resourceID) + ret0, _ := ret[0].(*addressscopes.AddressScope) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// GetAddressScope indicates an expected call of GetAddressScope. +func (mr *MockAddressScopeClientMockRecorder) GetAddressScope(ctx, resourceID any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "GetAddressScope", reflect.TypeOf((*MockAddressScopeClient)(nil).GetAddressScope), ctx, resourceID) +} + +// ListAddressScopes mocks base method. +func (m *MockAddressScopeClient) ListAddressScopes(ctx context.Context, listOpts addressscopes.ListOptsBuilder) iter.Seq2[*addressscopes.AddressScope, error] { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "ListAddressScopes", ctx, listOpts) + ret0, _ := ret[0].(iter.Seq2[*addressscopes.AddressScope, error]) + return ret0 +} + +// ListAddressScopes indicates an expected call of ListAddressScopes. +func (mr *MockAddressScopeClientMockRecorder) ListAddressScopes(ctx, listOpts any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "ListAddressScopes", reflect.TypeOf((*MockAddressScopeClient)(nil).ListAddressScopes), ctx, listOpts) +} + +// UpdateAddressScope mocks base method. +func (m *MockAddressScopeClient) UpdateAddressScope(ctx context.Context, id string, opts addressscopes.UpdateOptsBuilder) (*addressscopes.AddressScope, error) { + m.ctrl.T.Helper() + ret := m.ctrl.Call(m, "UpdateAddressScope", ctx, id, opts) + ret0, _ := ret[0].(*addressscopes.AddressScope) + ret1, _ := ret[1].(error) + return ret0, ret1 +} + +// UpdateAddressScope indicates an expected call of UpdateAddressScope. +func (mr *MockAddressScopeClientMockRecorder) UpdateAddressScope(ctx, id, opts any) *gomock.Call { + mr.mock.ctrl.T.Helper() + return mr.mock.ctrl.RecordCallWithMethodType(mr.mock, "UpdateAddressScope", reflect.TypeOf((*MockAddressScopeClient)(nil).UpdateAddressScope), ctx, id, opts) +} diff --git a/internal/osclients/mock/doc.go b/internal/osclients/mock/doc.go index 176f3bc93..206e6752f 100644 --- a/internal/osclients/mock/doc.go +++ b/internal/osclients/mock/doc.go @@ -35,6 +35,9 @@ import ( //go:generate mockgen -package mock -destination=identity.go -source=../identity.go github.com/k-orc/openstack-resource-controller/internal/osclients/mock IdentityClient //go:generate /usr/bin/env bash -c "cat ../../../hack/boilerplate.go.txt identity.go > _identity.go && mv _identity.go identity.go" +//go:generate mockgen -package mock -destination=addressscope.go -source=../addressscope.go github.com/k-orc/openstack-resource-controller/internal/osclients/mock AddressScopeClient +//go:generate /usr/bin/env bash -c "cat ../../../hack/boilerplate.go.txt addressscope.go > _addressscope.go && mv _addressscope.go addressscope.go" + //go:generate mockgen -package mock -destination=domain.go -source=../domain.go github.com/k-orc/openstack-resource-controller/internal/osclients/mock DomainClient //go:generate /usr/bin/env bash -c "cat ../../../hack/boilerplate.go.txt domain.go > _domain.go && mv _domain.go domain.go" diff --git a/internal/scope/mock.go b/internal/scope/mock.go index 9cc49cd03..67c8744d3 100644 --- a/internal/scope/mock.go +++ b/internal/scope/mock.go @@ -34,6 +34,7 @@ import ( // MockScopeFactory implements both the ScopeFactory and ClientScope interfaces. It can be used in place of the default ProviderScopeFactory // when we want to use mocked service clients which do not attempt to connect to a running OpenStack cloud. type MockScopeFactory struct { + AddressScope *mock.MockAddressScopeClient ComputeClient *mock.MockComputeClient DomainClient *mock.MockDomainClient EndpointClient *mock.MockEndpointClient @@ -51,6 +52,7 @@ type MockScopeFactory struct { } func NewMockScopeFactory(mockCtrl *gomock.Controller) *MockScopeFactory { + addressScope := mock.NewMockAddressScopeClient(mockCtrl) computeClient := mock.NewMockComputeClient(mockCtrl) domainClient := mock.NewMockDomainClient(mockCtrl) endpointClient := mock.NewMockEndpointClient(mockCtrl) @@ -65,6 +67,7 @@ func NewMockScopeFactory(mockCtrl *gomock.Controller) *MockScopeFactory { volumetypeClient := mock.NewMockVolumeTypeClient(mockCtrl) return &MockScopeFactory{ + AddressScope: addressScope, ComputeClient: computeClient, DomainClient: domainClient, EndpointClient: endpointClient, @@ -91,6 +94,10 @@ func (f *MockScopeFactory) NewClientScopeFromObject(_ context.Context, _ client. return f, nil } +func (f *MockScopeFactory) NewAddressScopeClient() (osclients.AddressScopeClient, error) { + return f.AddressScope, nil +} + func (f *MockScopeFactory) NewComputeClient() (osclients.ComputeClient, error) { return f.ComputeClient, nil } diff --git a/internal/scope/provider.go b/internal/scope/provider.go index d9853e381..f9ff9f88f 100644 --- a/internal/scope/provider.go +++ b/internal/scope/provider.go @@ -137,6 +137,10 @@ func NewCachedProviderScope(cache *cache.LRUExpireCache, cloud clientconfig.Clou return scope, nil } +func (s *providerScope) NewAddressScopeClient() (clients.AddressScopeClient, error) { + return clients.NewAddressScopeClient(s.providerClient, s.providerClientOpts) +} + func (s *providerScope) NewComputeClient() (clients.ComputeClient, error) { return clients.NewComputeClient(s.providerClient, s.providerClientOpts) } diff --git a/internal/scope/scope.go b/internal/scope/scope.go index 8baa7f404..20aa25cf5 100644 --- a/internal/scope/scope.go +++ b/internal/scope/scope.go @@ -48,6 +48,7 @@ type Factory interface { // Scope contains arguments common to most operations. type Scope interface { + NewAddressScopeClient() (osclients.AddressScopeClient, error) NewComputeClient() (osclients.ComputeClient, error) NewDomainClient() (osclients.DomainClient, error) NewEndpointClient() (osclients.EndpointClient, error) diff --git a/kuttl-test.yaml b/kuttl-test.yaml index 10cedb065..f54466d84 100644 --- a/kuttl-test.yaml +++ b/kuttl-test.yaml @@ -2,6 +2,7 @@ apiVersion: kuttl.dev/v1beta1 kind: TestSuite testDirs: +- ./internal/controllers/addressscope/tests/ - ./internal/controllers/domain/tests/ - ./internal/controllers/endpoint/tests/ - ./internal/controllers/flavor/tests/ diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/addressscope.go b/pkg/clients/applyconfiguration/api/v1alpha1/addressscope.go new file mode 100644 index 000000000..7b43dfb87 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/addressscope.go @@ -0,0 +1,281 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + internal "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/internal" + metav1 "k8s.io/apimachinery/pkg/apis/meta/v1" + types "k8s.io/apimachinery/pkg/types" + managedfields "k8s.io/apimachinery/pkg/util/managedfields" + v1 "k8s.io/client-go/applyconfigurations/meta/v1" +) + +// AddressScopeApplyConfiguration represents a declarative configuration of the AddressScope type for use +// with apply. +type AddressScopeApplyConfiguration struct { + v1.TypeMetaApplyConfiguration `json:",inline"` + *v1.ObjectMetaApplyConfiguration `json:"metadata,omitempty"` + Spec *AddressScopeSpecApplyConfiguration `json:"spec,omitempty"` + Status *AddressScopeStatusApplyConfiguration `json:"status,omitempty"` +} + +// AddressScope constructs a declarative configuration of the AddressScope type for use with +// apply. +func AddressScope(name, namespace string) *AddressScopeApplyConfiguration { + b := &AddressScopeApplyConfiguration{} + b.WithName(name) + b.WithNamespace(namespace) + b.WithKind("AddressScope") + b.WithAPIVersion("openstack.k-orc.cloud/v1alpha1") + return b +} + +// ExtractAddressScope extracts the applied configuration owned by fieldManager from +// addressScope. If no managedFields are found in addressScope for fieldManager, a +// AddressScopeApplyConfiguration is returned with only the Name, Namespace (if applicable), +// APIVersion and Kind populated. It is possible that no managed fields were found for because other +// field managers have taken ownership of all the fields previously owned by fieldManager, or because +// the fieldManager never owned fields any fields. +// addressScope must be a unmodified AddressScope API object that was retrieved from the Kubernetes API. +// ExtractAddressScope provides a way to perform a extract/modify-in-place/apply workflow. +// Note that an extracted apply configuration will contain fewer fields than what the fieldManager previously +// applied if another fieldManager has updated or force applied any of the previously applied fields. +// Experimental! +func ExtractAddressScope(addressScope *apiv1alpha1.AddressScope, fieldManager string) (*AddressScopeApplyConfiguration, error) { + return extractAddressScope(addressScope, fieldManager, "") +} + +// ExtractAddressScopeStatus is the same as ExtractAddressScope except +// that it extracts the status subresource applied configuration. +// Experimental! +func ExtractAddressScopeStatus(addressScope *apiv1alpha1.AddressScope, fieldManager string) (*AddressScopeApplyConfiguration, error) { + return extractAddressScope(addressScope, fieldManager, "status") +} + +func extractAddressScope(addressScope *apiv1alpha1.AddressScope, fieldManager string, subresource string) (*AddressScopeApplyConfiguration, error) { + b := &AddressScopeApplyConfiguration{} + err := managedfields.ExtractInto(addressScope, internal.Parser().Type("com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.AddressScope"), fieldManager, b, subresource) + if err != nil { + return nil, err + } + b.WithName(addressScope.Name) + b.WithNamespace(addressScope.Namespace) + + b.WithKind("AddressScope") + b.WithAPIVersion("openstack.k-orc.cloud/v1alpha1") + return b, nil +} +func (b AddressScopeApplyConfiguration) IsApplyConfiguration() {} + +// WithKind sets the Kind field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Kind field is set to the value of the last call. +func (b *AddressScopeApplyConfiguration) WithKind(value string) *AddressScopeApplyConfiguration { + b.TypeMetaApplyConfiguration.Kind = &value + return b +} + +// WithAPIVersion sets the APIVersion field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the APIVersion field is set to the value of the last call. +func (b *AddressScopeApplyConfiguration) WithAPIVersion(value string) *AddressScopeApplyConfiguration { + b.TypeMetaApplyConfiguration.APIVersion = &value + return b +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *AddressScopeApplyConfiguration) WithName(value string) *AddressScopeApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.Name = &value + return b +} + +// WithGenerateName sets the GenerateName field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the GenerateName field is set to the value of the last call. +func (b *AddressScopeApplyConfiguration) WithGenerateName(value string) *AddressScopeApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.GenerateName = &value + return b +} + +// WithNamespace sets the Namespace field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Namespace field is set to the value of the last call. +func (b *AddressScopeApplyConfiguration) WithNamespace(value string) *AddressScopeApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.Namespace = &value + return b +} + +// WithUID sets the UID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the UID field is set to the value of the last call. +func (b *AddressScopeApplyConfiguration) WithUID(value types.UID) *AddressScopeApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.UID = &value + return b +} + +// WithResourceVersion sets the ResourceVersion field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ResourceVersion field is set to the value of the last call. +func (b *AddressScopeApplyConfiguration) WithResourceVersion(value string) *AddressScopeApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.ResourceVersion = &value + return b +} + +// WithGeneration sets the Generation field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Generation field is set to the value of the last call. +func (b *AddressScopeApplyConfiguration) WithGeneration(value int64) *AddressScopeApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.Generation = &value + return b +} + +// WithCreationTimestamp sets the CreationTimestamp field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the CreationTimestamp field is set to the value of the last call. +func (b *AddressScopeApplyConfiguration) WithCreationTimestamp(value metav1.Time) *AddressScopeApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.CreationTimestamp = &value + return b +} + +// WithDeletionTimestamp sets the DeletionTimestamp field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the DeletionTimestamp field is set to the value of the last call. +func (b *AddressScopeApplyConfiguration) WithDeletionTimestamp(value metav1.Time) *AddressScopeApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.DeletionTimestamp = &value + return b +} + +// WithDeletionGracePeriodSeconds sets the DeletionGracePeriodSeconds field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the DeletionGracePeriodSeconds field is set to the value of the last call. +func (b *AddressScopeApplyConfiguration) WithDeletionGracePeriodSeconds(value int64) *AddressScopeApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + b.ObjectMetaApplyConfiguration.DeletionGracePeriodSeconds = &value + return b +} + +// WithLabels puts the entries into the Labels field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, the entries provided by each call will be put on the Labels field, +// overwriting an existing map entries in Labels field with the same key. +func (b *AddressScopeApplyConfiguration) WithLabels(entries map[string]string) *AddressScopeApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + if b.ObjectMetaApplyConfiguration.Labels == nil && len(entries) > 0 { + b.ObjectMetaApplyConfiguration.Labels = make(map[string]string, len(entries)) + } + for k, v := range entries { + b.ObjectMetaApplyConfiguration.Labels[k] = v + } + return b +} + +// WithAnnotations puts the entries into the Annotations field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, the entries provided by each call will be put on the Annotations field, +// overwriting an existing map entries in Annotations field with the same key. +func (b *AddressScopeApplyConfiguration) WithAnnotations(entries map[string]string) *AddressScopeApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + if b.ObjectMetaApplyConfiguration.Annotations == nil && len(entries) > 0 { + b.ObjectMetaApplyConfiguration.Annotations = make(map[string]string, len(entries)) + } + for k, v := range entries { + b.ObjectMetaApplyConfiguration.Annotations[k] = v + } + return b +} + +// WithOwnerReferences adds the given value to the OwnerReferences field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the OwnerReferences field. +func (b *AddressScopeApplyConfiguration) WithOwnerReferences(values ...*v1.OwnerReferenceApplyConfiguration) *AddressScopeApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + for i := range values { + if values[i] == nil { + panic("nil value passed to WithOwnerReferences") + } + b.ObjectMetaApplyConfiguration.OwnerReferences = append(b.ObjectMetaApplyConfiguration.OwnerReferences, *values[i]) + } + return b +} + +// WithFinalizers adds the given value to the Finalizers field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the Finalizers field. +func (b *AddressScopeApplyConfiguration) WithFinalizers(values ...string) *AddressScopeApplyConfiguration { + b.ensureObjectMetaApplyConfigurationExists() + for i := range values { + b.ObjectMetaApplyConfiguration.Finalizers = append(b.ObjectMetaApplyConfiguration.Finalizers, values[i]) + } + return b +} + +func (b *AddressScopeApplyConfiguration) ensureObjectMetaApplyConfigurationExists() { + if b.ObjectMetaApplyConfiguration == nil { + b.ObjectMetaApplyConfiguration = &v1.ObjectMetaApplyConfiguration{} + } +} + +// WithSpec sets the Spec field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Spec field is set to the value of the last call. +func (b *AddressScopeApplyConfiguration) WithSpec(value *AddressScopeSpecApplyConfiguration) *AddressScopeApplyConfiguration { + b.Spec = value + return b +} + +// WithStatus sets the Status field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Status field is set to the value of the last call. +func (b *AddressScopeApplyConfiguration) WithStatus(value *AddressScopeStatusApplyConfiguration) *AddressScopeApplyConfiguration { + b.Status = value + return b +} + +// GetKind retrieves the value of the Kind field in the declarative configuration. +func (b *AddressScopeApplyConfiguration) GetKind() *string { + return b.TypeMetaApplyConfiguration.Kind +} + +// GetAPIVersion retrieves the value of the APIVersion field in the declarative configuration. +func (b *AddressScopeApplyConfiguration) GetAPIVersion() *string { + return b.TypeMetaApplyConfiguration.APIVersion +} + +// GetName retrieves the value of the Name field in the declarative configuration. +func (b *AddressScopeApplyConfiguration) GetName() *string { + b.ensureObjectMetaApplyConfigurationExists() + return b.ObjectMetaApplyConfiguration.Name +} + +// GetNamespace retrieves the value of the Namespace field in the declarative configuration. +func (b *AddressScopeApplyConfiguration) GetNamespace() *string { + b.ensureObjectMetaApplyConfigurationExists() + return b.ObjectMetaApplyConfiguration.Namespace +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/addressscopefilter.go b/pkg/clients/applyconfiguration/api/v1alpha1/addressscopefilter.go new file mode 100644 index 000000000..646451d21 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/addressscopefilter.go @@ -0,0 +1,70 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" +) + +// AddressScopeFilterApplyConfiguration represents a declarative configuration of the AddressScopeFilter type for use +// with apply. +type AddressScopeFilterApplyConfiguration struct { + Name *apiv1alpha1.OpenStackName `json:"name,omitempty"` + ProjectRef *apiv1alpha1.KubernetesNameRef `json:"projectRef,omitempty"` + IPVersion *apiv1alpha1.IPVersion `json:"ipVersion,omitempty"` + Shared *bool `json:"shared,omitempty"` +} + +// AddressScopeFilterApplyConfiguration constructs a declarative configuration of the AddressScopeFilter type for use with +// apply. +func AddressScopeFilter() *AddressScopeFilterApplyConfiguration { + return &AddressScopeFilterApplyConfiguration{} +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *AddressScopeFilterApplyConfiguration) WithName(value apiv1alpha1.OpenStackName) *AddressScopeFilterApplyConfiguration { + b.Name = &value + return b +} + +// WithProjectRef sets the ProjectRef field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ProjectRef field is set to the value of the last call. +func (b *AddressScopeFilterApplyConfiguration) WithProjectRef(value apiv1alpha1.KubernetesNameRef) *AddressScopeFilterApplyConfiguration { + b.ProjectRef = &value + return b +} + +// WithIPVersion sets the IPVersion field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the IPVersion field is set to the value of the last call. +func (b *AddressScopeFilterApplyConfiguration) WithIPVersion(value apiv1alpha1.IPVersion) *AddressScopeFilterApplyConfiguration { + b.IPVersion = &value + return b +} + +// WithShared sets the Shared field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Shared field is set to the value of the last call. +func (b *AddressScopeFilterApplyConfiguration) WithShared(value bool) *AddressScopeFilterApplyConfiguration { + b.Shared = &value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/addressscopeimport.go b/pkg/clients/applyconfiguration/api/v1alpha1/addressscopeimport.go new file mode 100644 index 000000000..a1e787e7a --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/addressscopeimport.go @@ -0,0 +1,48 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +// AddressScopeImportApplyConfiguration represents a declarative configuration of the AddressScopeImport type for use +// with apply. +type AddressScopeImportApplyConfiguration struct { + ID *string `json:"id,omitempty"` + Filter *AddressScopeFilterApplyConfiguration `json:"filter,omitempty"` +} + +// AddressScopeImportApplyConfiguration constructs a declarative configuration of the AddressScopeImport type for use with +// apply. +func AddressScopeImport() *AddressScopeImportApplyConfiguration { + return &AddressScopeImportApplyConfiguration{} +} + +// WithID sets the ID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ID field is set to the value of the last call. +func (b *AddressScopeImportApplyConfiguration) WithID(value string) *AddressScopeImportApplyConfiguration { + b.ID = &value + return b +} + +// WithFilter sets the Filter field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Filter field is set to the value of the last call. +func (b *AddressScopeImportApplyConfiguration) WithFilter(value *AddressScopeFilterApplyConfiguration) *AddressScopeImportApplyConfiguration { + b.Filter = value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/addressscoperesourcespec.go b/pkg/clients/applyconfiguration/api/v1alpha1/addressscoperesourcespec.go new file mode 100644 index 000000000..8fb3db96b --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/addressscoperesourcespec.go @@ -0,0 +1,70 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" +) + +// AddressScopeResourceSpecApplyConfiguration represents a declarative configuration of the AddressScopeResourceSpec type for use +// with apply. +type AddressScopeResourceSpecApplyConfiguration struct { + Name *apiv1alpha1.OpenStackName `json:"name,omitempty"` + ProjectRef *apiv1alpha1.KubernetesNameRef `json:"projectRef,omitempty"` + IPVersion *apiv1alpha1.IPVersion `json:"ipVersion,omitempty"` + Shared *bool `json:"shared,omitempty"` +} + +// AddressScopeResourceSpecApplyConfiguration constructs a declarative configuration of the AddressScopeResourceSpec type for use with +// apply. +func AddressScopeResourceSpec() *AddressScopeResourceSpecApplyConfiguration { + return &AddressScopeResourceSpecApplyConfiguration{} +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *AddressScopeResourceSpecApplyConfiguration) WithName(value apiv1alpha1.OpenStackName) *AddressScopeResourceSpecApplyConfiguration { + b.Name = &value + return b +} + +// WithProjectRef sets the ProjectRef field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ProjectRef field is set to the value of the last call. +func (b *AddressScopeResourceSpecApplyConfiguration) WithProjectRef(value apiv1alpha1.KubernetesNameRef) *AddressScopeResourceSpecApplyConfiguration { + b.ProjectRef = &value + return b +} + +// WithIPVersion sets the IPVersion field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the IPVersion field is set to the value of the last call. +func (b *AddressScopeResourceSpecApplyConfiguration) WithIPVersion(value apiv1alpha1.IPVersion) *AddressScopeResourceSpecApplyConfiguration { + b.IPVersion = &value + return b +} + +// WithShared sets the Shared field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Shared field is set to the value of the last call. +func (b *AddressScopeResourceSpecApplyConfiguration) WithShared(value bool) *AddressScopeResourceSpecApplyConfiguration { + b.Shared = &value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/addressscoperesourcestatus.go b/pkg/clients/applyconfiguration/api/v1alpha1/addressscoperesourcestatus.go new file mode 100644 index 000000000..baae40d75 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/addressscoperesourcestatus.go @@ -0,0 +1,66 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +// AddressScopeResourceStatusApplyConfiguration represents a declarative configuration of the AddressScopeResourceStatus type for use +// with apply. +type AddressScopeResourceStatusApplyConfiguration struct { + Name *string `json:"name,omitempty"` + ProjectID *string `json:"projectID,omitempty"` + IPVersion *int32 `json:"ipVersion,omitempty"` + Shared *bool `json:"shared,omitempty"` +} + +// AddressScopeResourceStatusApplyConfiguration constructs a declarative configuration of the AddressScopeResourceStatus type for use with +// apply. +func AddressScopeResourceStatus() *AddressScopeResourceStatusApplyConfiguration { + return &AddressScopeResourceStatusApplyConfiguration{} +} + +// WithName sets the Name field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Name field is set to the value of the last call. +func (b *AddressScopeResourceStatusApplyConfiguration) WithName(value string) *AddressScopeResourceStatusApplyConfiguration { + b.Name = &value + return b +} + +// WithProjectID sets the ProjectID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ProjectID field is set to the value of the last call. +func (b *AddressScopeResourceStatusApplyConfiguration) WithProjectID(value string) *AddressScopeResourceStatusApplyConfiguration { + b.ProjectID = &value + return b +} + +// WithIPVersion sets the IPVersion field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the IPVersion field is set to the value of the last call. +func (b *AddressScopeResourceStatusApplyConfiguration) WithIPVersion(value int32) *AddressScopeResourceStatusApplyConfiguration { + b.IPVersion = &value + return b +} + +// WithShared sets the Shared field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Shared field is set to the value of the last call. +func (b *AddressScopeResourceStatusApplyConfiguration) WithShared(value bool) *AddressScopeResourceStatusApplyConfiguration { + b.Shared = &value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/addressscopespec.go b/pkg/clients/applyconfiguration/api/v1alpha1/addressscopespec.go new file mode 100644 index 000000000..4a42ce57c --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/addressscopespec.go @@ -0,0 +1,79 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" +) + +// AddressScopeSpecApplyConfiguration represents a declarative configuration of the AddressScopeSpec type for use +// with apply. +type AddressScopeSpecApplyConfiguration struct { + Import *AddressScopeImportApplyConfiguration `json:"import,omitempty"` + Resource *AddressScopeResourceSpecApplyConfiguration `json:"resource,omitempty"` + ManagementPolicy *apiv1alpha1.ManagementPolicy `json:"managementPolicy,omitempty"` + ManagedOptions *ManagedOptionsApplyConfiguration `json:"managedOptions,omitempty"` + CloudCredentialsRef *CloudCredentialsReferenceApplyConfiguration `json:"cloudCredentialsRef,omitempty"` +} + +// AddressScopeSpecApplyConfiguration constructs a declarative configuration of the AddressScopeSpec type for use with +// apply. +func AddressScopeSpec() *AddressScopeSpecApplyConfiguration { + return &AddressScopeSpecApplyConfiguration{} +} + +// WithImport sets the Import field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Import field is set to the value of the last call. +func (b *AddressScopeSpecApplyConfiguration) WithImport(value *AddressScopeImportApplyConfiguration) *AddressScopeSpecApplyConfiguration { + b.Import = value + return b +} + +// WithResource sets the Resource field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Resource field is set to the value of the last call. +func (b *AddressScopeSpecApplyConfiguration) WithResource(value *AddressScopeResourceSpecApplyConfiguration) *AddressScopeSpecApplyConfiguration { + b.Resource = value + return b +} + +// WithManagementPolicy sets the ManagementPolicy field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ManagementPolicy field is set to the value of the last call. +func (b *AddressScopeSpecApplyConfiguration) WithManagementPolicy(value apiv1alpha1.ManagementPolicy) *AddressScopeSpecApplyConfiguration { + b.ManagementPolicy = &value + return b +} + +// WithManagedOptions sets the ManagedOptions field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ManagedOptions field is set to the value of the last call. +func (b *AddressScopeSpecApplyConfiguration) WithManagedOptions(value *ManagedOptionsApplyConfiguration) *AddressScopeSpecApplyConfiguration { + b.ManagedOptions = value + return b +} + +// WithCloudCredentialsRef sets the CloudCredentialsRef field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the CloudCredentialsRef field is set to the value of the last call. +func (b *AddressScopeSpecApplyConfiguration) WithCloudCredentialsRef(value *CloudCredentialsReferenceApplyConfiguration) *AddressScopeSpecApplyConfiguration { + b.CloudCredentialsRef = value + return b +} diff --git a/pkg/clients/applyconfiguration/api/v1alpha1/addressscopestatus.go b/pkg/clients/applyconfiguration/api/v1alpha1/addressscopestatus.go new file mode 100644 index 000000000..c2d823af0 --- /dev/null +++ b/pkg/clients/applyconfiguration/api/v1alpha1/addressscopestatus.go @@ -0,0 +1,66 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by applyconfiguration-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + v1 "k8s.io/client-go/applyconfigurations/meta/v1" +) + +// AddressScopeStatusApplyConfiguration represents a declarative configuration of the AddressScopeStatus type for use +// with apply. +type AddressScopeStatusApplyConfiguration struct { + Conditions []v1.ConditionApplyConfiguration `json:"conditions,omitempty"` + ID *string `json:"id,omitempty"` + Resource *AddressScopeResourceStatusApplyConfiguration `json:"resource,omitempty"` +} + +// AddressScopeStatusApplyConfiguration constructs a declarative configuration of the AddressScopeStatus type for use with +// apply. +func AddressScopeStatus() *AddressScopeStatusApplyConfiguration { + return &AddressScopeStatusApplyConfiguration{} +} + +// WithConditions adds the given value to the Conditions field in the declarative configuration +// and returns the receiver, so that objects can be build by chaining "With" function invocations. +// If called multiple times, values provided by each call will be appended to the Conditions field. +func (b *AddressScopeStatusApplyConfiguration) WithConditions(values ...*v1.ConditionApplyConfiguration) *AddressScopeStatusApplyConfiguration { + for i := range values { + if values[i] == nil { + panic("nil value passed to WithConditions") + } + b.Conditions = append(b.Conditions, *values[i]) + } + return b +} + +// WithID sets the ID field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the ID field is set to the value of the last call. +func (b *AddressScopeStatusApplyConfiguration) WithID(value string) *AddressScopeStatusApplyConfiguration { + b.ID = &value + return b +} + +// WithResource sets the Resource field in the declarative configuration to the given value +// and returns the receiver, so that objects can be built by chaining "With" function invocations. +// If called multiple times, the Resource field is set to the value of the last call. +func (b *AddressScopeStatusApplyConfiguration) WithResource(value *AddressScopeResourceStatusApplyConfiguration) *AddressScopeStatusApplyConfiguration { + b.Resource = value + return b +} diff --git a/pkg/clients/applyconfiguration/internal/internal.go b/pkg/clients/applyconfiguration/internal/internal.go index 87e4f6e86..bca4e6606 100644 --- a/pkg/clients/applyconfiguration/internal/internal.go +++ b/pkg/clients/applyconfiguration/internal/internal.go @@ -48,6 +48,118 @@ var schemaYAML = typed.YAMLObject(`types: - name: subnetRef type: scalar: string +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.AddressScope + map: + fields: + - name: apiVersion + type: + scalar: string + - name: kind + type: + scalar: string + - name: metadata + type: + namedType: io.k8s.apimachinery.pkg.apis.meta.v1.ObjectMeta + default: {} + - name: spec + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.AddressScopeSpec + default: {} + - name: status + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.AddressScopeStatus + default: {} +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.AddressScopeFilter + map: + fields: + - name: ipVersion + type: + scalar: numeric + - name: name + type: + scalar: string + - name: projectRef + type: + scalar: string + - name: shared + type: + scalar: boolean +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.AddressScopeImport + map: + fields: + - name: filter + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.AddressScopeFilter + - name: id + type: + scalar: string +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.AddressScopeResourceSpec + map: + fields: + - name: ipVersion + type: + scalar: numeric + default: 0 + - name: name + type: + scalar: string + - name: projectRef + type: + scalar: string + - name: shared + type: + scalar: boolean +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.AddressScopeResourceStatus + map: + fields: + - name: ipVersion + type: + scalar: numeric + - name: name + type: + scalar: string + - name: projectID + type: + scalar: string + - name: shared + type: + scalar: boolean +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.AddressScopeSpec + map: + fields: + - name: cloudCredentialsRef + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.CloudCredentialsReference + default: {} + - name: import + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.AddressScopeImport + - name: managedOptions + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.ManagedOptions + - name: managementPolicy + type: + scalar: string + - name: resource + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.AddressScopeResourceSpec +- name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.AddressScopeStatus + map: + fields: + - name: conditions + type: + list: + elementType: + namedType: io.k8s.apimachinery.pkg.apis.meta.v1.Condition + elementRelationship: associative + keys: + - type + - name: id + type: + scalar: string + - name: resource + type: + namedType: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.AddressScopeResourceStatus - name: com.github.k-orc.openstack-resource-controller.v2.api.v1alpha1.AllocationPool map: fields: diff --git a/pkg/clients/applyconfiguration/utils.go b/pkg/clients/applyconfiguration/utils.go index 1b58223cf..6460b10e6 100644 --- a/pkg/clients/applyconfiguration/utils.go +++ b/pkg/clients/applyconfiguration/utils.go @@ -34,6 +34,20 @@ func ForKind(kind schema.GroupVersionKind) interface{} { // Group=openstack.k-orc.cloud, Version=v1alpha1 case v1alpha1.SchemeGroupVersion.WithKind("Address"): return &apiv1alpha1.AddressApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("AddressScope"): + return &apiv1alpha1.AddressScopeApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("AddressScopeFilter"): + return &apiv1alpha1.AddressScopeFilterApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("AddressScopeImport"): + return &apiv1alpha1.AddressScopeImportApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("AddressScopeResourceSpec"): + return &apiv1alpha1.AddressScopeResourceSpecApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("AddressScopeResourceStatus"): + return &apiv1alpha1.AddressScopeResourceStatusApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("AddressScopeSpec"): + return &apiv1alpha1.AddressScopeSpecApplyConfiguration{} + case v1alpha1.SchemeGroupVersion.WithKind("AddressScopeStatus"): + return &apiv1alpha1.AddressScopeStatusApplyConfiguration{} case v1alpha1.SchemeGroupVersion.WithKind("AllocationPool"): return &apiv1alpha1.AllocationPoolApplyConfiguration{} case v1alpha1.SchemeGroupVersion.WithKind("AllocationPoolStatus"): diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/addressscope.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/addressscope.go new file mode 100644 index 000000000..463d3a12c --- /dev/null +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/addressscope.go @@ -0,0 +1,74 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by client-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + context "context" + + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + applyconfigurationapiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" + scheme "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/clientset/clientset/scheme" + v1 "k8s.io/apimachinery/pkg/apis/meta/v1" + types "k8s.io/apimachinery/pkg/types" + watch "k8s.io/apimachinery/pkg/watch" + gentype "k8s.io/client-go/gentype" +) + +// AddressScopesGetter has a method to return a AddressScopeInterface. +// A group's client should implement this interface. +type AddressScopesGetter interface { + AddressScopes(namespace string) AddressScopeInterface +} + +// AddressScopeInterface has methods to work with AddressScope resources. +type AddressScopeInterface interface { + Create(ctx context.Context, addressScope *apiv1alpha1.AddressScope, opts v1.CreateOptions) (*apiv1alpha1.AddressScope, error) + Update(ctx context.Context, addressScope *apiv1alpha1.AddressScope, opts v1.UpdateOptions) (*apiv1alpha1.AddressScope, error) + // Add a +genclient:noStatus comment above the type to avoid generating UpdateStatus(). + UpdateStatus(ctx context.Context, addressScope *apiv1alpha1.AddressScope, opts v1.UpdateOptions) (*apiv1alpha1.AddressScope, error) + Delete(ctx context.Context, name string, opts v1.DeleteOptions) error + DeleteCollection(ctx context.Context, opts v1.DeleteOptions, listOpts v1.ListOptions) error + Get(ctx context.Context, name string, opts v1.GetOptions) (*apiv1alpha1.AddressScope, error) + List(ctx context.Context, opts v1.ListOptions) (*apiv1alpha1.AddressScopeList, error) + Watch(ctx context.Context, opts v1.ListOptions) (watch.Interface, error) + Patch(ctx context.Context, name string, pt types.PatchType, data []byte, opts v1.PatchOptions, subresources ...string) (result *apiv1alpha1.AddressScope, err error) + Apply(ctx context.Context, addressScope *applyconfigurationapiv1alpha1.AddressScopeApplyConfiguration, opts v1.ApplyOptions) (result *apiv1alpha1.AddressScope, err error) + // Add a +genclient:noStatus comment above the type to avoid generating ApplyStatus(). + ApplyStatus(ctx context.Context, addressScope *applyconfigurationapiv1alpha1.AddressScopeApplyConfiguration, opts v1.ApplyOptions) (result *apiv1alpha1.AddressScope, err error) + AddressScopeExpansion +} + +// addressScopes implements AddressScopeInterface +type addressScopes struct { + *gentype.ClientWithListAndApply[*apiv1alpha1.AddressScope, *apiv1alpha1.AddressScopeList, *applyconfigurationapiv1alpha1.AddressScopeApplyConfiguration] +} + +// newAddressScopes returns a AddressScopes +func newAddressScopes(c *OpenstackV1alpha1Client, namespace string) *addressScopes { + return &addressScopes{ + gentype.NewClientWithListAndApply[*apiv1alpha1.AddressScope, *apiv1alpha1.AddressScopeList, *applyconfigurationapiv1alpha1.AddressScopeApplyConfiguration]( + "addressscopes", + c.RESTClient(), + scheme.ParameterCodec, + namespace, + func() *apiv1alpha1.AddressScope { return &apiv1alpha1.AddressScope{} }, + func() *apiv1alpha1.AddressScopeList { return &apiv1alpha1.AddressScopeList{} }, + ), + } +} diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go index 7c2e4e67d..119869731 100644 --- a/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/api_client.go @@ -28,6 +28,7 @@ import ( type OpenstackV1alpha1Interface interface { RESTClient() rest.Interface + AddressScopesGetter DomainsGetter EndpointsGetter FlavorsGetter @@ -56,6 +57,10 @@ type OpenstackV1alpha1Client struct { restClient rest.Interface } +func (c *OpenstackV1alpha1Client) AddressScopes(namespace string) AddressScopeInterface { + return newAddressScopes(c, namespace) +} + func (c *OpenstackV1alpha1Client) Domains(namespace string) DomainInterface { return newDomains(c, namespace) } diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_addressscope.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_addressscope.go new file mode 100644 index 000000000..549024d55 --- /dev/null +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_addressscope.go @@ -0,0 +1,53 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by client-gen. DO NOT EDIT. + +package fake + +import ( + v1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" + typedapiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/clientset/clientset/typed/api/v1alpha1" + gentype "k8s.io/client-go/gentype" +) + +// fakeAddressScopes implements AddressScopeInterface +type fakeAddressScopes struct { + *gentype.FakeClientWithListAndApply[*v1alpha1.AddressScope, *v1alpha1.AddressScopeList, *apiv1alpha1.AddressScopeApplyConfiguration] + Fake *FakeOpenstackV1alpha1 +} + +func newFakeAddressScopes(fake *FakeOpenstackV1alpha1, namespace string) typedapiv1alpha1.AddressScopeInterface { + return &fakeAddressScopes{ + gentype.NewFakeClientWithListAndApply[*v1alpha1.AddressScope, *v1alpha1.AddressScopeList, *apiv1alpha1.AddressScopeApplyConfiguration]( + fake.Fake, + namespace, + v1alpha1.SchemeGroupVersion.WithResource("addressscopes"), + v1alpha1.SchemeGroupVersion.WithKind("AddressScope"), + func() *v1alpha1.AddressScope { return &v1alpha1.AddressScope{} }, + func() *v1alpha1.AddressScopeList { return &v1alpha1.AddressScopeList{} }, + func(dst, src *v1alpha1.AddressScopeList) { dst.ListMeta = src.ListMeta }, + func(list *v1alpha1.AddressScopeList) []*v1alpha1.AddressScope { + return gentype.ToPointerSlice(list.Items) + }, + func(list *v1alpha1.AddressScopeList, items []*v1alpha1.AddressScope) { + list.Items = gentype.FromPointerSlice(items) + }, + ), + fake, + } +} diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go index 2b7ba89cc..c9d511137 100644 --- a/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/fake/fake_api_client.go @@ -28,6 +28,10 @@ type FakeOpenstackV1alpha1 struct { *testing.Fake } +func (c *FakeOpenstackV1alpha1) AddressScopes(namespace string) v1alpha1.AddressScopeInterface { + return newFakeAddressScopes(c, namespace) +} + func (c *FakeOpenstackV1alpha1) Domains(namespace string) v1alpha1.DomainInterface { return newFakeDomains(c, namespace) } diff --git a/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go b/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go index e34607a4b..090359485 100644 --- a/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go +++ b/pkg/clients/clientset/clientset/typed/api/v1alpha1/generated_expansion.go @@ -18,6 +18,8 @@ limitations under the License. package v1alpha1 +type AddressScopeExpansion interface{} + type DomainExpansion interface{} type EndpointExpansion interface{} diff --git a/pkg/clients/informers/externalversions/api/v1alpha1/addressscope.go b/pkg/clients/informers/externalversions/api/v1alpha1/addressscope.go new file mode 100644 index 000000000..39f360e11 --- /dev/null +++ b/pkg/clients/informers/externalversions/api/v1alpha1/addressscope.go @@ -0,0 +1,102 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by informer-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + context "context" + time "time" + + v2apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + clientset "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/clientset/clientset" + internalinterfaces "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/informers/externalversions/internalinterfaces" + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/listers/api/v1alpha1" + v1 "k8s.io/apimachinery/pkg/apis/meta/v1" + runtime "k8s.io/apimachinery/pkg/runtime" + watch "k8s.io/apimachinery/pkg/watch" + cache "k8s.io/client-go/tools/cache" +) + +// AddressScopeInformer provides access to a shared informer and lister for +// AddressScopes. +type AddressScopeInformer interface { + Informer() cache.SharedIndexInformer + Lister() apiv1alpha1.AddressScopeLister +} + +type addressScopeInformer struct { + factory internalinterfaces.SharedInformerFactory + tweakListOptions internalinterfaces.TweakListOptionsFunc + namespace string +} + +// NewAddressScopeInformer constructs a new informer for AddressScope type. +// Always prefer using an informer factory to get a shared informer instead of getting an independent +// one. This reduces memory footprint and number of connections to the server. +func NewAddressScopeInformer(client clientset.Interface, namespace string, resyncPeriod time.Duration, indexers cache.Indexers) cache.SharedIndexInformer { + return NewFilteredAddressScopeInformer(client, namespace, resyncPeriod, indexers, nil) +} + +// NewFilteredAddressScopeInformer constructs a new informer for AddressScope type. +// Always prefer using an informer factory to get a shared informer instead of getting an independent +// one. This reduces memory footprint and number of connections to the server. +func NewFilteredAddressScopeInformer(client clientset.Interface, namespace string, resyncPeriod time.Duration, indexers cache.Indexers, tweakListOptions internalinterfaces.TweakListOptionsFunc) cache.SharedIndexInformer { + return cache.NewSharedIndexInformer( + &cache.ListWatch{ + ListFunc: func(options v1.ListOptions) (runtime.Object, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().AddressScopes(namespace).List(context.Background(), options) + }, + WatchFunc: func(options v1.ListOptions) (watch.Interface, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().AddressScopes(namespace).Watch(context.Background(), options) + }, + ListWithContextFunc: func(ctx context.Context, options v1.ListOptions) (runtime.Object, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().AddressScopes(namespace).List(ctx, options) + }, + WatchFuncWithContext: func(ctx context.Context, options v1.ListOptions) (watch.Interface, error) { + if tweakListOptions != nil { + tweakListOptions(&options) + } + return client.OpenstackV1alpha1().AddressScopes(namespace).Watch(ctx, options) + }, + }, + &v2apiv1alpha1.AddressScope{}, + resyncPeriod, + indexers, + ) +} + +func (f *addressScopeInformer) defaultInformer(client clientset.Interface, resyncPeriod time.Duration) cache.SharedIndexInformer { + return NewFilteredAddressScopeInformer(client, f.namespace, resyncPeriod, cache.Indexers{cache.NamespaceIndex: cache.MetaNamespaceIndexFunc}, f.tweakListOptions) +} + +func (f *addressScopeInformer) Informer() cache.SharedIndexInformer { + return f.factory.InformerFor(&v2apiv1alpha1.AddressScope{}, f.defaultInformer) +} + +func (f *addressScopeInformer) Lister() apiv1alpha1.AddressScopeLister { + return apiv1alpha1.NewAddressScopeLister(f.Informer().GetIndexer()) +} diff --git a/pkg/clients/informers/externalversions/api/v1alpha1/interface.go b/pkg/clients/informers/externalversions/api/v1alpha1/interface.go index c9f62ae9c..a853d66ab 100644 --- a/pkg/clients/informers/externalversions/api/v1alpha1/interface.go +++ b/pkg/clients/informers/externalversions/api/v1alpha1/interface.go @@ -24,6 +24,8 @@ import ( // Interface provides access to all the informers in this group version. type Interface interface { + // AddressScopes returns a AddressScopeInformer. + AddressScopes() AddressScopeInformer // Domains returns a DomainInformer. Domains() DomainInformer // Endpoints returns a EndpointInformer. @@ -79,6 +81,11 @@ func New(f internalinterfaces.SharedInformerFactory, namespace string, tweakList return &version{factory: f, namespace: namespace, tweakListOptions: tweakListOptions} } +// AddressScopes returns a AddressScopeInformer. +func (v *version) AddressScopes() AddressScopeInformer { + return &addressScopeInformer{factory: v.factory, namespace: v.namespace, tweakListOptions: v.tweakListOptions} +} + // Domains returns a DomainInformer. func (v *version) Domains() DomainInformer { return &domainInformer{factory: v.factory, namespace: v.namespace, tweakListOptions: v.tweakListOptions} diff --git a/pkg/clients/informers/externalversions/generic.go b/pkg/clients/informers/externalversions/generic.go index a2cd276ae..04db4c8da 100644 --- a/pkg/clients/informers/externalversions/generic.go +++ b/pkg/clients/informers/externalversions/generic.go @@ -53,6 +53,8 @@ func (f *genericInformer) Lister() cache.GenericLister { func (f *sharedInformerFactory) ForResource(resource schema.GroupVersionResource) (GenericInformer, error) { switch resource { // Group=openstack.k-orc.cloud, Version=v1alpha1 + case v1alpha1.SchemeGroupVersion.WithResource("addressscopes"): + return &genericInformer{resource: resource.GroupResource(), informer: f.Openstack().V1alpha1().AddressScopes().Informer()}, nil case v1alpha1.SchemeGroupVersion.WithResource("domains"): return &genericInformer{resource: resource.GroupResource(), informer: f.Openstack().V1alpha1().Domains().Informer()}, nil case v1alpha1.SchemeGroupVersion.WithResource("endpoints"): diff --git a/pkg/clients/listers/api/v1alpha1/addressscope.go b/pkg/clients/listers/api/v1alpha1/addressscope.go new file mode 100644 index 000000000..b2a8b7929 --- /dev/null +++ b/pkg/clients/listers/api/v1alpha1/addressscope.go @@ -0,0 +1,70 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +// Code generated by lister-gen. DO NOT EDIT. + +package v1alpha1 + +import ( + apiv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + labels "k8s.io/apimachinery/pkg/labels" + listers "k8s.io/client-go/listers" + cache "k8s.io/client-go/tools/cache" +) + +// AddressScopeLister helps list AddressScopes. +// All objects returned here must be treated as read-only. +type AddressScopeLister interface { + // List lists all AddressScopes in the indexer. + // Objects returned here must be treated as read-only. + List(selector labels.Selector) (ret []*apiv1alpha1.AddressScope, err error) + // AddressScopes returns an object that can list and get AddressScopes. + AddressScopes(namespace string) AddressScopeNamespaceLister + AddressScopeListerExpansion +} + +// addressScopeLister implements the AddressScopeLister interface. +type addressScopeLister struct { + listers.ResourceIndexer[*apiv1alpha1.AddressScope] +} + +// NewAddressScopeLister returns a new AddressScopeLister. +func NewAddressScopeLister(indexer cache.Indexer) AddressScopeLister { + return &addressScopeLister{listers.New[*apiv1alpha1.AddressScope](indexer, apiv1alpha1.Resource("addressscope"))} +} + +// AddressScopes returns an object that can list and get AddressScopes. +func (s *addressScopeLister) AddressScopes(namespace string) AddressScopeNamespaceLister { + return addressScopeNamespaceLister{listers.NewNamespaced[*apiv1alpha1.AddressScope](s.ResourceIndexer, namespace)} +} + +// AddressScopeNamespaceLister helps list and get AddressScopes. +// All objects returned here must be treated as read-only. +type AddressScopeNamespaceLister interface { + // List lists all AddressScopes in the indexer for a given namespace. + // Objects returned here must be treated as read-only. + List(selector labels.Selector) (ret []*apiv1alpha1.AddressScope, err error) + // Get retrieves the AddressScope from the indexer for a given namespace and name. + // Objects returned here must be treated as read-only. + Get(name string) (*apiv1alpha1.AddressScope, error) + AddressScopeNamespaceListerExpansion +} + +// addressScopeNamespaceLister implements the AddressScopeNamespaceLister +// interface. +type addressScopeNamespaceLister struct { + listers.ResourceIndexer[*apiv1alpha1.AddressScope] +} diff --git a/pkg/clients/listers/api/v1alpha1/expansion_generated.go b/pkg/clients/listers/api/v1alpha1/expansion_generated.go index e2fc3b2d2..112762597 100644 --- a/pkg/clients/listers/api/v1alpha1/expansion_generated.go +++ b/pkg/clients/listers/api/v1alpha1/expansion_generated.go @@ -18,6 +18,14 @@ limitations under the License. package v1alpha1 +// AddressScopeListerExpansion allows custom methods to be added to +// AddressScopeLister. +type AddressScopeListerExpansion interface{} + +// AddressScopeNamespaceListerExpansion allows custom methods to be added to +// AddressScopeNamespaceLister. +type AddressScopeNamespaceListerExpansion interface{} + // DomainListerExpansion allows custom methods to be added to // DomainLister. type DomainListerExpansion interface{} diff --git a/test/apivalidations/addressscope_test.go b/test/apivalidations/addressscope_test.go new file mode 100644 index 000000000..2ac6246d9 --- /dev/null +++ b/test/apivalidations/addressscope_test.go @@ -0,0 +1,77 @@ +/* +Copyright The ORC Authors. + +Licensed under the Apache License, Version 2.0 (the "License"); +you may not use this file except in compliance with the License. +You may obtain a copy of the License at + + http://www.apache.org/licenses/LICENSE-2.0 + +Unless required by applicable law or agreed to in writing, software +distributed under the License is distributed on an "AS IS" BASIS, +WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. +See the License for the specific language governing permissions and +limitations under the License. +*/ + +package apivalidations + +import ( + "context" + + . "github.com/onsi/ginkgo/v2" + . "github.com/onsi/gomega" + corev1 "k8s.io/api/core/v1" + "sigs.k8s.io/controller-runtime/pkg/client" + + orcv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/api/v1alpha1" + applyconfigv1alpha1 "github.com/k-orc/openstack-resource-controller/v2/pkg/clients/applyconfiguration/api/v1alpha1" +) + +const ( + addressScopeObjName = "addressscope" +) + +func addressScopeStub(namespace *corev1.Namespace) *orcv1alpha1.AddressScope { + obj := &orcv1alpha1.AddressScope{} + obj.Name = addressScopeObjName + obj.Namespace = namespace.Name + return obj +} + +func baseAddressScopePatch(addressScope client.Object) *applyconfigv1alpha1.AddressScopeApplyConfiguration { + return applyconfigv1alpha1.AddressScope(addressScope.GetName(), addressScope.GetNamespace()). + WithSpec(applyconfigv1alpha1.AddressScopeSpec(). + WithCloudCredentialsRef(testCredentials())) +} + +var _ = Describe("ORC AddressScope API validations", func() { + var namespace *corev1.Namespace + BeforeEach(func() { + namespace = createNamespace() + }) + + When("updating the shared field", func() { + It("should permit share a unshared address scope", func(ctx context.Context) { + addressScope := addressScopeStub(namespace) + patch := baseAddressScopePatch(addressScope) + patch.Spec.WithResource(applyconfigv1alpha1.AddressScopeResourceSpec(). + WithIPVersion(orcv1alpha1.IPVersion(4)). + WithShared(false)) + Expect(applyObj(ctx, addressScope, patch)).To(Succeed()) + patch.Spec.WithResource(patch.Spec.Resource).Resource.WithShared(true) + Expect(applyObj(ctx, addressScope, patch)).To(Succeed()) + }) + + It("should not permit unshare a shared address scope", func(ctx context.Context) { + addressScope := addressScopeStub(namespace) + patch := baseAddressScopePatch(addressScope) + patch.Spec.WithResource(applyconfigv1alpha1.AddressScopeResourceSpec(). + WithIPVersion(orcv1alpha1.IPVersion(4)). + WithShared(true)) + Expect(applyObj(ctx, addressScope, patch)).To(Succeed()) + patch.Spec.WithResource(patch.Spec.Resource).Resource.WithShared(false) + Expect(applyObj(ctx, addressScope, patch)).To(MatchError(ContainSubstring("shared address scope can't be unshared"))) + }) + }) +}) diff --git a/website/docs/crd-reference.md b/website/docs/crd-reference.md index ebec04a84..963cc5cdb 100644 --- a/website/docs/crd-reference.md +++ b/website/docs/crd-reference.md @@ -10,6 +10,7 @@ Package v1alpha1 contains API Schema definitions for the openstack v1alpha1 API ### Resource Types +- [AddressScope](#addressscope) - [Domain](#domain) - [Endpoint](#endpoint) - [Flavor](#flavor) @@ -51,12 +52,141 @@ _Appears in:_ | `subnetRef` _[KubernetesNameRef](#kubernetesnameref)_ | subnetRef references the subnet from which to allocate the IP
address. | | MaxLength: 253
MinLength: 1
| +#### AddressScope +AddressScope is the Schema for an ORC resource. + + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `apiVersion` _string_ | `openstack.k-orc.cloud/v1alpha1` | | | +| `kind` _string_ | `AddressScope` | | | +| `metadata` _[ObjectMeta](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#objectmeta-v1-meta)_ | Refer to Kubernetes API documentation for fields of `metadata`. | | | +| `spec` _[AddressScopeSpec](#addressscopespec)_ | spec specifies the desired state of the resource. | | | +| `status` _[AddressScopeStatus](#addressscopestatus)_ | status defines the observed state of the resource. | | | + + +#### AddressScopeFilter + + + +AddressScopeFilter defines an existing resource by its properties + +_Validation:_ +- MinProperties: 1 + +_Appears in:_ +- [AddressScopeImport](#addressscopeimport) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `name` _[OpenStackName](#openstackname)_ | name of the existing resource | | MaxLength: 255
MinLength: 1
Pattern: `^[^,]+$`
| +| `projectRef` _[KubernetesNameRef](#kubernetesnameref)_ | projectRef is a reference to the ORC Project which this resource is associated with. | | MaxLength: 253
MinLength: 1
| +| `ipVersion` _[IPVersion](#ipversion)_ | ipVersion is the IP protocol version. | | Enum: [4 6]
| +| `shared` _boolean_ | shared indicates whether this resource is shared across all
projects or not. By default, only admin users can change set
this value. | | | + + +#### AddressScopeImport + + + +AddressScopeImport specifies an existing resource which will be imported instead of +creating a new one + +_Validation:_ +- MaxProperties: 1 +- MinProperties: 1 + +_Appears in:_ +- [AddressScopeSpec](#addressscopespec) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `id` _string_ | id contains the unique identifier of an existing OpenStack resource. Note
that when specifying an import by ID, the resource MUST already exist.
The ORC object will enter an error state if the resource does not exist. | | Format: uuid
MaxLength: 36
| +| `filter` _[AddressScopeFilter](#addressscopefilter)_ | filter contains a resource query which is expected to return a single
result. The controller will continue to retry if filter returns no
results. If filter returns multiple results the controller will set an
error state and will not continue to retry. | | MinProperties: 1
| + + +#### AddressScopeResourceSpec + + + +AddressScopeResourceSpec contains the desired state of the resource. + + + +_Appears in:_ +- [AddressScopeSpec](#addressscopespec) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `name` _[OpenStackName](#openstackname)_ | name will be the name of the created resource. If not specified, the
name of the ORC object will be used. | | MaxLength: 255
MinLength: 1
Pattern: `^[^,]+$`
| +| `projectRef` _[KubernetesNameRef](#kubernetesnameref)_ | projectRef is a reference to the ORC Project which this resource is associated with. | | MaxLength: 253
MinLength: 1
| +| `ipVersion` _[IPVersion](#ipversion)_ | ipVersion is the IP protocol version. | | Enum: [4 6]
| +| `shared` _boolean_ | shared indicates whether this resource is shared across all
projects or not. By default, only admin users can change set
this value. We can't unshared a shared address scope; Neutron
enforces this. | | | + + +#### AddressScopeResourceStatus + + + +AddressScopeResourceStatus represents the observed state of the resource. + + + +_Appears in:_ +- [AddressScopeStatus](#addressscopestatus) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `name` _string_ | name is a Human-readable name for the resource. Might not be unique. | | MaxLength: 1024
| +| `projectID` _string_ | projectID is the ID of the Project to which the resource is associated. | | MaxLength: 1024
| +| `ipVersion` _integer_ | ipVersion is the IP protocol version. | | | +| `shared` _boolean_ | shared indicates whether this resource is shared across all
projects or not. By default, only admin users can change set
this value. | | | + + +#### AddressScopeSpec + + + +AddressScopeSpec defines the desired state of an ORC object. + + + +_Appears in:_ +- [AddressScope](#addressscope) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `import` _[AddressScopeImport](#addressscopeimport)_ | import refers to an existing OpenStack resource which will be imported instead of
creating a new one. | | MaxProperties: 1
MinProperties: 1
| +| `resource` _[AddressScopeResourceSpec](#addressscoperesourcespec)_ | resource specifies the desired state of the resource.
resource may not be specified if the management policy is `unmanaged`.
resource must be specified if the management policy is `managed`. | | | +| `managementPolicy` _[ManagementPolicy](#managementpolicy)_ | managementPolicy defines how ORC will treat the object. Valid values are
`managed`: ORC will create, update, and delete the resource; `unmanaged`:
ORC will import an existing resource, and will not apply updates to it or
delete it. | managed | Enum: [managed unmanaged]
| +| `managedOptions` _[ManagedOptions](#managedoptions)_ | managedOptions specifies options which may be applied to managed objects. | | | +| `cloudCredentialsRef` _[CloudCredentialsReference](#cloudcredentialsreference)_ | cloudCredentialsRef points to a secret containing OpenStack credentials | | | + + +#### AddressScopeStatus + + + +AddressScopeStatus defines the observed state of an ORC resource. + + + +_Appears in:_ +- [AddressScope](#addressscope) + +| Field | Description | Default | Validation | +| --- | --- | --- | --- | +| `conditions` _[Condition](https://kubernetes.io/docs/reference/generated/kubernetes-api/v1.29/#condition-v1-meta) array_ | conditions represents the observed status of the object.
Known .status.conditions.type are: "Available", "Progressing"
Available represents the availability of the OpenStack resource. If it is
true then the resource is ready for use.
Progressing indicates whether the controller is still attempting to
reconcile the current state of the OpenStack resource to the desired
state. Progressing will be False either because the desired state has
been achieved, or because some terminal error prevents it from ever being
achieved and the controller is no longer attempting to reconcile. If
Progressing is True, an observer waiting on the resource should continue
to wait. | | MaxItems: 32
| +| `id` _string_ | id is the unique identifier of the OpenStack resource. | | MaxLength: 1024
| +| `resource` _[AddressScopeResourceStatus](#addressscoperesourcestatus)_ | resource contains the observed state of the OpenStack resource. | | | + + #### AllocationPool @@ -171,6 +301,7 @@ CloudCredentialsReference is a reference to a secret containing OpenStack creden _Appears in:_ +- [AddressScopeSpec](#addressscopespec) - [DomainSpec](#domainspec) - [EndpointSpec](#endpointspec) - [FlavorSpec](#flavorspec) @@ -1103,6 +1234,8 @@ _Validation:_ - Enum: [4 6] _Appears in:_ +- [AddressScopeFilter](#addressscopefilter) +- [AddressScopeResourceSpec](#addressscoperesourcespec) - [SubnetFilter](#subnetfilter) - [SubnetResourceSpec](#subnetresourcespec) @@ -1851,6 +1984,7 @@ _Appears in:_ _Appears in:_ +- [AddressScopeSpec](#addressscopespec) - [DomainSpec](#domainspec) - [EndpointSpec](#endpointspec) - [FlavorSpec](#flavorspec) @@ -1887,6 +2021,7 @@ _Validation:_ - Enum: [managed unmanaged] _Appears in:_ +- [AddressScopeSpec](#addressscopespec) - [DomainSpec](#domainspec) - [EndpointSpec](#endpointspec) - [FlavorSpec](#flavorspec)